rtoss

Subversion Repositories:
Compare Path: Rev
With Path: Rev
/ @ 351  →  / @ 352
/Web Favorities/rss.php
@@ -8,7 +8,7 @@
 
if (isset($_GET["catid"])) {
$catqstr="AND catid = ".intval($_GET["catid"]);
$qry="SELECT * FROM Fav WHERE id = ".$_GET["catid"];
$qry="SELECT * FROM Fav WHERE id = ".intval($_GET["catid"]);
$rs=sqlite_query($conn,$qry);
$row = sqlite_fetch_array($rs);
$homeTitle=$homeTitle." - ".$row["name"];
/Web Favorities/fav_action.php
@@ -2,7 +2,7 @@
require("./fav_settings.php");
require("./fav_strings.php");
 
$conn=sqlite_popen($sqlite_file);
$db = new PDO('sqlite:./'.$sqlite_file, '', '', array(PDO::ATTR_PERSISTENT => true));
 
$iPass=val($_POST,"pwd");
$iAction=val($_GET,'action');
@@ -27,8 +27,8 @@
if (($iAction=="go") && ($iPass) && isset($_POST["h_id"]) && (($iPass==$FavPasswd) || ($iPass==$ViewPassword))) {
viewAuth('login',$iPass);
$qry="SELECT * FROM Fav WHERE id = ".$_POST["h_id"];
$rs=sqlite_query($conn,$qry);
$row = sqlite_fetch_array($rs);
$rs=$db->query($qry);
$row = $rs->fetch(PDO::FETCH_ASSOC);
header("Location: ".$row["addr"]);
} else {
if (($iAction=="go") && (!$iPass)) {
@@ -54,7 +54,7 @@
if (isset($_SESSION['isLogined']) || viewAuth()) {
switch ($iAction) {
case "add":
$_GET['url']=urlencode($_GET['url']); // encodes url again
$_GET['url']=preg_replace('/%([0189a-fA-F])/','%25\1',urlencode($_GET['url'])); // encodes url again, preserve %00-%1F,%80-%FF
$_GET['name']=urlencode(jsUCEsc2utf8($_GET['name'])); // encodes name again
header("Location: ".$BaseURL."fav_add.php?".toQueryString("catid",'name','url').$SidebarSuffix2);
break;
@@ -65,17 +65,17 @@
header("Location: ".$BaseURL."fav_del.php?".toQueryString('id').$SidebarSuffix2);
break;
case "order":
header("Location: ".$BaseURL."fav_reorder.php?".toQueryString('id').$SidebarSuffix2);
header("Location: ".$BaseURL."fav_reorder_2.php?".toQueryString('id').$SidebarSuffix2);
break;
case "go":
$qry="SELECT * FROM Fav WHERE id = ".$_GET["id"];
$rs=sqlite_query($conn,$qry);
$row = sqlite_fetch_array($rs);
$rs=$db->query($qry);
$row = $rs->fetch(PDO::FETCH_ASSOC);
header("Location: ".$row["addr"]);
break;
case "opt":
$qry="VACUUM Fav";
$rs=sqlite_exec($conn,$qry);
$rs=$db->exec($qry);
echo $MyFav_Action_Optimized.'<br><center>'.$MyFav_BackHTML.'</center>';
break;
default:
New file
/Web Favorities/tool-man.js
@@ -0,0 +1,21 @@
var ToolMan={events:function(){if(!ToolMan._eventsFactory)throw"ToolMan Events module isn't loaded";return ToolMan._eventsFactory},css:function(){if(!ToolMan._cssFactory)throw"ToolMan CSS module isn't loaded";return ToolMan._cssFactory},coordinates:function(){if(!ToolMan._coordinatesFactory)throw"ToolMan Coordinates module isn't loaded";return ToolMan._coordinatesFactory},drag:function(){if(!ToolMan._dragFactory)throw"ToolMan Drag module isn't loaded";return ToolMan._dragFactory},dragsort:function(){if(!ToolMan._dragsortFactory)throw"ToolMan DragSort module isn't loaded";
return ToolMan._dragsortFactory},helpers:function(){return ToolMan._helpers},cookies:function(){if(!ToolMan._cookieOven)throw"ToolMan Cookie module isn't loaded";return ToolMan._cookieOven},junkdrawer:function(){return ToolMan._junkdrawer}};
ToolMan._helpers={map:function(a,b){for(var c=0,d=a.length;c<d;c++)b(a[c])},nextItem:function(a,b){if(a!=null){for(a=a.nextSibling;a!=null;){if(a.nodeName==b)return a;a=a.nextSibling}return null}},previousItem:function(a,b){for(a=a.previousSibling;a!=null;){if(a.nodeName==b)return a;a=a.previousSibling}return null},moveBefore:function(a,b){var c=a.parentNode;c.removeChild(a);c.insertBefore(a,b)},moveAfter:function(a,b){var c=a.parentNode;c.removeChild(a);c.insertBefore(a,b?b.nextSibling:null)}};
ToolMan._junkdrawer={serializeList:function(a){a=a.getElementsByTagName("li");for(var b=[],c=0,d=a.length;c<d;c++){var e=a[c];b.push(ToolMan.junkdrawer()._identifier(e))}return b.join("|")},inspectListOrder:function(a){alert(ToolMan.junkdrawer().serializeList(document.getElementById(a)))},restoreListOrder:function(a){var b=document.getElementById(a);if(b!=null)if(a=ToolMan.cookies().get("list-"+a)){a=a.split("|");for(var c=ToolMan.junkdrawer()._itemsByID(b),d=0,e=a.length;d<e;d++){var f=a[d];if(f in
c){f=c[f];b.removeChild(f);b.insertBefore(f,null)}}}},_identifier:function(a){var b=ToolMan.junkdrawer().trim,c;c=b(a.getAttribute("id"));if(c!=null&&c.length>0)return c;c=b(a.getAttribute("itemID"));if(c!=null&&c.length>0)return c;return b(a.innerHTML)},_itemsByID:function(a){var b=[];a=a.getElementsByTagName("li");for(var c=0,d=a.length;c<d;c++){var e=a[c];b[ToolMan.junkdrawer()._identifier(e)]=e}return b},trim:function(a){if(a==null)return null;return a.replace(/^(\s+)?(.*\S)(\s+)?$/,"$2")}};ToolMan._cookieOven={set:function(a,b,c){if(c){var d=new Date;d.setTime(d.getTime()+c*24*60*60*1E3);c="; expires="+d.toGMTString()}else c="";document.cookie=a+"="+b+c+"; path=/"},get:function(a){a=a+"=";for(var b=document.cookie.split(";"),c=0,d=b.length;c<d;c++){for(var e=b[c];e.charAt(0)==" ";)e=e.substring(1,e.length);if(e.indexOf(a)==0)return e.substring(a.length,e.length)}return null},eraseCookie:function(a){createCookie(a,"",-1)}};ToolMan._coordinatesFactory={create:function(a,b){return new _ToolManCoordinate(this,a,b)},origin:function(){return this.create(0,0)},topLeftPosition:function(a){var b=parseInt(ToolMan.css().readStyle(a,"left"));b=isNaN(b)?0:b;a=parseInt(ToolMan.css().readStyle(a,"top"));a=isNaN(a)?0:a;return this.create(b,a)},bottomRightPosition:function(a){return this.topLeftPosition(a).plus(this._size(a))},topLeftOffset:function(a){var b=this._offset(a);for(a=a.offsetParent;a;){b=b.plus(this._offset(a));a=a.offsetParent}return b},
bottomRightOffset:function(a){return this.topLeftOffset(a).plus(this.create(a.offsetWidth,a.offsetHeight))},scrollOffset:function(){return window.pageXOffset?this.create(window.pageXOffset,window.pageYOffset):document.documentElement?this.create(document.body.scrollLeft+document.documentElement.scrollLeft,document.body.scrollTop+document.documentElement.scrollTop):document.body.scrollLeft>=0?this.create(document.body.scrollLeft,document.body.scrollTop):this.create(0,0)},clientSize:function(){return window.innerHeight>=
0?this.create(window.innerWidth,window.innerHeight):document.documentElement?this.create(document.documentElement.clientWidth,document.documentElement.clientHeight):document.body.clientHeight>=0?this.create(document.body.clientWidth,document.body.clientHeight):this.create(0,0)},mousePosition:function(a){a=ToolMan.events().fix(a);return this.create(a.clientX,a.clientY)},mouseOffset:function(a){a=ToolMan.events().fix(a);if(a.pageX>=0||a.pageX<0)return this.create(a.pageX,a.pageY);else if(a.clientX>=
0||a.clientX<0)return this.mousePosition(a).plus(this.scrollOffset())},_size:function(a){return this.create(a.offsetWidth,a.offsetHeight)},_offset:function(a){return this.create(a.offsetLeft,a.offsetTop)}};function _ToolManCoordinate(a,b,c){this.factory=a;this.x=isNaN(b)?0:b;this.y=isNaN(c)?0:c}
_ToolManCoordinate.prototype={toString:function(){return"("+this.x+","+this.y+")"},plus:function(a){return this.factory.create(this.x+a.x,this.y+a.y)},minus:function(a){return this.factory.create(this.x-a.x,this.y-a.y)},min:function(a){return this.factory.create(Math.min(this.x,a.x),Math.min(this.y,a.y))},max:function(a){return this.factory.create(Math.max(this.x,a.x),Math.max(this.y,a.y))},constrainTo:function(a,b){var c=a.min(b);a=a.max(b);return this.max(c).min(a)},distance:function(a){return Math.sqrt(Math.pow(this.x-
a.x,2)+Math.pow(this.y-a.y,2))},reposition:function(a){a.style.top=this.y+"px";a.style.left=this.x+"px"}};ToolMan._cssFactory={readStyle:function(a,b){return a.style[b]?a.style[b]:a.currentStyle?a.currentStyle[b]:document.defaultView&&document.defaultView.getComputedStyle?document.defaultView.getComputedStyle(a,null).getPropertyValue(b):null}};ToolMan._dragFactory={createSimpleGroup:function(a,b){b=b?b:a;a=this.createGroup(a);a.setHandle(b);a.transparentDrag();a.onTopWhileDragging();return a},createGroup:function(a){var b=new _ToolManDragGroup(this,a),c=ToolMan.css().readStyle(a,"position");if(c=="static")a.style.position="relative";else c=="absolute"&&ToolMan.coordinates().topLeftOffset(a).reposition(a);b.register("draginit",this._showDragEventStatus);b.register("dragmove",this._showDragEventStatus);b.register("dragend",this._showDragEventStatus);
return b},_showDragEventStatus:function(){},constraints:function(){return this._constraintFactory},_createEvent:function(a,b,c){return new _ToolManDragEvent(a,b,c)}};function _ToolManDragGroup(a,b){this.factory=a;this.element=b;this._handle=null;this._thresholdDistance=0;this._transforms=[];this._listeners=[];this._listeners.draginit=[];this._listeners.dragstart=[];this._listeners.dragmove=[];this._listeners.dragend=[]}
_ToolManDragGroup.prototype={setHandle:function(a){var b=ToolMan.events();a.toolManDragGroup=this;b.register(a,"mousedown",this._dragInit);a.onmousedown=function(){return false};this.element!=a&&b.unregister(this.element,"mousedown",this._dragInit)},register:function(a,b){this._listeners[a].push(b)},addTransform:function(a){this._transforms.push(a)},verticalOnly:function(){this.addTransform(this.factory.constraints().vertical())},horizontalOnly:function(){this.addTransform(this.factory.constraints().horizontal())},
setThreshold:function(a){this._thresholdDistance=a},transparentDrag:function(a){a=typeof a!="undefined"?a:0.75;var b=ToolMan.css().readStyle(this.element,"opacity");this.register("dragstart",function(c){c=c.group.element;c.style.opacity=a;c.style.filter="alpha(opacity="+a*100+")"});this.register("dragend",function(c){c=c.group.element;c.style.opacity=b;c.style.filter="alpha(opacity=100)"})},onTopWhileDragging:function(a){a=typeof a!="undefined"?a:1E5;var b=ToolMan.css().readStyle(this.element,"z-index");
this.register("dragstart",function(c){c.group.element.style.zIndex=a});this.register("dragend",function(c){c.group.element.style.zIndex=b})},_dragInit:function(a){a=ToolMan.events().fix(a);var b=document.toolManDragGroup=this.toolManDragGroup;a=b.factory._createEvent("draginit",a,b);b._isThresholdExceeded=false;b._initialMouseOffset=a.mouseOffset;b._grabOffset=a.mouseOffset.minus(a.topLeftOffset);ToolMan.events().register(document,"mousemove",b._drag);document.onmousemove=function(){return false};
ToolMan.events().register(document,"mouseup",b._dragEnd);b._notifyListeners(a)},_drag:function(a){a=ToolMan.events().fix(a);var b=ToolMan.coordinates(),c=this.toolManDragGroup;if(c){var d=c.factory._createEvent("dragmove",a,c),e=d.mouseOffset.minus(c._grabOffset);if(!c._isThresholdExceeded){if(d.mouseOffset.distance(c._initialMouseOffset)<c._thresholdDistance)return;c._isThresholdExceeded=true;c._notifyListeners(c.factory._createEvent("dragstart",a,c))}for(i in c._transforms)e=c._transforms[i](e,
d);a=e.minus(d.topLeftOffset);d.topLeftPosition.plus(a).reposition(c.element);d.transformedMouseOffset=e.plus(c._grabOffset);c._notifyListeners(d);d=e.minus(b.topLeftOffset(c.element));if(d.x!=0||d.y!=0)b.topLeftPosition(c.element).plus(d).reposition(c.element)}},_dragEnd:function(a){a=ToolMan.events().fix(a);var b=this.toolManDragGroup;a=b.factory._createEvent("dragend",a,b);b._notifyListeners(a);this.toolManDragGroup=null;ToolMan.events().unregister(document,"mousemove",b._drag);document.onmousemove=
null;ToolMan.events().unregister(document,"mouseup",b._dragEnd)},_notifyListeners:function(a){var b=this._listeners[a.type];for(i in b)b[i](a)}};function _ToolManDragEvent(a,b,c){this.type=a;this.group=c;this.mousePosition=ToolMan.coordinates().mousePosition(b);this.transformedMouseOffset=this.mouseOffset=ToolMan.coordinates().mouseOffset(b);this.topLeftPosition=ToolMan.coordinates().topLeftPosition(c.element);this.topLeftOffset=ToolMan.coordinates().topLeftOffset(c.element)}
_ToolManDragEvent.prototype={toString:function(){return"mouse: "+this.mousePosition+this.mouseOffset+" xmouse: "+this.transformedMouseOffset+" left,top: "+this.topLeftPosition+this.topLeftOffset}};ToolMan._dragFactory._constraintFactory={vertical:function(){return function(a,b){b=b.topLeftOffset.x;return a.x!=b?a.factory.create(b,a.y):a}},horizontal:function(){return function(a,b){b=b.topLeftOffset.y;return a.y!=b?a.factory.create(a.x,b):a}}};ToolMan._dragsortFactory={makeSortable:function(a){a=ToolMan.drag().createSimpleGroup(a);a.register("dragstart",this._onDragStart);a.register("dragmove",this._onDragMove);a.register("dragend",this._onDragEnd);return a},makeListSortable:function(a){var b=ToolMan.helpers(),c=ToolMan.coordinates(),d=a.getElementsByTagName("li");b.map(d,function(g){g=dragsort.makeSortable(g);g.setThreshold(4);var j,k;g.addTransform(function(h){return h.constrainTo(j,k)});g.register("dragstart",function(){var h=a.getElementsByTagName("li");
j=k=c.topLeftOffset(h[0]);for(var l=1,n=h.length;l<n;l++){var m=c.topLeftOffset(h[l]);j=j.min(m);k=k.max(m)}})});for(var e=1,f=arguments.length;e<f;e++)b.map(d,arguments[e])},_onDragStart:function(){},_onDragMove:function(a){var b=ToolMan.helpers(),c=ToolMan.coordinates(),d=a.group.element;a=a.transformedMouseOffset;for(var e=null,f=b.previousItem(d,d.nodeName);f!=null;){var g=c.bottomRightOffset(f);if(a.y<=g.y&&a.x<=g.x)e=f;f=b.previousItem(f,d.nodeName)}if(e!=null)b.moveBefore(d,e);else{for(f=b.nextItem(d,
d.nodeName);f!=null;){g=c.topLeftOffset(f);if(g.y<=a.y&&g.x<=a.x)e=f;f=b.nextItem(f,d.nodeName)}e!=null&&b.moveBefore(d,b.nextItem(e,d.nodeName))}},_onDragEnd:function(a){ToolMan.coordinates().create(0,0).reposition(a.group.element)}};ToolMan._eventsFactory={fix:function(a){if(!a)a=window.event;if(a.target){if(a.target.nodeType==3)a.target=a.target.parentNode}else if(a.srcElement)a.target=a.srcElement;return a},register:function(a,b,c){if(a.addEventListener)a.addEventListener(b,c,false);else if(a.attachEvent){if(!a._listeners)a._listeners=[];a._listeners[b]||(a._listeners[b]=[]);var d=function(){c.apply(a,[])};a._listeners[b][c]=d;a.attachEvent("on"+b,d)}},unregister:function(a,b,c){if(a.removeEventListener)a.removeEventListener(b,
c,false);else a.detachEvent&&a._listeners&&a._listeners[b]&&a._listeners[b][c]&&a.detachEvent("on"+b,a._listeners[b][c])}};
/Web Favorities/fav.php
@@ -11,16 +11,33 @@
 
function printAdmTools($id) {
global $SidebarSuffix2,$admAppend,$MyFav_Edit,$MyFav_Delete;
return '<a href="'.text2xml("fav_action.php?action=edit&id=".$id.$SidebarSuffix2).'" class="admtool" '.$admAppend.'>'.$MyFav_Edit.'</a>&nbsp;<a href="'.text2xml("fav_action.php?action=delete&id=".$id.$SidebarSuffix2).'" class="admtool" '.$admAppend.'>'.$MyFav_Delete.'</a>';
return '<a href="'.text2xml("fav_action.php?action=edit&id=".$id.$SidebarSuffix2).'" class="admtool" '.$admAppend.' onclick="return true;">'.$MyFav_Edit.'</a>&nbsp;<a href="'.text2xml("fav_action.php?action=delete&id=".$id.$SidebarSuffix2).'" class="admtool" '.$admAppend.' onclick="return true;">'.$MyFav_Delete.'</a>';
}
 
if(isset($_POST['pwd'])||isset($_POST['logout'])) logInOut(val($_POST,'pwd'),isset($_POST['logout']));
 
$conn=sqlite_popen($sqlite_file);
$conn2=sqlite_popen($sqlite_file);
// *** Read SQLite DB *** //
$db = new PDO('sqlite:./'.$sqlite_file, '', '', array(PDO::ATTR_PERSISTENT => true));
 
$qry="SELECT * FROM Fav WHERE cat = 1 ORDER BY ord,id";
$rs=sqlite_query($conn,$qry);
$rs=$db->query($qry);
 
$ary=$rs->fetchAll(PDO::FETCH_ASSOC);
 
foreach($ary as &$acat) {
$qry2="SELECT * FROM Fav WHERE cat = 0 AND catid = ".$acat['id']." ORDER BY ord,id";
$rs2=$db->query($qry2);
$ary2=$rs2->fetchAll(PDO::FETCH_ASSOC);
$acat['childs']=$ary2;
 
}
 
$qry2="SELECT * FROM Fav WHERE cat = 0 AND catid = 0 ORDER BY ord,id";
$rs3=$db->query($qry2);
$ary3=$rs3->fetchAll(PDO::FETCH_ASSOC);
// *** Read SQLite DB *** //
 
 
if (!($oldNetscape || $noXML))
header('Content-type: application/xhtml+xml');
echo '<?xml version="1.0" encoding="UTF-8"?>
@@ -232,56 +249,63 @@
document.cookie = name+"="+value+expires+"; path=/";
}';
if (!($oldNetscape || $noXML)) echo ']]>';
echo '</script>
</head>
echo '</script>';
if($jscroll) {
echo '<script type="text/javascript" src="jquery.min.js"></script>
<script type="text/javascript" src="jquery.nicescroll.min.js"></script>
<script type="text/javascript">';
if (!($oldNetscape || $noXML)) echo '<![CDATA[';
echo '$(document).ready(
function() {
$("html").niceScroll({cursorcolor:"#888",cursorwidth:7,cursoropacitymin:0.25,mousescrollstep:13,scrollspeed:40});
if(location.hash) document.getElementById("a"+location.hash.substring(1)).scrollIntoView(true);
}
);';
if (!($oldNetscape || $noXML)) echo ']]>';
echo '</script>';
}
echo '</head>
<body onload="moveNavi();">
<center><h2>網上『我的最愛』</h2></center>
<a name="top"></a>';
if (isset($_SESSION['isLogined'])) echo '<a href="'.text2xml("fav_action.php?action=order&id=-1".$SidebarSuffix2).'" class="admtool" '.$admAppend.'>'.$MyFav_CatOrder.'</a> ';
if (!$oldNetscape) echo '<a id="aToggle" href="'.text2xml("javascript:toggleAllDiv('aToggle','force');").'" class="admtool">'.($shrinkFirst?$MyFav_ExpandAll:$MyFav_ShrinkAll).'</a> <a id="aToggle2" href="'.text2xml("javascript:toggleAllDiv('aToggle2','invert');").'" class="admtool">'.$MyFav_InvertAll.'</a>';
<center><h2>'.$MyFav_Title.'</h2></center>
<a name="top" id="atop"></a>';
if (isset($_SESSION['isLogined'])) echo '<a href="'.text2xml("fav_action.php?action=order&id=-1".$SidebarSuffix2).'" class="admtool" onclick="return true;" '.$admAppend.'>'.$MyFav_CatOrder.'</a> ';
if (!$oldNetscape) echo '<a id="aToggle" href="'.text2xml("javascript:toggleAllDiv('aToggle','force');").'" class="admtool" onclick="return true;">'.($shrinkFirst?$MyFav_ExpandAll:$MyFav_ShrinkAll).'</a> <a id="aToggle2" href="'.text2xml("javascript:toggleAllDiv('aToggle2','invert');").'" class="admtool" onclick="return true;">'.$MyFav_InvertAll.'</a>';
echo '<div class="'.($NoNavi?'dh':($DispNavi?'divNavi':'divNavi-hide')).'" id="divNavi" onmouseover="restoreNavi()" onmouseout="NaviTimout()">';
if (!$NoNavi) {
echo '<a href="#bottom" style="font-size:x-small;" onmouseover="restoreNavi()">'.$MyFav_GotoBottom."</a><br />\n";
while($row = sqlite_fetch_array($rs))
echo '<a href="#'.$row['id'].'" class="navi" onmouseover="restoreNavi()" '.((!$oldNetscape)?'onclick="'.text2xml("ExpandDiv('d".$row['id']."','a".$row['id']."');").'"':'').'>'.text2xml($row['name'])."</a><br />\n";
echo '<a href="#top" style="font-size:x-small;">'.$MyFav_GotoTop."</a><br />\n";
sqlite_rewind($rs);
echo '<a href="#bottom" style="font-size:x-small;" onmouseover="restoreNavi()" onclick="return true;">'.$MyFav_GotoBottom."</a><br />\n";
foreach($ary as $a) {
echo '<a href="#'.$a['id'].'" class="navi" onmouseover="restoreNavi()" '.((!$oldNetscape)?'onclick="'.text2xml("ExpandDiv('d".$a['id']."','a".$a['id']."');").'"':'').'>'.text2xml($a['name'])."</a><br />\n";
}
echo '<a href="#top" style="font-size:x-small;" onclick="return true;">'.$MyFav_GotoTop."</a><br />\n";
}
echo '</div>
<dl>';
while($row = sqlite_fetch_array($rs)) {
echo '<dt>';
if(isset($_SESSION['isLogined'])) echo '<div onmouseover="toggleAdmTool(\'adm'.$row['id'].'\')" onmouseout="toggleAdmTool(\'adm'.$row['id'].'\')">';
if (!$oldNetscape)
echo '<a id="a'.$row['id'].'" href="'.text2xml("javascript:ToggleDiv('d".$row['id']."','a".$row['id']."');").'" class="toggle">'.($shrinkFirst?$MyFav_ExpandMark:$MyFav_ShrinkMark).'</a> ';
echo '<a name="'.$row['id'].'"'.($row['addr']?' href="'.text2xml($row['addr']).'" '.$aAppend:'').'>'.text2xml($row['name']).'</a>';
if (isset($_SESSION['isLogined'])) echo '<span class="admtools-hide" id="adm'.$row['id'].'"><a href="'.text2xml("fav_action.php?action=add&catid=".$row['id'].$SidebarSuffix2).'" class="admtool" '.$admAppend.'>'.$MyFav_Add.'</a>&nbsp;<a href="'.text2xml("fav_action.php?action=order&id=".$row['id'].$SidebarSuffix2).'" class="admtool" '.$admAppend.'>'.$MyFav_Order.'</a>&nbsp;'.printAdmTools($row['id']).'</span></div>';
echo '</dt>
<dd><div id="d'.$row['id'].'" class="'.$divShrink.'">';
$qry2="SELECT * FROM Fav WHERE cat = 0 AND catid = ".$row['id']." ORDER BY ord,id";
$rs2=sqlite_query($conn2,$qry2);
echo '<ul>';
while($row2 = sqlite_fetch_array($rs2)) {
if ($row2['protected']) echo '<li type="circle"'.(printAdmJs($row2['id'])).'><a href="'.text2xml("fav_action.php?action=go&id=".$row2['id']).'" '.$aAppend.'>'.text2xml($row2['name']).'</a>';
else echo'<li'.(printAdmJs($row2['id'])).'><a href="'.text2xml($row2['addr']).'" '.$aAppend.'>'.text2xml($row2['name']).'</a>';
if (isset($_SESSION['isLogined'])) echo '<span class="admtools-hide" id="adm'.$row2['id'].'">'.printAdmTools($row2['id']).'</span>';
echo "</li>\n";
echo '</div>';
 
function ary2listOflinks($arr) {
global $oldNetscape,$divShrink,$shrinkFirst,$MyFav_ExpandMark,$MyFav_ShrinkMark,$SidebarSuffix2,$admAppend,$MyFav_Add,$MyFav_Order,$aAppend;
$txt='';
foreach($arr as $a) {
if($a['cat']=="1") {
$txt.= '<dt>';
if(isset($_SESSION['isLogined'])) $txt.= '<div onmouseover="toggleAdmTool(\'adm'.$a['id'].'\')" onmouseout="toggleAdmTool(\'adm'.$a['id'].'\')">';
if (!$oldNetscape)
$txt.= '<a id="a'.$a['id'].'" href="'.text2xml("javascript:ToggleDiv('d".$a['id']."','a".$a['id']."');").'" class="toggle">'.($shrinkFirst?$MyFav_ExpandMark:$MyFav_ShrinkMark).'</a> ';
$txt.= '<a name="'.$a['id'].'"'.($a['addr']?' href="'.text2xml($a['addr']).'" '.$aAppend:'').'>'.text2xml($a['name']).'</a>';
 
if (isset($_SESSION['isLogined'])) $txt.= '<span class="admtools-hide" id="adm'.$a['id'].'"><a href="'.text2xml("fav_action.php?action=add&catid=".$a['id'].$SidebarSuffix2).'" class="admtool" '.$admAppend.' onclick="return true;">'.$MyFav_Add.'</a>&nbsp;<a href="'.text2xml("fav_action.php?action=order&id=".$a['id'].$SidebarSuffix2).'" class="admtool" onclick="return true;" '.$admAppend.'>'.$MyFav_Order.'</a>&nbsp;'.printAdmTools($a['id']).'</span></div>';
 
$txt .='</dt><dd><div id="d'.$a['id'].'" class="'.$divShrink.'"><ul>'.ary2listOflinks($a['childs']).'</ul><br /></div></dd><dt><br /></dt>';
} else {
if ($a['protected']) $txt .= '<li type="circle"'.(printAdmJs($a['id'])).'><a href="'.text2xml("fav_action.php?action=go&id=".$a['id']).'" '.$aAppend.'>'.text2xml($a['name']).'</a>';
else $txt .='<li'.(printAdmJs($a['id'])).'><a href="'.text2xml($a['addr']).'" '.$aAppend.'>'.text2xml($a['name']).'</a>';
if (isset($_SESSION['isLogined'])) $txt .= '<span class="admtools-hide" id="adm'.$a['id'].'">'.printAdmTools($a['id']).'</span>';
}
}
echo '</ul>
<br /></div></dd>
<dt><br /></dt>';
return $txt;
}
 
$qry="SELECT * FROM Fav WHERE cat = 0 AND catid = 0 ORDER BY ord,id";
$rs=sqlite_query($conn,$qry);
echo '<dd><ul>';
while($row = sqlite_fetch_array($rs)) {
if ($row['protected']) echo '<li type="circle"'.(printAdmJs($row['id'])).'><a href="'.text2xml("fav_action.php?action=go&id=".$row['id']).'" '.$aAppend.'>'.$row['name'].'</a>';
else echo '<li'.(printAdmJs($row['id'])).'><a href="'.text2xml($row['addr']).'" '.$aAppend.'>'.text2xml($row['name']).'</a>';
if (isset($_SESSION['isLogined'])) echo '<span class="admtools-hide" id="adm'.$row['id'].'">'.printAdmTools($row['id']).'</span>';
echo "</li>\n";
}
echo '</ul></dd></dl>
echo '<dl>'.ary2listOflinks($ary);
echo '<dd><ul>'.ary2listOflinks($ary3).'</ul></dd></dl>
<script type="text/javascript">';
if (!($oldNetscape || $noXML)) echo '<![CDATA[';
echo 'var showsubmenu = get_submenu();
@@ -290,10 +314,8 @@
}';
if (!($oldNetscape || $noXML)) echo ']]>';
echo '</script>
<a name="bottom"></a>';
sqlite_close($conn);
sqlite_close($conn2);
if (isset($_SESSION['isLogined'])) echo '<a href="'.text2xml("fav_action.php?action=add".$SidebarSuffix2).'" class="admtool" '.$admAppend.'>'.$MyFav_Add.'</a>&nbsp;<a href="'.text2xml("fav_action.php?action=order&id=0".$SidebarSuffix2).'" class="admtool" '.$admAppend.'>'.$MyFav_Order.'</a> <a href="'.text2xml("fav_action.php?action=opt".$SidebarSuffix2).'" class="admtool" '.$admAppend.'>'.$MyFav_Optimize.'</a> <a href="'.text2xml("javascript:location.href='".$BaseURL."fav_action.php?action=add&name='+escape(document.title)+'&url='+escape(document.location.href);").'" class="admtool" '.$admAppend.'>'.$MyFav_Bookmarklet.'</a>';
<a name="bottom" id="abottom"></a>';
if (isset($_SESSION['isLogined'])) echo '<a href="'.text2xml("fav_action.php?action=add".$SidebarSuffix2).'" class="admtool" onclick="return true;" '.$admAppend.'>'.$MyFav_Add.'</a>&nbsp;<a href="'.text2xml("fav_action.php?action=order&id=0".$SidebarSuffix2).'" class="admtool" onclick="return true;" '.$admAppend.'>'.$MyFav_Order.'</a> <a href="'.text2xml("fav_action.php?action=opt".$SidebarSuffix2).'" class="admtool" onclick="return true;" '.$admAppend.'>'.$MyFav_Optimize.'</a> <a href="'.text2xml("javascript:location.href='".$BaseURL."fav_action.php?action=add&name='+escape(document.title)+'&url='+escape(document.location.href);").'" class="admtool" onclick="return true;" '.$admAppend.'>'.$MyFav_Bookmarklet.'</a>';
$uriSuffix=isset($_SERVER['QUERY_STRING']) && $_SERVER['QUERY_STRING']!=""?"?".$_SERVER['QUERY_STRING']:'';
 
echo '<form action="'.text2xml($_SERVER['PHP_SELF'].$uriSuffix).'" method="post">';
@@ -308,4 +330,3 @@
require("./fav_footer.htm");
echo '</body>
</html>';
?>
New file
/Web Favorities/tool-man-nocookie.js
@@ -0,0 +1,21 @@
var ToolMan={events:function(){if(!ToolMan._eventsFactory)throw"ToolMan Events module isn't loaded";return ToolMan._eventsFactory},css:function(){if(!ToolMan._cssFactory)throw"ToolMan CSS module isn't loaded";return ToolMan._cssFactory},coordinates:function(){if(!ToolMan._coordinatesFactory)throw"ToolMan Coordinates module isn't loaded";return ToolMan._coordinatesFactory},drag:function(){if(!ToolMan._dragFactory)throw"ToolMan Drag module isn't loaded";return ToolMan._dragFactory},dragsort:function(){if(!ToolMan._dragsortFactory)throw"ToolMan DragSort module isn't loaded";
return ToolMan._dragsortFactory},helpers:function(){return ToolMan._helpers},cookies:function(){if(!ToolMan._cookieOven)throw"ToolMan Cookie module isn't loaded";return ToolMan._cookieOven},junkdrawer:function(){return ToolMan._junkdrawer}};
ToolMan._helpers={map:function(a,b){for(var c=0,d=a.length;c<d;c++)b(a[c])},nextItem:function(a,b){if(a!=null){for(a=a.nextSibling;a!=null;){if(a.nodeName==b)return a;a=a.nextSibling}return null}},previousItem:function(a,b){for(a=a.previousSibling;a!=null;){if(a.nodeName==b)return a;a=a.previousSibling}return null},moveBefore:function(a,b){var c=a.parentNode;c.removeChild(a);c.insertBefore(a,b)},moveAfter:function(a,b){var c=a.parentNode;c.removeChild(a);c.insertBefore(a,b?b.nextSibling:null)}};
ToolMan._junkdrawer={serializeList:function(a){a=a.getElementsByTagName("li");for(var b=[],c=0,d=a.length;c<d;c++){var e=a[c];b.push(ToolMan.junkdrawer()._identifier(e))}return b.join("|")},inspectListOrder:function(a){alert(ToolMan.junkdrawer().serializeList(document.getElementById(a)))},restoreListOrder:function(a){var b=document.getElementById(a);if(b!=null)if(a=ToolMan.cookies().get("list-"+a)){a=a.split("|");for(var c=ToolMan.junkdrawer()._itemsByID(b),d=0,e=a.length;d<e;d++){var f=a[d];if(f in
c){f=c[f];b.removeChild(f);b.insertBefore(f,null)}}}},_identifier:function(a){var b=ToolMan.junkdrawer().trim,c;c=b(a.getAttribute("id"));if(c!=null&&c.length>0)return c;c=b(a.getAttribute("itemID"));if(c!=null&&c.length>0)return c;return b(a.innerHTML)},_itemsByID:function(a){var b=[];a=a.getElementsByTagName("li");for(var c=0,d=a.length;c<d;c++){var e=a[c];b[ToolMan.junkdrawer()._identifier(e)]=e}return b},trim:function(a){if(a==null)return null;return a.replace(/^(\s+)?(.*\S)(\s+)?$/,"$2")}};ToolMan._coordinatesFactory={create:function(a,b){return new _ToolManCoordinate(this,a,b)},origin:function(){return this.create(0,0)},topLeftPosition:function(a){var b=parseInt(ToolMan.css().readStyle(a,"left"));b=isNaN(b)?0:b;a=parseInt(ToolMan.css().readStyle(a,"top"));a=isNaN(a)?0:a;return this.create(b,a)},bottomRightPosition:function(a){return this.topLeftPosition(a).plus(this._size(a))},topLeftOffset:function(a){var b=this._offset(a);for(a=a.offsetParent;a;){b=b.plus(this._offset(a));a=a.offsetParent}return b},
bottomRightOffset:function(a){return this.topLeftOffset(a).plus(this.create(a.offsetWidth,a.offsetHeight))},scrollOffset:function(){return window.pageXOffset?this.create(window.pageXOffset,window.pageYOffset):document.documentElement?this.create(document.body.scrollLeft+document.documentElement.scrollLeft,document.body.scrollTop+document.documentElement.scrollTop):document.body.scrollLeft>=0?this.create(document.body.scrollLeft,document.body.scrollTop):this.create(0,0)},clientSize:function(){return window.innerHeight>=
0?this.create(window.innerWidth,window.innerHeight):document.documentElement?this.create(document.documentElement.clientWidth,document.documentElement.clientHeight):document.body.clientHeight>=0?this.create(document.body.clientWidth,document.body.clientHeight):this.create(0,0)},mousePosition:function(a){a=ToolMan.events().fix(a);return this.create(a.clientX,a.clientY)},mouseOffset:function(a){a=ToolMan.events().fix(a);if(a.pageX>=0||a.pageX<0)return this.create(a.pageX,a.pageY);else if(a.clientX>=
0||a.clientX<0)return this.mousePosition(a).plus(this.scrollOffset())},_size:function(a){return this.create(a.offsetWidth,a.offsetHeight)},_offset:function(a){return this.create(a.offsetLeft,a.offsetTop)}};function _ToolManCoordinate(a,b,c){this.factory=a;this.x=isNaN(b)?0:b;this.y=isNaN(c)?0:c}
_ToolManCoordinate.prototype={toString:function(){return"("+this.x+","+this.y+")"},plus:function(a){return this.factory.create(this.x+a.x,this.y+a.y)},minus:function(a){return this.factory.create(this.x-a.x,this.y-a.y)},min:function(a){return this.factory.create(Math.min(this.x,a.x),Math.min(this.y,a.y))},max:function(a){return this.factory.create(Math.max(this.x,a.x),Math.max(this.y,a.y))},constrainTo:function(a,b){var c=a.min(b);a=a.max(b);return this.max(c).min(a)},distance:function(a){return Math.sqrt(Math.pow(this.x-
a.x,2)+Math.pow(this.y-a.y,2))},reposition:function(a){a.style.top=this.y+"px";a.style.left=this.x+"px"}};ToolMan._cssFactory={readStyle:function(a,b){return a.style[b]?a.style[b]:a.currentStyle?a.currentStyle[b]:document.defaultView&&document.defaultView.getComputedStyle?document.defaultView.getComputedStyle(a,null).getPropertyValue(b):null}};ToolMan._dragFactory={createSimpleGroup:function(a,b){b=b?b:a;a=this.createGroup(a);a.setHandle(b);a.transparentDrag();a.onTopWhileDragging();return a},createGroup:function(a){var b=new _ToolManDragGroup(this,a),c=ToolMan.css().readStyle(a,"position");if(c=="static")a.style.position="relative";else c=="absolute"&&ToolMan.coordinates().topLeftOffset(a).reposition(a);b.register("draginit",this._showDragEventStatus);b.register("dragmove",this._showDragEventStatus);b.register("dragend",this._showDragEventStatus);
return b},_showDragEventStatus:function(){},constraints:function(){return this._constraintFactory},_createEvent:function(a,b,c){return new _ToolManDragEvent(a,b,c)}};function _ToolManDragGroup(a,b){this.factory=a;this.element=b;this._handle=null;this._thresholdDistance=0;this._transforms=[];this._listeners=[];this._listeners.draginit=[];this._listeners.dragstart=[];this._listeners.dragmove=[];this._listeners.dragend=[]}
_ToolManDragGroup.prototype={setHandle:function(a){var b=ToolMan.events();a.toolManDragGroup=this;b.register(a,"mousedown",this._dragInit);a.onmousedown=function(){return false};this.element!=a&&b.unregister(this.element,"mousedown",this._dragInit)},register:function(a,b){this._listeners[a].push(b)},addTransform:function(a){this._transforms.push(a)},verticalOnly:function(){this.addTransform(this.factory.constraints().vertical())},horizontalOnly:function(){this.addTransform(this.factory.constraints().horizontal())},
setThreshold:function(a){this._thresholdDistance=a},transparentDrag:function(a){a=typeof a!="undefined"?a:0.75;var b=ToolMan.css().readStyle(this.element,"opacity");this.register("dragstart",function(c){c=c.group.element;c.style.opacity=a;c.style.filter="alpha(opacity="+a*100+")"});this.register("dragend",function(c){c=c.group.element;c.style.opacity=b;c.style.filter="alpha(opacity=100)"})},onTopWhileDragging:function(a){a=typeof a!="undefined"?a:1E5;var b=ToolMan.css().readStyle(this.element,"z-index");
this.register("dragstart",function(c){c.group.element.style.zIndex=a});this.register("dragend",function(c){c.group.element.style.zIndex=b})},_dragInit:function(a){a=ToolMan.events().fix(a);var b=document.toolManDragGroup=this.toolManDragGroup;a=b.factory._createEvent("draginit",a,b);b._isThresholdExceeded=false;b._initialMouseOffset=a.mouseOffset;b._grabOffset=a.mouseOffset.minus(a.topLeftOffset);ToolMan.events().register(document,"mousemove",b._drag);document.onmousemove=function(){return false};
ToolMan.events().register(document,"mouseup",b._dragEnd);b._notifyListeners(a)},_drag:function(a){a=ToolMan.events().fix(a);var b=ToolMan.coordinates(),c=this.toolManDragGroup;if(c){var d=c.factory._createEvent("dragmove",a,c),e=d.mouseOffset.minus(c._grabOffset);if(!c._isThresholdExceeded){if(d.mouseOffset.distance(c._initialMouseOffset)<c._thresholdDistance)return;c._isThresholdExceeded=true;c._notifyListeners(c.factory._createEvent("dragstart",a,c))}for(i in c._transforms)e=c._transforms[i](e,
d);a=e.minus(d.topLeftOffset);d.topLeftPosition.plus(a).reposition(c.element);d.transformedMouseOffset=e.plus(c._grabOffset);c._notifyListeners(d);d=e.minus(b.topLeftOffset(c.element));if(d.x!=0||d.y!=0)b.topLeftPosition(c.element).plus(d).reposition(c.element)}},_dragEnd:function(a){a=ToolMan.events().fix(a);var b=this.toolManDragGroup;a=b.factory._createEvent("dragend",a,b);b._notifyListeners(a);this.toolManDragGroup=null;ToolMan.events().unregister(document,"mousemove",b._drag);document.onmousemove=
null;ToolMan.events().unregister(document,"mouseup",b._dragEnd)},_notifyListeners:function(a){var b=this._listeners[a.type];for(i in b)b[i](a)}};function _ToolManDragEvent(a,b,c){this.type=a;this.group=c;this.mousePosition=ToolMan.coordinates().mousePosition(b);this.transformedMouseOffset=this.mouseOffset=ToolMan.coordinates().mouseOffset(b);this.topLeftPosition=ToolMan.coordinates().topLeftPosition(c.element);this.topLeftOffset=ToolMan.coordinates().topLeftOffset(c.element)}
_ToolManDragEvent.prototype={toString:function(){return"mouse: "+this.mousePosition+this.mouseOffset+" xmouse: "+this.transformedMouseOffset+" left,top: "+this.topLeftPosition+this.topLeftOffset}};ToolMan._dragFactory._constraintFactory={vertical:function(){return function(a,b){b=b.topLeftOffset.x;return a.x!=b?a.factory.create(b,a.y):a}},horizontal:function(){return function(a,b){b=b.topLeftOffset.y;return a.y!=b?a.factory.create(a.x,b):a}}};ToolMan._dragsortFactory={makeSortable:function(a){a=ToolMan.drag().createSimpleGroup(a);a.register("dragstart",this._onDragStart);a.register("dragmove",this._onDragMove);a.register("dragend",this._onDragEnd);return a},makeListSortable:function(a){var b=ToolMan.helpers(),c=ToolMan.coordinates(),d=a.getElementsByTagName("li");b.map(d,function(g){g=dragsort.makeSortable(g);g.setThreshold(4);var j,k;g.addTransform(function(h){return h.constrainTo(j,k)});g.register("dragstart",function(){var h=a.getElementsByTagName("li");
j=k=c.topLeftOffset(h[0]);for(var l=1,n=h.length;l<n;l++){var m=c.topLeftOffset(h[l]);j=j.min(m);k=k.max(m)}})});for(var e=1,f=arguments.length;e<f;e++)b.map(d,arguments[e])},_onDragStart:function(){},_onDragMove:function(a){var b=ToolMan.helpers(),c=ToolMan.coordinates(),d=a.group.element;a=a.transformedMouseOffset;for(var e=null,f=b.previousItem(d,d.nodeName);f!=null;){var g=c.bottomRightOffset(f);if(a.y<=g.y&&a.x<=g.x)e=f;f=b.previousItem(f,d.nodeName)}if(e!=null)b.moveBefore(d,e);else{for(f=b.nextItem(d,
d.nodeName);f!=null;){g=c.topLeftOffset(f);if(g.y<=a.y&&g.x<=a.x)e=f;f=b.nextItem(f,d.nodeName)}e!=null&&b.moveBefore(d,b.nextItem(e,d.nodeName))}},_onDragEnd:function(a){ToolMan.coordinates().create(0,0).reposition(a.group.element)}};ToolMan._eventsFactory={fix:function(a){if(!a)a=window.event;if(a.target){if(a.target.nodeType==3)a.target=a.target.parentNode}else if(a.srcElement)a.target=a.srcElement;return a},register:function(a,b,c){if(a.addEventListener)a.addEventListener(b,c,false);else if(a.attachEvent){if(!a._listeners)a._listeners=[];a._listeners[b]||(a._listeners[b]=[]);var d=function(){c.apply(a,[])};a._listeners[b][c]=d;a.attachEvent("on"+b,d)}},unregister:function(a,b,c){if(a.removeEventListener)a.removeEventListener(b,
c,false);else a.detachEvent&&a._listeners&&a._listeners[b]&&a._listeners[b][c]&&a.detachEvent("on"+b,a._listeners[b][c])}};
/Web Favorities/CHANGELOG.txt
@@ -1,6 +1,12 @@
Web Favorities System Change Log
================================
Version 0.06:
* Upgrade from SQLite2 to PDO SQlite3
 
Version 0.05:
* Make "noxml=Y" as default
* Add "jscroll=Y" useing JQuery NiceScroll (works well in NoXML mode only)
+ Add fav_reorder_2.php and ToolManDHTML-0.2 for Drag and Drop Reordering
* Simplify some codes
* Correct some variables
* Move determination script out of fav_settings.php to fav_common.php
New file
/Web Favorities/fav_reorder_2.php
@@ -0,0 +1,114 @@
<?php
require("./fav_settings.php");
require("./fav_strings.php");
 
$db = new PDO('sqlite:./'.$sqlite_file, '', '', array(PDO::ATTR_PERSISTENT => true));
 
$getid=intval($_GET['id']);
if($getid>0) {
$qry="SELECT name FROM Fav WHERE id=".$getid;
$rs=$db->query($qry);
$container=$rs->fetchColumn();
} elseif($_GET['id']==-1) $container=$MyFav_Order_CatOrd;
else $container=$MyFav_Order_RootOrd;
 
$qry='SELECT id,name,addr FROM Fav WHERE '.($getid==-1?'cat = 1':'catid='.$getid).(!$getid?' AND cat = 0':'').' ORDER BY ord,id';
$rs=$db->query($qry);
$row = $rs->fetch(PDO::FETCH_ASSOC);
$rcnt=is_array($row) ? 1 : 0;
$rs=$db->query($qry); // There is no rewind() in PDO, requery instead.
 
$MM_RedirectUrl=$homeURL.$SidebarSuffix1;
if (isset($_SESSION['isLogined']) && isset($_POST["MM_reorder"]) && $_POST["MM_reorder"]=="form1"){
$Command1_CommandText='';
$order=explode('|',$_POST['newOrder']);
// array_pop($order);
foreach($order as $ord => $id)
$Command1_CommandText.="UPDATE Fav SET ord = ".intval($ord)." WHERE id = ".intval($id).";";
$db->exec($Command1_CommandText,$conn);
 
header("Location: ".$MM_RedirectUrl);
exit();
}
 
echo '<html>
<head>
<meta http-equiv="Content-Type" content="text/html; charset=utf-8">
<title>'.$MyFav_Order_Title.'</title>
 
<script language="JavaScript" type="text/javascript" src="tool-man-nocookie.js"></script>
<script language="JavaScript" type="text/javascript">
function ws(s){window.status = s}
</script>
 
<link href="./style.css" rel="stylesheet" type="text/css" />
<STYLE type="text/css"><!--
ul#ids {
list-style-type: none;
padding: 0 0 1em 1em;
margin: 0px;
width: 20em;
}
ul#ids li {
font-size:9pt;
cursor:move;
padding: 2px 2px;
border: 1px solid #ccc;
background-color: #eee;
}
ul#ids li:before {
content:"↕";
}
--></STYLE>';
if ($InSidebar) {
echo '<STYLE type="text/css"><!--
 
body,select {font-size: 9pt;}
 
--></STYLE>';
}
echo '</head>';
 
require("./fav_header.htm");
echo "<h3>$MyFav_Order_Header$container</h3>";
if (isset($_SESSION['isLogined']) && $rcnt) {
echo '<script language="JavaScript" type="text/javascript"><!--
var dragsort = ToolMan.dragsort()
var junkdrawer = ToolMan.junkdrawer()
 
window.onload = function() {
dragsort.makeListSortable(document.getElementById("ids"),
verticalOnly, saveOrder)
}
 
function verticalOnly(item) {
item.toolManDragGroup.verticalOnly()
}
 
function saveOrder(item) {}
 
function placeInHidden(id,hid) { document.getElementById(hid).value = ToolMan.junkdrawer().serializeList(document.getElementById(id)); }
//-->
</script>
 
<form action='.$_SERVER['PHP_SELF'].'?id='.$_GET['id'].$SidebarSuffix2.' method="post" onsubmit="placeInHidden(\'ids\',\'nod\')">';
echo ' <ul id="ids">';
while($row2 = $rs->fetch(PDO::FETCH_ASSOC)) {
echo ' <li itemID="'.($row2["id"]).'"><span onmouseover="ws(\''.$row2["addr"].'\')" onmouseout="ws(\'\')">'.$row2["name"].'</span></li>
';
}
echo ' </ul>
<input type="hidden" name="newOrder" id="nod" value="" />
<input type="hidden" name="MM_reorder" value="form1">
<input type="submit" name="Submit" value="'.$MyFav_AddMod_Submit.'">
'.$MyFav_BackHTML.'
</form>';
} elseif (!$rcnt) {
echo $MyFav_NotFound.'<br><center>'.$MyFav_BackHTML.'</center>';
} else {
echo $MyFav_AccessDeny.'<br><center>'.$MyFav_BackHTML.'</center>';
}
require("./fav_footer.htm");
?>
</body>
</html>
/Web Favorities/fav_edit.php
@@ -14,15 +14,17 @@
$Recordset1__MMColParam="1";
if (isset($_GET["id"])) $Recordset1__MMColParam=intval($_GET["id"]);
 
$conn=sqlite_popen($sqlite_file);
$qry="SELECT * FROM Fav WHERE id = ".sqlite_escape_string($Recordset1__MMColParam);
$rs=sqlite_query($conn,$qry);
$rcnt=sqlite_num_rows($rs);
$row = sqlite_fetch_array($rs);
$db = new PDO('sqlite:./'.$sqlite_file, '', '', array(PDO::ATTR_PERSISTENT => true));
$qry='SELECT * FROM Fav WHERE id = '.$Recordset1__MMColParam;
$rs=$db->query($qry);
$row = $rs->fetch(PDO::FETCH_ASSOC);
$rcnt=is_array($row) ? 1 : 0;
 
if (isset($_POST["MM_insert"]) && $_POST["MM_insert"]=="form1"){
$Command1_CommandText="UPDATE Fav SET cat = ".sqlite_escape_string($Command1__varcat)." , protected = ".sqlite_escape_string($Command1__varprot)." , catid = ".sqlite_escape_string($Command1__varcatid)." , name = '".sqlite_escape_string($Command1__varname)."' , addr = '".sqlite_escape_string($Command1__varaddr)."' WHERE id = ".sqlite_escape_string($Command1__varid);
sqlite_exec($Command1_CommandText,$conn);
$sth = $db->prepare('UPDATE Fav SET cat = ?, protected = ?, catid = ?, name = ?, addr = ? WHERE id = ?');
$sth->execute(array($Command1__varcat, $Command1__varprot, $Command1__varcatid, $Command1__varname. $Command1__varaddr, $Command1__varid));
// $Command1_CommandText="UPDATE Fav SET cat = ".sqlite_escape_string($Command1__varcat)." , protected = ".sqlite_escape_string($Command1__varprot)." , catid = ".sqlite_escape_string($Command1__varcatid)." , name = '".sqlite_escape_string($Command1__varname)."' , addr = '".sqlite_escape_string($Command1__varaddr)."' WHERE id = ".sqlite_escape_string($Command1__varid);
// sqlite_exec($Command1_CommandText,$conn);
 
header("Location: ".$MM_RedirectUrl);
exit();
@@ -88,9 +90,9 @@
<select name="catid" id="catid" onChange="detSel();" '.($row['cat']?"disabled":'').'>';
 
$qry="SELECT id,name FROM Fav WHERE cat = 1 ORDER BY ord,id";
$rs=sqlite_query($conn,$qry);
$rs=$db->query($qry);
echo ' <option value="0">'.$MyFav_Cat_NoCategory.'</option>';
while($row2 = sqlite_fetch_array($rs)) {
while($row2 = $rs->fetch(PDO::FETCH_ASSOC)) {
echo ' <option value="'.($row2["id"]).'" '.($row2["id"]==$row["catid"]?"selected":'').'>'.($row2["name"]).'</option>';
}
echo ' </select>
New file
/Web Favorities/jquery.nicescroll.min.js
@@ -0,0 +1,3798 @@
/* jquery.nicescroll
-- version 3.6.8
-- copyright 2016-02-29 InuYaksa*2016
-- licensed under the MIT
--
-- http://nicescroll.areaaperta.com/
-- https://github.com/inuyaksa/jquery.nicescroll
--
*/
 
(function(factory) {
if (typeof define === 'function' && define.amd) {
// AMD. Register as anonymous module.
define(['jquery'], factory);
} else if (typeof exports === 'object') {
// Node/CommonJS.
module.exports = factory(require('jquery'));
} else {
// Browser globals.
factory(jQuery);
}
}(function(jQuery) {
"use strict";
 
// globals
var domfocus = false;
var mousefocus = false;
var tabindexcounter = 0;
var ascrailcounter = 2000;
var globalmaxzindex = 0;
 
var $ = jQuery; // sandbox
 
// http://stackoverflow.com/questions/2161159/get-script-path
function getScriptPath() {
var scripts = document.getElementsByTagName('script');
var path = scripts.length ? scripts[scripts.length - 1].src.split('?')[0] : '';
return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
}
 
var vendors = ['webkit','ms','moz','o'];
 
var setAnimationFrame = window.requestAnimationFrame || false;
var clearAnimationFrame = window.cancelAnimationFrame || false;
 
if (!setAnimationFrame) { // legacy detection
for (var vx in vendors) {
var v = vendors[vx];
setAnimationFrame = window[v + 'RequestAnimationFrame'];
if (setAnimationFrame) {
clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'];
break;
}
}
}
 
var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
 
var _globaloptions = {
zindex: "auto",
cursoropacitymin: 0,
cursoropacitymax: 1,
cursorcolor: "#424242",
cursorwidth: "6px",
cursorborder: "1px solid #fff",
cursorborderradius: "5px",
scrollspeed: 60,
mousescrollstep: 8 * 3,
touchbehavior: false,
hwacceleration: true,
usetransition: true,
boxzoom: false,
dblclickzoom: true,
gesturezoom: true,
grabcursorenabled: true,
autohidemode: true,
background: "",
iframeautoresize: true,
cursorminheight: 32,
preservenativescrolling: true,
railoffset: false,
railhoffset: false,
bouncescroll: true,
spacebarenabled: true,
railpadding: {
top: 0,
right: 0,
left: 0,
bottom: 0
},
disableoutline: true,
horizrailenabled: true,
railalign: "right",
railvalign: "bottom",
enabletranslate3d: true,
enablemousewheel: true,
enablekeyboard: true,
smoothscroll: true,
sensitiverail: true,
enablemouselockapi: true,
// cursormaxheight:false,
cursorfixedheight: false,
directionlockdeadzone: 6,
hidecursordelay: 400,
nativeparentscrolling: true,
enablescrollonselection: true,
overflowx: true,
overflowy: true,
cursordragspeed: 0.3,
rtlmode: "auto",
cursordragontouch: false,
oneaxismousemode: "auto",
scriptpath: getScriptPath(),
preventmultitouchscrolling: true,
disablemutationobserver:false
};
 
var browserdetected = false;
 
var getBrowserDetection = function() {
 
if (browserdetected) return browserdetected;
 
var _el = document.createElement('DIV'),
_style = _el.style,
_agent = navigator.userAgent,
_platform = navigator.platform,
d = {};
 
d.haspointerlock = "pointerLockElement" in document || "webkitPointerLockElement" in document || "mozPointerLockElement" in document;
 
d.isopera = ("opera" in window); // 12-
d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");
 
d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7));
d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8);
d.isie9 = d.isie && ("performance" in window) && (document.documentMode == 9);
d.isie10 = d.isie && ("performance" in window) && (document.documentMode == 10);
d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
d.isieedge12 = (navigator.userAgent.match(/Edge\/12\./)); // IE Edge 12
d.isieedge = ("msOverflowStyle" in _el); // IE Edge
d.ismodernie = d.isie11 || d.isieedge;
d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
if (d.isie9mobile) d.isie9 = false;
d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
 
d.ismozilla = ("MozAppearance" in _style);
 
d.iswebkit = ("WebkitAppearance" in _style);
 
d.ischrome = ("chrome" in window);
d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation
d.ischrome22 = (!d.ischrome38)&&(d.ischrome && d.haspointerlock);
d.ischrome26 = (!d.ischrome38)&&(d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // with detection for Chrome Touch Emulation
d.hasw3ctouch = (window.PointerEvent || false) && ((navigator.MaxTouchPoints > 0)||(navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec
d.hasmstouch = (!d.hasw3ctouch)&&(window.MSPointerEvent || false); // IE10 pointer events
 
d.ismac = /^mac$/i.test(_platform);
d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(_platform));
d.isios4 = ((d.isios) && !("seal" in Object));
d.isios7 = ((d.isios)&&("webkitHidden" in document)); //iOS 7+
d.isios8 = ((d.isios)&&("hidden" in document)); //iOS 8+
 
d.isandroid = (/android/i.test(_agent));
 
d.haseventlistener = ("addEventListener" in _el);
d.trstyle = false;
d.hastransform = false;
d.hastranslate3d = false;
d.transitionstyle = false;
d.hastransition = false;
d.transitionend = false;
 
var a;
var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];
for (a = 0; a < check.length; a++) {
if (_style[check[a]] !== undefined) {
d.trstyle = check[a];
break;
}
}
d.hastransform = (!!d.trstyle);
if (d.hastransform) {
_style[d.trstyle] = "translate3d(1px,2px,3px)";
d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
}
 
d.transitionstyle = false;
d.prefixstyle = '';
d.transitionend = false;
check = ['transition', 'webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
var prefix = ['', '-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
var evs = ['transitionend', 'webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
for (a = 0; a < check.length; a++) {
if (check[a] in _style) {
d.transitionstyle = check[a];
d.prefixstyle = prefix[a];
d.transitionend = evs[a];
break;
}
}
if (d.ischrome26) { // always use prefix
d.prefixstyle = prefix[1];
}
 
d.hastransition = (d.transitionstyle);
 
function detectCursorGrab() {
var lst = ['grab','-webkit-grab', '-moz-grab'];
if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
for (var a = 0; a < lst.length; a++) {
var p = lst[a];
_style.cursor = p;
if (_style.cursor == p) return p;
}
return '';//url(//patriciaportfolio.googlecode.com/files/openhand.cur),n-resize'; // thank you google for custom cursor!
}
d.cursorgrabvalue = detectCursorGrab();
 
d.hasmousecapture = ("setCapture" in _el);
 
d.hasMutationObserver = (ClsMutationObserver !== false);
 
_el = null; //memory released
 
browserdetected = d;
 
return d;
};
 
var NiceScrollClass = function(myopt, me) {
 
var self = this;
 
this.version = '3.6.8';
this.name = 'nicescroll';
 
this.me = me;
 
this.opt = {
doc: $("body"),
win: false
};
 
$.extend(this.opt, _globaloptions); // clone opts
 
// Options for internal use
this.opt.snapbackspeed = 80;
 
if (myopt || false) {
for (var a in self.opt) {
if (myopt[a] !== undefined) self.opt[a] = myopt[a];
}
}
 
if (self.opt.disablemutationobserver) ClsMutationObserver = false;
this.doc = self.opt.doc;
this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName);
this.haswrapper = (self.opt.win !== false);
this.win = self.opt.win || (this.ispage ? $(window) : this.doc);
this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win;
this.body = $("body");
this.viewport = false;
 
this.isfixed = false;
 
this.iframe = false;
this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
 
this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
 
this.forcescreen = false; //force to use screen position on events
 
this.canshowonmouseevent = (self.opt.autohidemode != "scroll");
 
// Events jump table
this.onmousedown = false;
this.onmouseup = false;
this.onmousemove = false;
this.onmousewheel = false;
this.onkeypress = false;
this.ongesturezoom = false;
this.onclick = false;
 
// Nicescroll custom events
this.onscrollstart = false;
this.onscrollend = false;
this.onscrollcancel = false;
 
this.onzoomin = false;
this.onzoomout = false;
 
// Let's start!
this.view = false;
this.page = false;
 
this.scroll = {
x: 0,
y: 0
};
this.scrollratio = {
x: 0,
y: 0
};
this.cursorheight = 20;
this.scrollvaluemax = 0;
 
// http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical
// http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode
if (this.opt.rtlmode == "auto") {
var target = this.win[0] == window ? this.body : this.win;
var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode");
 
if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode == "") {
this.isrtlmode = (target.css("direction") == "rtl");
this.isvertical = false;
} else {
this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb");
this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl");
}
} else {
this.isrtlmode = (this.opt.rtlmode === true);
this.isvertical = false;
}
// this.checkrtlmode = false;
this.scrollrunning = false;
 
this.scrollmom = false;
 
this.observer = false; // observer div changes
this.observerremover = false; // observer on parent for remove detection
this.observerbody = false; // observer on body for position change
 
do {
this.id = "ascrail" + (ascrailcounter++);
} while (document.getElementById(this.id));
 
this.rail = false;
this.cursor = false;
this.cursorfreezed = false;
this.selectiondrag = false;
 
this.zoom = false;
this.zoomactive = false;
 
this.hasfocus = false;
this.hasmousefocus = false;
 
this.visibility = true;
this.railslocked = false; // locked by resize
this.locked = false; // prevent lost of locked status sets by user
this.hidden = false; // rails always hidden
this.cursoractive = true; // user can interact with cursors
 
this.wheelprevented = false; //prevent mousewheel event
 
this.overflowx = self.opt.overflowx;
this.overflowy = self.opt.overflowy;
 
this.nativescrollingarea = false;
this.checkarea = 0;
 
this.events = []; // event list for unbind
 
this.saved = {}; // style saved
 
this.delaylist = {};
this.synclist = {};
 
this.lastdeltax = 0;
this.lastdeltay = 0;
 
this.detected = getBrowserDetection();
 
var cap = $.extend({}, this.detected);
 
this.canhwscroll = (cap.hastransform && self.opt.hwacceleration);
this.ishwscroll = (this.canhwscroll && self.haswrapper);
 
if (!this.isrtlmode) {
this.hasreversehr = false;
} else if (this.isvertical) { // RTL mode with reverse horizontal axis
this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11);
} else {
this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11));
}
 
this.istouchcapable = false; // desktop devices with touch screen support
 
//## Check WebKit-based desktop with touch support
//## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
if (!cap.cantouch && (cap.hasw3ctouch||cap.hasmstouch)) { // desktop device with multiple input
this.istouchcapable = true;
} else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
this.istouchcapable = true;
// cap.cantouch = false; // parse normal desktop events
}
 
//## disable MouseLock API on user request
if (!self.opt.enablemouselockapi) {
cap.hasmousecapture = false;
cap.haspointerlock = false;
}
 
/* deprecated
this.delayed = function(name, fn, tm, lazy) {
};
*/
 
/*
this.debounced = function(name, fn, tm) {
if (!self) return;
var dd = self.delaylist[name];
self.delaylist[name] = fn;
if (!dd) {
self.debouncedelayed = setTimeout(function() {
if (!self) return;
var fn = self.delaylist[name];
self.delaylist[name] = false;
fn.call(self);
}, tm);
}
};
*/
 
this.debounced = function(name, fn, tm) {
if (!self) return;
var dd = self.delaylist[name]||false;
if (!dd) {
//fixed loop call fn:checkSelectionScroll
//fn.call(self);
self.delaylist[name] = {
h: setAnimationFrame(function(){
self.delaylist[name].fn.call(self);
self.delaylist[name] = false;
}, tm)
};
fn.call(self);
}
self.delaylist[name].fn = fn;
};
 
var _onsync = false;
 
this.synched = function(name, fn) {
 
function requestSync() {
if (_onsync) return;
setAnimationFrame(function() {
if (!self) return;
_onsync = false;
for (var nn in self.synclist) {
var fn = self.synclist[nn];
if (fn) fn.call(self);
self.synclist[nn] = false;
}
});
_onsync = true;
}
 
self.synclist[name] = fn;
requestSync();
return name;
};
 
this.unsynched = function(name) {
if (self.synclist[name]) self.synclist[name] = false;
};
 
this.css = function(el, pars) { // save & set
for (var n in pars) {
self.saved.css.push([el, n, el.css(n)]);
el.css(n, pars[n]);
}
};
 
this.scrollTop = function(val) {
return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val);
};
 
this.scrollLeft = function(val) {
return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val);
};
 
// derived by by Dan Pupius www.pupius.net
var BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
this.st = st;
this.ed = ed;
this.spd = spd;
 
this.p1 = p1 || 0;
this.p2 = p2 || 1;
this.p3 = p3 || 0;
this.p4 = p4 || 1;
 
this.ts = (new Date()).getTime();
this.df = this.ed - this.st;
};
BezierClass.prototype = {
B2: function(t) {
return 3 * t * t * (1 - t);
},
B3: function(t) {
return 3 * t * (1 - t) * (1 - t);
},
B4: function(t) {
return (1 - t) * (1 - t) * (1 - t);
},
getNow: function() {
var nw = (new Date()).getTime();
var pc = 1 - ((nw - this.ts) / this.spd);
var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz);
},
update: function(ed, spd) {
this.st = this.getNow();
this.ed = ed;
this.spd = spd;
this.ts = (new Date()).getTime();
this.df = this.ed - this.st;
return this;
}
};
 
//derived from http://stackoverflow.com/questions/11236090/
function getMatrixValues() {
var tr = self.doc.css(cap.trstyle);
if (tr && (tr.substr(0, 6) == "matrix")) {
return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
}
return false;
}
 
if (this.ishwscroll) {
// hw accelerated scroll
this.doc.translate = {
x: 0,
y: 0,
tx: "0px",
ty: "0px"
};
 
//this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/
 
this.getScrollTop = function(last) {
if (!last) {
var mtx = getMatrixValues();
if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
}
return self.doc.translate.y;
};
 
this.getScrollLeft = function(last) {
if (!last) {
var mtx = getMatrixValues();
if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
}
return self.doc.translate.x;
};
 
this.notifyScrollEvent = function(el) {
var e = document.createEvent("UIEvents");
e.initUIEvent("scroll", false, true, window, 1);
e.niceevent = true;
el.dispatchEvent(e);
};
 
var cxscrollleft = (this.isrtlmode) ? 1 : -1;
 
if (cap.hastranslate3d && self.opt.enabletranslate3d) {
this.setScrollTop = function(val, silent) {
self.doc.translate.y = val;
self.doc.translate.ty = (val * -1) + "px";
self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
this.setScrollLeft = function(val, silent) {
self.doc.translate.x = val;
self.doc.translate.tx = (val * cxscrollleft) + "px";
self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
} else {
this.setScrollTop = function(val, silent) {
self.doc.translate.y = val;
self.doc.translate.ty = (val * -1) + "px";
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
this.setScrollLeft = function(val, silent) {
self.doc.translate.x = val;
self.doc.translate.tx = (val * cxscrollleft) + "px";
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
}
} else {
// native scroll
this.getScrollTop = function() {
return self.docscroll.scrollTop();
};
this.setScrollTop = function(val) {
return setTimeout(function() {(self)&&self.docscroll.scrollTop(val)}, 1);
};
this.getScrollLeft = function() {
var val;
if (!self.hasreversehr) {
val = self.docscroll.scrollLeft();
} else if (self.detected.ismozilla) {
val = self.page.maxw - Math.abs(self.docscroll.scrollLeft());
} else {
val = self.page.maxw - self.docscroll.scrollLeft();
}
return val;
};
this.setScrollLeft = function(val) {
return setTimeout(function() {
if (!self) return;
if (self.hasreversehr) {
if (self.detected.ismozilla) {
val = -(self.page.maxw - val);
} else {
val = self.page.maxw - val;
}
}
return self.docscroll.scrollLeft(val);
}, 1);
};
}
 
this.getTarget = function(e) {
if (!e) return false;
if (e.target) return e.target;
if (e.srcElement) return e.srcElement;
return false;
};
 
this.hasParent = function(e, id) {
if (!e) return false;
var el = e.target || e.srcElement || e || false;
while (el && el.id != id) {
el = el.parentNode || false;
}
return (el !== false);
};
 
function getZIndex() {
var dom = self.win;
if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
while (dom.length > 0) {
if (dom[0].nodeType == 9) return false;
var zi = dom.css('zIndex');
if (!isNaN(zi) && zi != 0) return parseInt(zi);
dom = dom.parent();
}
return false;
}
 
//inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
var _convertBorderWidth = {
"thin": 1,
"medium": 3,
"thick": 5
};
 
function getWidthToPixel(dom, prop, chkheight) {
var wd = dom.css(prop);
var px = parseFloat(wd);
if (isNaN(px)) {
px = _convertBorderWidth[wd] || 0;
var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
if (self.isie8 && px) px += 1;
return (brd) ? px : 0;
}
return px;
}
 
this.getDocumentScrollOffset = function() {
return {
top: window.pageYOffset || document.documentElement.scrollTop,
left: window.pageXOffset || document.documentElement.scrollLeft
};
};
this.getOffset = function() {
if (self.isfixed) {
var ofs = self.win.offset(); // fix Chrome auto issue (when right/bottom props only)
var scrl = self.getDocumentScrollOffset();
ofs.top-=scrl.top;
ofs.left-=scrl.left;
return ofs;
}
var ww = self.win.offset();
if (!self.viewport) return ww;
var vp = self.viewport.offset();
return {
top: ww.top - vp.top,// + self.viewport.scrollTop(),
left: ww.left - vp.left // + self.viewport.scrollLeft()
};
};
 
this.updateScrollBar = function(len) {
var pos, off;
if (self.ishwscroll) {
self.rail.css({ //**
height: self.win.innerHeight() - (self.opt.railpadding.top + self.opt.railpadding.bottom)
});
if (self.railh) self.railh.css({ //**
width: self.win.innerWidth() - (self.opt.railpadding.left + self.opt.railpadding.right)
});
} else {
var wpos = self.getOffset();
pos = {
top: wpos.top,
left: wpos.left - (self.opt.railpadding.left + self.opt.railpadding.right)
};
pos.top += getWidthToPixel(self.win, 'border-top-width', true);
pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');
 
off = self.opt.railoffset;
if (off) {
if (off.top) pos.top += off.top;
if (off.left) pos.left += off.left;
}
if (!self.railslocked) self.rail.css({
top: pos.top,
left: pos.left,
height: ((len) ? len.h : self.win.innerHeight()) - (self.opt.railpadding.top + self.opt.railpadding.bottom)
});
 
if (self.zoom) {
self.zoom.css({
top: pos.top + 1,
left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
});
}
 
if (self.railh && !self.railslocked) {
pos = {
top: wpos.top,
left: wpos.left
};
off = self.opt.railhoffset;
if (off) {
if (off.top) pos.top += off.top;
if (off.left) pos.left += off.left;
}
var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
self.railh.css({
top: y - (self.opt.railpadding.top + self.opt.railpadding.bottom),
left: x,
width: self.railh.width
});
}
 
}
};
 
this.doRailClick = function(e, dbl, hr) {
var fn, pg, cur, pos;
 
if (self.railslocked) return;
self.cancelEvent(e);
 
if (dbl) {
fn = (hr) ? self.doScrollLeft : self.doScrollTop;
cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
fn(cur);
} else {
fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
cur = (hr) ? self.scroll.x : self.scroll.y;
pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
pg = (hr) ? self.view.w : self.view.h;
fn((cur >= pos) ? pg: -pg);// (cur >= pos) ? fn(pg): fn(-pg);
}
 
};
 
self.hasanimationframe = (setAnimationFrame);
self.hascancelanimationframe = (clearAnimationFrame);
 
if (!self.hasanimationframe) {
setAnimationFrame = function(fn) {
return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
}; // 1000/60)};
clearAnimationFrame = clearTimeout;
} else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
self.cancelAnimationFrame = true;
};
 
this.init = function() {
self.saved.css = [];
if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
 
var _touchaction = (cap.isie10) ? '-ms-touch-action' : 'touch-action';
if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, {
_touchaction: 'none'
});
 
var _scrollyhidden = (cap.ismodernie||cap.isie10) ? {'-ms-overflow-style':'none'} : {'overflow-y':'hidden'}; // IE is always a world apart!
self.zindex = "auto";
if (!self.ispage && self.opt.zindex == "auto") {
self.zindex = getZIndex() || "auto";
} else {
self.zindex = self.opt.zindex;
}
 
if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) {
globalmaxzindex = self.zindex;
}
 
if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0
self.zindex = "auto";
}
 
if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
 
var cont = self.docscroll;
if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;
 
if (!cap.isie9mobile) self.css(cont, _scrollyhidden);
 
if (self.ispage && cap.isie7) {
if (self.doc[0].nodeName == 'BODY') self.css($("html"), {
'overflow-y': 'hidden'
}); //IE7 double scrollbar issue
else if (self.doc[0].nodeName == 'HTML') self.css($("body"), _scrollyhidden); //IE7 double scrollbar issue
}
 
if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), {
"-webkit-overflow-scrolling": "touch"
}); //force hw acceleration
 
var cursor = $(document.createElement('div'));
cursor.css({
position: "relative",
top: 0,
"float": "right",
width: self.opt.cursorwidth,
height: 0,
'background-color': self.opt.cursorcolor,
border: self.opt.cursorborder,
'background-clip': 'padding-box',
'-webkit-border-radius': self.opt.cursorborderradius,
'-moz-border-radius': self.opt.cursorborderradius,
'border-radius': self.opt.cursorborderradius
});
 
cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
cursor.addClass('nicescroll-cursors');
self.cursor = cursor;
 
var rail = $(document.createElement('div'));
rail.attr('id', self.id);
rail.addClass('nicescroll-rails nicescroll-rails-vr');
 
var v, a, kp = ["left","right","top","bottom"]; //**
for (var n in kp) {
a = kp[n];
v = self.opt.railpadding[a];
(v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
}
 
rail.append(cursor);
 
rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth());
rail.css({
width: rail.width + "px",
zIndex: self.zindex,
background: self.opt.background,
cursor: "default"
});
 
rail.visibility = true;
rail.scrollable = true;
 
rail.align = (self.opt.railalign == "left") ? 0 : 1;
 
self.rail = rail;
 
self.rail.drag = false;
 
var zoom = false;
if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
zoom = document.createElement('div');
 
self.bind(zoom, "click", self.doZoom);
self.bind(zoom, "mouseenter", function() {
self.zoom.css('opacity', self.opt.cursoropacitymax);
});
self.bind(zoom, "mouseleave", function() {
self.zoom.css('opacity', self.opt.cursoropacitymin);
});
 
self.zoom = $(zoom);
self.zoom.css({
cursor: "pointer",
zIndex: self.zindex,
backgroundImage: 'url(' + self.opt.scriptpath + 'zoomico.png)',
height: 18,
width: 18,
backgroundPosition: '0px 0px'
});
if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
if (cap.cantouch && self.opt.gesturezoom) {
self.ongesturezoom = function(e) {
if (e.scale > 1.5) self.doZoomIn(e);
if (e.scale < 0.8) self.doZoomOut(e);
return self.cancelEvent(e);
};
self.bind(self.win, "gestureend", self.ongesturezoom);
}
}
 
// init HORIZ
 
self.railh = false;
var railh;
 
if (self.opt.horizrailenabled) {
 
self.css(cont, {
overflowX: 'hidden'
});
 
var cursor = $(document.createElement('div'));
cursor.css({
position: "absolute",
top: 0,
height: self.opt.cursorwidth,
width: 0,
backgroundColor: self.opt.cursorcolor,
border: self.opt.cursorborder,
backgroundClip: 'padding-box',
'-webkit-border-radius': self.opt.cursorborderradius,
'-moz-border-radius': self.opt.cursorborderradius,
'border-radius': self.opt.cursorborderradius
});
 
if (cap.isieold) cursor.css('overflow', 'hidden'); //IE6 horiz scrollbar issue
cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
cursor.addClass('nicescroll-cursors');
self.cursorh = cursor;
 
railh = $(document.createElement('div'));
railh.attr('id', self.id + '-hr');
railh.addClass('nicescroll-rails nicescroll-rails-hr');
railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight());
railh.css({
height: railh.height + "px",
'zIndex': self.zindex,
"background": self.opt.background
});
 
railh.append(cursor);
 
railh.visibility = true;
railh.scrollable = true;
 
railh.align = (self.opt.railvalign == "top") ? 0 : 1;
 
self.railh = railh;
 
self.railh.drag = false;
 
}
 
//
 
if (self.ispage) {
rail.css({
position: "fixed",
top: 0,
height: "100%"
});
(rail.align) ? rail.css({
right: 0
}): rail.css({
left: 0
});
self.body.append(rail);
if (self.railh) {
railh.css({
position: "fixed",
left: 0,
width: "100%"
});
(railh.align) ? railh.css({
bottom: 0
}): railh.css({
top: 0
});
self.body.append(railh);
}
} else {
if (self.ishwscroll) {
if (self.win.css('position') == 'static') self.css(self.win, {
'position': 'relative'
});
var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
$(bd).scrollTop(0).scrollLeft(0); // fix rail position if content already scrolled
if (self.zoom) {
self.zoom.css({
position: "absolute",
top: 1,
right: 0,
"margin-right": rail.width + 4
});
bd.append(self.zoom);
}
rail.css({
position: "absolute",
top: 0
});
(rail.align) ? rail.css({
right: 0
}): rail.css({
left: 0
});
bd.append(rail);
if (railh) {
railh.css({
position: "absolute",
left: 0,
bottom: 0
});
(railh.align) ? railh.css({
bottom: 0
}): railh.css({
top: 0
});
bd.append(railh);
}
} else {
self.isfixed = (self.win.css("position") == "fixed");
var rlpos = (self.isfixed) ? "fixed" : "absolute";
 
if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
if (self.viewport) {
self.body = self.viewport;
if ((/fixed|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, {
"position": "relative"
});
}
 
rail.css({
position: rlpos
});
if (self.zoom) self.zoom.css({
position: rlpos
});
self.updateScrollBar();
self.body.append(rail);
if (self.zoom) self.body.append(self.zoom);
if (self.railh) {
railh.css({
position: rlpos
});
self.body.append(railh);
}
}
 
if (cap.isios) self.css(self.win, {
'-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
'-webkit-touch-callout': 'none'
}); // prevent grey layer on click
 
if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
if (cap.iswebkit && self.opt.disableoutline) self.win.css('outline', 'none'); // Webkit outline
//if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera 12- to test [TODO]
 
}
 
if (self.opt.autohidemode === false) {
self.autohidedom = false;
self.rail.css({
opacity: self.opt.cursoropacitymax
});
if (self.railh) self.railh.css({
opacity: self.opt.cursoropacitymax
});
} else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) {
self.autohidedom = $().add(self.rail);
if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
} else if (self.opt.autohidemode == "scroll") {
self.autohidedom = $().add(self.rail);
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
} else if (self.opt.autohidemode == "cursor") {
self.autohidedom = $().add(self.cursor);
if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
} else if (self.opt.autohidemode == "hidden") {
self.autohidedom = false;
self.hide();
self.railslocked = false;
}
 
if (cap.isie9mobile) {
 
self.scrollmom = new ScrollMomentumClass2D(self);
 
self.onmangotouch = function() {
var py = self.getScrollTop();
var px = self.getScrollLeft();
 
if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true;
 
var dfy = py - self.mangotouch.sy;
var dfx = px - self.mangotouch.sx;
var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)));
if (df == 0) return;
 
var dry = (dfy < 0) ? -1 : 1;
var drx = (dfx < 0) ? -1 : 1;
 
var tm = +new Date();
if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
 
if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) {
self.scrollmom.stop();
self.scrollmom.reset(px, py);
self.mangotouch.sy = py;
self.mangotouch.ly = py;
self.mangotouch.sx = px;
self.mangotouch.lx = px;
self.mangotouch.dry = dry;
self.mangotouch.drx = drx;
self.mangotouch.tm = tm;
} else {
 
self.scrollmom.stop();
self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy);
self.mangotouch.tm = tm;
 
var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px));
self.mangotouch.ly = py;
self.mangotouch.lx = px;
 
if (ds > 2) {
self.mangotouch.lazy = setTimeout(function() {
self.mangotouch.lazy = false;
self.mangotouch.dry = 0;
self.mangotouch.drx = 0;
self.mangotouch.tm = 0;
self.scrollmom.doMomentum(30);
}, 100);
}
}
};
 
var top = self.getScrollTop();
var lef = self.getScrollLeft();
self.mangotouch = {
sy: top,
ly: top,
dry: 0,
sx: lef,
lx: lef,
drx: 0,
lazy: false,
tm: 0
};
 
self.bind(self.docscroll, "scroll", self.onmangotouch);
 
} else {
 
if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {
 
self.scrollmom = new ScrollMomentumClass2D(self);
 
self.ontouchstart = function(e) {
if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
self.hasmoving = false;
 
if (!self.railslocked) {
var tg;
if (cap.hasmstouch) {
tg = (e.target) ? e.target : false;
while (tg) {
var nc = $(tg).getNiceScroll();
if ((nc.length > 0) && (nc[0].me == self.me)) break;
if (nc.length > 0) return false;
if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break;
tg = (tg.parentNode) ? tg.parentNode : false;
}
}
 
self.cancelScroll();
 
tg = self.getTarget(e);
 
if (tg) {
var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
if (skp) return self.stopPropagation(e);
}
 
if (!("clientX" in e) && ("changedTouches" in e)) {
e.clientX = e.changedTouches[0].clientX;
e.clientY = e.changedTouches[0].clientY;
}
 
if (self.forcescreen) {
var le = e;
e = {
"original": (e.original) ? e.original : e
};
e.clientX = le.screenX;
e.clientY = le.screenY;
}
 
self.rail.drag = {
x: e.clientX,
y: e.clientY,
sx: self.scroll.x,
sy: self.scroll.y,
st: self.getScrollTop(),
sl: self.getScrollLeft(),
pt: 2,
dl: false
};
 
if (self.ispage || !self.opt.directionlockdeadzone) {
self.rail.drag.dl = "f";
} else {
 
var view = {
w: $(window).width(),
h: $(window).height()
};
 
var page = {
w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
};
 
var maxh = Math.max(0, page.h - view.h);
var maxw = Math.max(0, page.w - view.w);
 
if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
else self.rail.drag.ck = false;
if (!self.rail.drag.ck) self.rail.drag.dl = "f";
}
 
if (self.opt.touchbehavior && self.isiframe && cap.isie) {
var wp = self.win.position();
self.rail.drag.x += wp.left;
self.rail.drag.y += wp.top;
}
 
self.hasmoving = false;
self.lastmouseup = false;
self.scrollmom.reset(e.clientX, e.clientY);
if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {
var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false;
if (!ip) {
if (!self.ispage && cap.hasmousecapture) tg.setCapture();
if (self.opt.touchbehavior) {
if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
tg._onclick = tg.onclick;
tg.onclick = function(e) {
if (self.hasmoving) return false;
tg._onclick.call(this, e);
};
}
return self.cancelEvent(e);
}
return self.stopPropagation(e);
}
 
if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
self.preventclick = {
"tg": tg,
"click": false
};
}
 
}
}
 
};
 
self.ontouchend = function(e) {
if (!self.rail.drag) return true;
if (self.rail.drag.pt == 2) {
if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
self.scrollmom.doMomentum();
self.rail.drag = false;
if (self.hasmoving) {
self.lastmouseup = true;
self.hideCursor();
if (cap.hasmousecapture) document.releaseCapture();
if (!cap.cantouch) return self.cancelEvent(e);
}
}
else if (self.rail.drag.pt == 1) {
return self.onmouseup(e);
}
 
};
 
var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture);
 
self.ontouchmove = function(e, byiframe) {
 
if (!self.rail.drag) return false;
if (e.targetTouches && self.opt.preventmultitouchscrolling) {
if (e.targetTouches.length > 1) return false; // multitouch
}
if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
if (self.rail.drag.pt == 2) {
if (cap.cantouch && (cap.isios) && e.original === undefined) return true; // prevent ios "ghost" events by clickable elements
 
self.hasmoving = true;
 
if (self.preventclick && !self.preventclick.click) {
self.preventclick.click = self.preventclick.tg.onclick || false;
self.preventclick.tg.onclick = self.onpreventclick;
}
 
var ev = $.extend({
"original": e
}, e);
e = ev;
 
if (("changedTouches" in e)) {
e.clientX = e.changedTouches[0].clientX;
e.clientY = e.changedTouches[0].clientY;
}
 
if (self.forcescreen) {
var le = e;
e = {
"original": (e.original) ? e.original : e
};
e.clientX = le.screenX;
e.clientY = le.screenY;
}
 
var ofy,ofx;
ofx = ofy = 0;
 
if (moveneedoffset && !byiframe) {
var wp = self.win.position();
ofx = -wp.left;
ofy = -wp.top;
}
 
var fy = e.clientY + ofy;
var my = (fy - self.rail.drag.y);
var fx = e.clientX + ofx;
var mx = (fx - self.rail.drag.x);
 
var ny = self.rail.drag.st - my;
 
if (self.ishwscroll && self.opt.bouncescroll) {
if (ny < 0) {
ny = Math.round(ny / 2);
// fy = 0;
} else if (ny > self.page.maxh) {
ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
// fy = 0;
}
} else {
if (ny < 0) {
ny = 0;
fy = 0;
}
if (ny > self.page.maxh) {
ny = self.page.maxh;
fy = 0;
}
}
 
var nx;
if (self.railh && self.railh.scrollable) {
nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
 
if (self.ishwscroll && self.opt.bouncescroll) {
if (nx < 0) {
nx = Math.round(nx / 2);
// fx = 0;
} else if (nx > self.page.maxw) {
nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
// fx = 0;
}
} else {
if (nx < 0) {
nx = 0;
fx = 0;
}
if (nx > self.page.maxw) {
nx = self.page.maxw;
fx = 0;
}
}
 
}
 
var grabbed = false;
if (self.rail.drag.dl) {
grabbed = true;
if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
} else {
var ay = Math.abs(my);
var ax = Math.abs(mx);
var dz = self.opt.directionlockdeadzone;
if (self.rail.drag.ck == "v") {
if (ay > dz && (ax <= (ay * 0.3))) {
self.rail.drag = false;
return true;
} else if (ax > dz) {
self.rail.drag.dl = "f";
$("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
}
} else if (self.rail.drag.ck == "h") {
if (ax > dz && (ay <= (ax * 0.3))) {
self.rail.drag = false;
return true;
} else if (ay > dz) {
self.rail.drag.dl = "f";
$("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
}
}
}
 
self.synched("touchmove", function() {
if (self.rail.drag && (self.rail.drag.pt == 2)) {
if (self.prepareTransition) self.prepareTransition(0);
if (self.rail.scrollable) self.setScrollTop(ny);
self.scrollmom.update(fx, fy);
if (self.railh && self.railh.scrollable) {
self.setScrollLeft(nx);
self.showCursor(ny, nx);
} else {
self.showCursor(ny);
}
if (cap.isie10) document.selection.clear();
}
});
 
if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like!
if (grabbed) return self.cancelEvent(e);
}
else if (self.rail.drag.pt == 1) { // drag on cursor
return self.onmousemove(e);
}
 
};
 
self.ontouchstartCursor = function (e, hronly) {
if (self.rail.drag && self.rail.drag.pt != 3) return;
if (self.locked) return self.cancelEvent(e);
self.cancelScroll();
self.rail.drag = {
x: e.touches[0].clientX,
y: e.touches[0].clientY,
sx: self.scroll.x,
sy: self.scroll.y,
pt: 3,
hr: (!!hronly)
};
var tg = self.getTarget(e);
if (!self.ispage && cap.hasmousecapture) tg.setCapture();
if (self.isiframe && !cap.hasmousecapture) {
self.saved["csspointerevents"] = self.doc.css("pointer-events");
self.css(self.doc, {"pointer-events": "none"});
}
return self.cancelEvent(e);
};
 
self.ontouchendCursor = function (e) {
if (self.rail.drag) {
if (cap.hasmousecapture) document.releaseCapture();
if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved["csspointerevents"]);
if (self.rail.drag.pt != 3)return;
self.rail.drag = false;
//if (!self.rail.active) self.hideCursor();
return self.cancelEvent(e);
}
};
 
self.ontouchmoveCursor = function (e) {
if (self.rail.drag) {
if (self.rail.drag.pt != 3)return;
 
self.cursorfreezed = true;
 
if (self.rail.drag.hr) {
self.scroll.x = self.rail.drag.sx + (e.touches[0].clientX - self.rail.drag.x);
if (self.scroll.x < 0) self.scroll.x = 0;
var mw = self.scrollvaluemaxw;
if (self.scroll.x > mw) self.scroll.x = mw;
} else {
self.scroll.y = self.rail.drag.sy + (e.touches[0].clientY - self.rail.drag.y);
if (self.scroll.y < 0) self.scroll.y = 0;
var my = self.scrollvaluemax;
if (self.scroll.y > my) self.scroll.y = my;
}
 
self.synched('touchmove', function () {
if (self.rail.drag && (self.rail.drag.pt == 3)) {
self.showCursor();
if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
}
});
 
return self.cancelEvent(e);
}
/*
else {
self.checkarea = true;
}
*/
};
 
}
 
self.onmousedown = function(e, hronly) {
if (self.rail.drag && self.rail.drag.pt != 1) return;
if (self.railslocked) return self.cancelEvent(e);
self.cancelScroll();
self.rail.drag = {
x: e.clientX,
y: e.clientY,
sx: self.scroll.x,
sy: self.scroll.y,
pt: 1,
hr: (!!hronly)
};
var tg = self.getTarget(e);
if (!self.ispage && cap.hasmousecapture) tg.setCapture();
if (self.isiframe && !cap.hasmousecapture) {
self.saved.csspointerevents = self.doc.css("pointer-events");
self.css(self.doc, {
"pointer-events": "none"
});
}
self.hasmoving = false;
return self.cancelEvent(e);
};
 
self.onmouseup = function(e) {
if (self.rail.drag) {
if (self.rail.drag.pt != 1) return true;
if (cap.hasmousecapture) document.releaseCapture();
if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
self.rail.drag = false;
//if (!self.rail.active) self.hideCursor();
if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning
return self.cancelEvent(e);
}
};
 
self.onmousemove = function(e) {
if (self.rail.drag) {
if (self.rail.drag.pt != 1) return;
 
if (cap.ischrome && e.which == 0) return self.onmouseup(e);
 
self.cursorfreezed = true;
self.hasmoving = true;
 
if (self.rail.drag.hr) {
self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
if (self.scroll.x < 0) self.scroll.x = 0;
var mw = self.scrollvaluemaxw;
if (self.scroll.x > mw) self.scroll.x = mw;
} else {
self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
if (self.scroll.y < 0) self.scroll.y = 0;
var my = self.scrollvaluemax;
if (self.scroll.y > my) self.scroll.y = my;
}
 
self.synched('mousemove', function() {
if (self.rail.drag && (self.rail.drag.pt == 1)) {
self.showCursor();
if (self.rail.drag.hr) {
if (self.hasreversehr) {
self.doScrollLeft(self.scrollvaluemaxw-Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
} else {
self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
}
}
else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
}
});
 
return self.cancelEvent(e);
}
else {
self.checkarea = 0;
}
};
 
if (cap.cantouch || self.opt.touchbehavior) {
 
self.onpreventclick = function(e) {
if (self.preventclick) {
self.preventclick.tg.onclick = self.preventclick.click;
self.preventclick = false;
return self.cancelEvent(e);
}
};
 
self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging
 
self.onclick = (cap.isios) ? false : function(e) { // it needs to check IE11 ???
if (self.lastmouseup) {
self.lastmouseup = false;
return self.cancelEvent(e);
} else {
return true;
}
};
 
if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
self.css((self.ispage) ? self.doc : self.win, {
'cursor': cap.cursorgrabvalue
});
self.css(self.rail, {
'cursor': cap.cursorgrabvalue
});
}
 
} else {
 
var checkSelectionScroll = function(e) {
if (!self.selectiondrag) return;
 
if (e) {
var ww = self.win.outerHeight();
var df = (e.pageY - self.selectiondrag.top);
if (df > 0 && df < ww) df = 0;
if (df >= ww) df -= ww;
self.selectiondrag.df = df;
}
if (self.selectiondrag.df == 0) return;
 
var rt = -Math.floor(self.selectiondrag.df / 6) * 2;
self.doScrollBy(rt);
 
self.debounced("doselectionscroll", function() {
checkSelectionScroll();
}, 50);
};
 
if ("getSelection" in document) { // A grade - Major browsers
self.hasTextSelected = function() {
return (document.getSelection().rangeCount > 0);
};
} else if ("selection" in document) { //IE9-
self.hasTextSelected = function() {
return (document.selection.type != "None");
};
} else {
self.hasTextSelected = function() { // no support
return false;
};
}
 
self.onselectionstart = function(e) {
/* More testing - severe chrome issues
if (!self.haswrapper&&(e.which&&e.which==2)) { // fool browser to manage middle button scrolling
self.win.css({'overflow':'auto'});
setTimeout(function(){
self.win.css({'overflow':''});
},10);
return true;
}
*/
if (self.ispage) return;
self.selectiondrag = self.win.offset();
};
self.onselectionend = function(e) {
self.selectiondrag = false;
};
self.onselectiondrag = function(e) {
if (!self.selectiondrag) return;
if (self.hasTextSelected()) self.debounced("selectionscroll", function() {
checkSelectionScroll(e);
}, 250);
};
 
 
}
 
if (cap.hasw3ctouch) { //IE11+
self.css(self.rail, {
'touch-action': 'none'
});
self.css(self.cursor, {
'touch-action': 'none'
});
self.bind(self.win, "pointerdown", self.ontouchstart);
self.bind(document, "pointerup", self.ontouchend);
self.bind(document, "pointermove", self.ontouchmove);
} else if (cap.hasmstouch) { //IE10
self.css(self.rail, {
'-ms-touch-action': 'none'
});
self.css(self.cursor, {
'-ms-touch-action': 'none'
});
self.bind(self.win, "MSPointerDown", self.ontouchstart);
self.bind(document, "MSPointerUp", self.ontouchend);
self.bind(document, "MSPointerMove", self.ontouchmove);
self.bind(self.cursor, "MSGestureHold", function(e) {
e.preventDefault();
});
self.bind(self.cursor, "contextmenu", function(e) {
e.preventDefault();
});
} else if (this.istouchcapable) { //desktop with screen touch enabled
self.bind(self.win, "touchstart", self.ontouchstart);
self.bind(document, "touchend", self.ontouchend);
self.bind(document, "touchcancel", self.ontouchend);
self.bind(document, "touchmove", self.ontouchmove);
}
 
if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) {
 
self.rail.css({
cursor: "default"
});
self.railh && self.railh.css({
cursor: "default"
});
 
self.jqbind(self.rail, "mouseenter", function() {
if (!self.ispage && !self.win.is(":visible")) return false;
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true;
});
self.jqbind(self.rail, "mouseleave", function() {
self.rail.active = false;
if (!self.rail.drag) self.hideCursor();
});
 
if (self.opt.sensitiverail) {
self.bind(self.rail, "click", function(e) {
self.doRailClick(e, false, false);
});
self.bind(self.rail, "dblclick", function(e) {
self.doRailClick(e, true, false);
});
self.bind(self.cursor, "click", function(e) {
self.cancelEvent(e);
});
self.bind(self.cursor, "dblclick", function(e) {
self.cancelEvent(e);
});
}
 
if (self.railh) {
self.jqbind(self.railh, "mouseenter", function() {
if (!self.ispage && !self.win.is(":visible")) return false;
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true;
});
self.jqbind(self.railh, "mouseleave", function() {
self.rail.active = false;
if (!self.rail.drag) self.hideCursor();
});
 
if (self.opt.sensitiverail) {
self.bind(self.railh, "click", function(e) {
self.doRailClick(e, false, true);
});
self.bind(self.railh, "dblclick", function(e) {
self.doRailClick(e, true, true);
});
self.bind(self.cursorh, "click", function(e) {
self.cancelEvent(e);
});
self.bind(self.cursorh, "dblclick", function(e) {
self.cancelEvent(e);
});
}
 
}
 
}
 
if(self.opt.cursordragontouch && (this.istouchcapable || cap.cantouch)) {
self.bind(self.cursor, "touchstart", self.ontouchstartCursor);
self.bind(self.cursor, "touchmove", self.ontouchmoveCursor);
self.bind(self.cursor, "touchend", self.ontouchendCursor);
self.cursorh && self.bind(self.cursorh, "touchstart", function(e) {
self.ontouchstartCursor(e, true);
});
self.cursorh && self.bind(self.cursorh, "touchmove", self.ontouchmoveCursor);
self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor);
}
 
if (!cap.cantouch && !self.opt.touchbehavior) {
 
self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
self.bind(document, "mousemove", self.onmousemove);
if (self.onclick) self.bind(document, "click", self.onclick);
 
self.bind(self.cursor, "mousedown", self.onmousedown);
self.bind(self.cursor, "mouseup", self.onmouseup);
 
if (self.railh) {
self.bind(self.cursorh, "mousedown", function(e) {
self.onmousedown(e, true);
});
self.bind(self.cursorh, "mouseup", self.onmouseup);
}
if (!self.ispage && self.opt.enablescrollonselection) {
self.bind(self.win[0], "mousedown", self.onselectionstart);
self.bind(document, "mouseup", self.onselectionend);
self.bind(self.cursor, "mouseup", self.onselectionend);
if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
self.bind(document, "mousemove", self.onselectiondrag);
}
 
if (self.zoom) {
self.jqbind(self.zoom, "mouseenter", function() {
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true;
});
self.jqbind(self.zoom, "mouseleave", function() {
self.rail.active = false;
if (!self.rail.drag) self.hideCursor();
});
}
 
} else {
 
self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
self.bind(document, "mousemove", self.ontouchmove);
if (self.onclick) self.bind(document, "click", self.onclick);
 
if (self.opt.cursordragontouch) {
self.bind(self.cursor, "mousedown", self.onmousedown);
self.bind(self.cursor, "mouseup", self.onmouseup);
//self.bind(self.cursor, "mousemove", self.onmousemove);
self.cursorh && self.bind(self.cursorh, "mousedown", function(e) {
self.onmousedown(e, true);
});
//self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove);
self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
} else {
self.bind(self.rail, "mousedown", function(e){e.preventDefault();}); // prevent text selection
self.railh&&self.bind(self.railh, "mousedown", function(e){e.preventDefault();});
}
 
}
 
if (self.opt.enablemousewheel) {
if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? document : self.win , self.onmousewheel);
self.mousewheel(self.rail, self.onmousewheel);
if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr);
}
 
if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
if (!self.win.attr("tabindex")) self.win.attr({
"tabindex": tabindexcounter++
});
 
self.jqbind(self.win, "focus", function(e) {
domfocus = (self.getTarget(e)).id || true;
self.hasfocus = true;
if (self.canshowonmouseevent) self.noticeCursor();
});
self.jqbind(self.win, "blur", function(e) {
domfocus = false;
self.hasfocus = false;
});
 
self.jqbind(self.win, "mouseenter", function(e) {
mousefocus = (self.getTarget(e)).id || true;
self.hasmousefocus = true;
if (self.canshowonmouseevent) self.noticeCursor();
});
self.jqbind(self.win, "mouseleave", function() {
mousefocus = false;
self.hasmousefocus = false;
if (!self.rail.drag) self.hideCursor();
});
 
}
 
} // !ie9mobile
 
//Thanks to http://www.quirksmode.org !!
self.onkeypress = function(e) {
if (self.railslocked && self.page.maxh == 0) return true;
 
e = (e) ? e : window.e;
var tg = self.getTarget(e);
if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
var tp = tg.getAttribute('type') || tg.type || false;
if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
}
 
if ($(tg).attr('contenteditable')) return true;
 
if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
var key = e.keyCode;
 
if (self.railslocked && key != 27) return self.cancelEvent(e);
 
var ctrl = e.ctrlKey || false;
var shift = e.shiftKey || false;
 
var ret = false;
switch (key) {
case 38:
case 63233: //safari
self.doScrollBy(24 * 3);
ret = true;
break;
case 40:
case 63235: //safari
self.doScrollBy(-24 * 3);
ret = true;
break;
case 37:
case 63232: //safari
if (self.railh) {
(ctrl) ? self.doScrollLeft(0): self.doScrollLeftBy(24 * 3);
ret = true;
}
break;
case 39:
case 63234: //safari
if (self.railh) {
(ctrl) ? self.doScrollLeft(self.page.maxw): self.doScrollLeftBy(-24 * 3);
ret = true;
}
break;
case 33:
case 63276: // safari
self.doScrollBy(self.view.h);
ret = true;
break;
case 34:
case 63277: // safari
self.doScrollBy(-self.view.h);
ret = true;
break;
case 36:
case 63273: // safari
(self.railh && ctrl) ? self.doScrollPos(0, 0): self.doScrollTo(0);
ret = true;
break;
case 35:
case 63275: // safari
(self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh): self.doScrollTo(self.page.maxh);
ret = true;
break;
case 32:
if (self.opt.spacebarenabled) {
(shift) ? self.doScrollBy(self.view.h): self.doScrollBy(-self.view.h);
ret = true;
}
break;
case 27: // ESC
if (self.zoomactive) {
self.doZoom();
ret = true;
}
break;
}
if (ret) return self.cancelEvent(e);
}
};
 
if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
 
self.bind(document, "keydown", function(e) {
var ctrl = e.ctrlKey || false;
if (ctrl) self.wheelprevented = true;
});
self.bind(document, "keyup", function(e) {
var ctrl = e.ctrlKey || false;
if (!ctrl) self.wheelprevented = false;
});
self.bind(window,"blur",function(e){
self.wheelprevented = false;
});
 
self.bind(window, 'resize', self.lazyResize);
self.bind(window, 'orientationchange', self.lazyResize);
 
self.bind(window, "load", self.lazyResize);
 
if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
var tmp = self.win.attr("style");
var ww = parseFloat(self.win.css("width")) + 1;
self.win.css('width', ww);
self.synched("chromefix", function() {
self.win.attr("style", tmp);
});
}
 
 
// Trying a cross-browser implementation - good luck!
 
self.onAttributeChange = function(e) {
self.lazyResize(self.isieold ? 250 : 30);
};
 
if ((!self.isie11) && (ClsMutationObserver !== false)) { // IE11 crashes #568
self.observerbody = new ClsMutationObserver(function(mutations) {
mutations.forEach(function(mut){
if (mut.type=="attributes") {
return ($("body").hasClass("modal-open") && $("body").hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show(); // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
}
});
// if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
if (self.me.clientWidth!=self.page.width || self.me.clientHeight!=self.page.height) return self.lazyResize(30);
});
self.observerbody.observe(document.body, {
childList: true,
subtree: true,
characterData: false,
attributes: true,
attributeFilter: ['class']
});
}
if (!self.ispage && !self.haswrapper) {
// redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
if (ClsMutationObserver !== false) {
self.observer = new ClsMutationObserver(function(mutations) {
mutations.forEach(self.onAttributeChange);
});
self.observer.observe(self.win[0], {
childList: true,
characterData: false,
attributes: true,
subtree: false
});
self.observerremover = new ClsMutationObserver(function(mutations) {
mutations.forEach(function(mo) {
if (mo.removedNodes.length > 0) {
for (var dd in mo.removedNodes) {
if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
}
}
});
});
self.observerremover.observe(self.win[0].parentNode, {
childList: true,
characterData: false,
attributes: false,
subtree: false
});
} else {
self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
self.bind(self.win, "DOMNodeRemoved", function(e) {
if (e.target == self.win[0]) self.remove();
});
}
}
 
//
 
if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom);
if (self.istextarea) {
self.bind(self.win, "keydown", self.lazyResize);
self.bind(self.win, "mouseup", self.lazyResize);
}
 
// self.checkrtlmode = true;
self.lazyResize(30);
 
}
if (this.doc[0].nodeName == 'IFRAME') {
var oniframeload = function() {
self.iframexd = false;
var doc;
try {
doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
var a = doc.domain;
} catch (e) {
self.iframexd = true;
doc = false;
}
if (self.iframexd) {
if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
return true; //cross-domain - I can't manage this
}
 
self.forcescreen = true;
 
if (self.isiframe) {
self.iframe = {
"doc": $(doc),
"html": self.doc.contents().find('html')[0],
"body": self.doc.contents().find('body')[0]
};
self.getContentSize = function() {
return {
w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
};
};
self.docscroll = $(self.iframe.body); //$(this.contentWindow);
}
 
if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
self.win.scrollTop(0); // reset position
self.doc.height(""); //reset height to fix browser bug
var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
self.doc.height(hh);
}
self.lazyResize(30);
 
if (cap.isie7) self.css($(self.iframe.html), _scrollyhidden);
self.css($(self.iframe.body), _scrollyhidden);
 
if (cap.isios && self.haswrapper) {
self.css($(doc.body), {
'-webkit-transform': 'translate3d(0,0,0)'
}); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
}
 
if ('contentWindow' in this) {
self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
} else {
self.bind(doc, "scroll", self.onscroll);
}
 
if (self.opt.enablemousewheel) {
self.mousewheel(doc, self.onmousewheel);
}
 
if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
 
if (cap.cantouch || self.opt.touchbehavior) {
self.bind(doc, "mousedown", self.ontouchstart);
self.bind(doc, "mousemove", function(e) {
return self.ontouchmove(e, true);
});
if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
'cursor': cap.cursorgrabvalue
});
}
 
self.bind(doc, "mouseup", self.ontouchend);
 
if (self.zoom) {
if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
}
};
 
if (this.doc[0].readyState && this.doc[0].readyState == "complete") {
setTimeout(function() {
oniframeload.call(self.doc[0], false);
}, 500);
}
self.bind(this.doc, "load", oniframeload);
 
}
 
};
 
this.showCursor = function(py, px) {
if (self.cursortimeout) {
clearTimeout(self.cursortimeout);
self.cursortimeout = 0;
}
if (!self.rail) return;
if (self.autohidedom) {
self.autohidedom.stop().css({
opacity: self.opt.cursoropacitymax
});
self.cursoractive = true;
}
 
if (!self.rail.drag || self.rail.drag.pt != 1) {
if (py !== undefined && py !== false) {
self.scroll.y = Math.round(py * 1 / self.scrollratio.y);
}
if (px !== undefined) {
self.scroll.x = Math.round(px * 1 / self.scrollratio.x);
}
}
 
self.cursor.css({
height: self.cursorheight,
top: self.scroll.y
});
if (self.cursorh) {
var lx = (self.hasreversehr) ? self.scrollvaluemaxw-self.scroll.x : self.scroll.x;
(!self.rail.align && self.rail.visibility) ? self.cursorh.css({
width: self.cursorwidth,
left: lx + self.rail.width
}): self.cursorh.css({
width: self.cursorwidth,
left: lx
});
self.cursoractive = true;
}
 
if (self.zoom) self.zoom.stop().css({
opacity: self.opt.cursoropacitymax
});
};
 
this.hideCursor = function(tm) {
if (self.cursortimeout) return;
if (!self.rail) return;
if (!self.autohidedom) return;
if (self.hasmousefocus && self.opt.autohidemode == "leave") return;
self.cursortimeout = setTimeout(function() {
if (!self.rail.active || !self.showonmouseevent) {
self.autohidedom.stop().animate({
opacity: self.opt.cursoropacitymin
});
if (self.zoom) self.zoom.stop().animate({
opacity: self.opt.cursoropacitymin
});
self.cursoractive = false;
}
self.cursortimeout = 0;
}, tm || self.opt.hidecursordelay);
};
 
this.noticeCursor = function(tm, py, px) {
self.showCursor(py, px);
if (!self.rail.active) self.hideCursor(tm);
};
 
this.getContentSize =
(self.ispage) ?
function() {
return {
w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
};
} : (self.haswrapper) ?
function() {
return {
w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')),
h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom'))
};
} : function() {
return {
w: self.docscroll[0].scrollWidth,
h: self.docscroll[0].scrollHeight
};
};
 
this.onResize = function(e, page) {
if (!self || !self.win) return false;
 
if (!self.haswrapper && !self.ispage) {
if (self.win.css('display') == 'none') {
if (self.visibility) self.hideRail().hideRailHr();
return false;
} else {
if (!self.hidden && !self.visibility) self.showRail().showRailHr();
}
}
 
var premaxh = self.page.maxh;
var premaxw = self.page.maxw;
 
var preview = {
h: self.view.h,
w: self.view.w
};
 
self.view = {
w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
};
 
self.page = (page) ? page : self.getContentSize();
 
self.page.maxh = Math.max(0, self.page.h - self.view.h);
self.page.maxw = Math.max(0, self.page.w - self.view.w);
if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w) && (self.view.h == preview.h)) {
// test position
if (!self.ispage) {
var pos = self.win.offset();
if (self.lastposition) {
var lst = self.lastposition;
if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do
}
self.lastposition = pos;
} else {
return self; //nothing to do
}
}
 
if (self.page.maxh == 0) {
self.hideRail();
self.scrollvaluemax = 0;
self.scroll.y = 0;
self.scrollratio.y = 0;
self.cursorheight = 0;
self.setScrollTop(0);
if (self.rail) self.rail.scrollable = false;
} else {
self.page.maxh -= (self.opt.railpadding.top + self.opt.railpadding.bottom); //**
self.rail.scrollable = true;
}
 
if (self.page.maxw == 0) {
self.hideRailHr();
self.scrollvaluemaxw = 0;
self.scroll.x = 0;
self.scrollratio.x = 0;
self.cursorwidth = 0;
self.setScrollLeft(0);
if (self.railh) {
self.railh.scrollable = false;
}
} else {
self.page.maxw -= (self.opt.railpadding.left + self.opt.railpadding.right); //**
if (self.railh) self.railh.scrollable = (self.opt.horizrailenabled);
}
 
self.railslocked = (self.locked) || ((self.page.maxh == 0) && (self.page.maxw == 0));
if (self.railslocked) {
if (!self.ispage) self.updateScrollBar(self.view);
return false;
}
 
if (!self.hidden && !self.visibility) {
self.showRail().showRailHr();
}
else if (self.railh && (!self.hidden && !self.railh.visibility)) self.showRailHr();
 
if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;
 
self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight);
 
self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth);
 
self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder - (self.opt.railpadding.top + self.opt.railpadding.bottom); //**
 
if (self.railh) {
self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder - (self.opt.railpadding.left + self.opt.railpadding.right); //**
}
 
/*
if (self.checkrtlmode&&self.railh) {
self.checkrtlmode = false;
if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
}
*/
 
if (!self.ispage) self.updateScrollBar(self.view);
 
self.scrollratio = {
x: (self.page.maxw / self.scrollvaluemaxw),
y: (self.page.maxh / self.scrollvaluemax)
};
 
var sy = self.getScrollTop();
if (sy > self.page.maxh) {
self.doScrollTop(self.page.maxh);
} else {
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
if (self.cursoractive) self.noticeCursor();
}
 
if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y));
 
return self;
};
 
this.resize = self.onResize;
 
this.hlazyresize = 0;
this.lazyResize = function(tm) { // event debounce
/*
tm = (isNaN(tm)) ? 30 : tm;
self.debounced('resize', self.resize, tm);
*/
 
// if (!self.haswrapper&&self.opt.autohidemode!==false) self.hide();
if (!self.haswrapper) self.hide();
if (self.hlazyresize) clearTimeout(self.hlazyresize);
self.hlazyresize = setTimeout(function(){
self && self.show().resize();
},240);
return self;
};
 
// modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
function _modernWheelEvent(dom, name, fn, bubble) {
self._bind(dom, name, function(e) {
var e = (e) ? e : window.event;
var event = {
original: e,
target: e.target || e.srcElement,
type: "wheel",
deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
deltaX: 0,
deltaZ: 0,
preventDefault: function() {
e.preventDefault ? e.preventDefault() : e.returnValue = false;
return false;
},
stopImmediatePropagation: function() {
(e.stopImmediatePropagation) ? e.stopImmediatePropagation(): e.cancelBubble = true;
}
};
 
if (name == "mousewheel") {
e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY);
!event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta);
} else {
event.deltaY = e.detail;
}
 
return fn.call(dom, event);
}, bubble);
}
 
 
 
this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
self.events.push({
e: dom,
n: name,
f: fn,
q: true
});
$(dom).bind(name, fn);
};
this.mousewheel = function(dom, fn, bubble) { // bind mousewheel
var el = ("jquery" in dom) ? dom[0] : dom;
if ("onwheel" in document.createElement("div")) { // Modern browsers support "wheel"
self._bind(el, "wheel", fn, bubble || false);
} else {
var wname = (document.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox
_modernWheelEvent(el, wname, fn, bubble || false);
if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
}
};
if (cap.haseventlistener) { // W3C standard event model
this.bind = function(dom, name, fn, bubble) { // W3C
var el = ("jquery" in dom) ? dom[0] : dom;
self._bind(el, name, fn, bubble || false);
};
this._bind = function(el, name, fn, bubble) { // primitive bind
self.events.push({
e: el,
n: name,
f: fn,
b: bubble,
q: false
});
el.addEventListener(name, fn, bubble || false);
};
this.cancelEvent = function(e) {
if (!e) return false;
var e = (e.original) ? e.original : e;
if (e.cancelable) e.preventDefault();
e.stopPropagation();
if (e.preventManipulation) e.preventManipulation(); //IE10
return false;
};
this.stopPropagation = function(e) {
if (!e) return false;
var e = (e.original) ? e.original : e;
e.stopPropagation();
return false;
};
this._unbind = function(el, name, fn, bub) { // primitive unbind
el.removeEventListener(name, fn, bub);
};
} else { // old IE model
 
this.bind = function(dom, name, fn, bubble) { // legacy IE
var el = ("jquery" in dom) ? dom[0] : dom;
self._bind(el, name, function(e) {
e = e || window.event || false;
if (e && e.srcElement) {
e.target = e.srcElement;
}
if (!("pageY" in e)) {
e.pageX = e.clientX + document.documentElement.scrollLeft;
e.pageY = e.clientY + document.documentElement.scrollTop;
}
return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true;
});
};
this._bind = function(el, name, fn, bubble) { // primitive bind
self.events.push({
e: el,
n: name,
f: fn,
b: bubble,
q: false
});
if (el.attachEvent) {
el.attachEvent("on" + name, fn);
} else {
el["on" + name] = fn;
}
};
// Thanks to http://www.switchonthecode.com !!
this.cancelEvent = function(e) {
var e = window.event || false;
if (!e) return false;
e.cancelBubble = true;
e.cancel = true;
e.returnValue = false;
return false;
};
this.stopPropagation = function(e) {
var e = window.event || false;
if (!e) return false;
e.cancelBubble = true;
return false;
};
this._unbind = function(el, name, fn, bub) { // primitive unbind IE old
if (el.detachEvent) {
el.detachEvent('on' + name, fn);
} else {
el['on' + name] = false;
}
};
}
this.unbindAll = function() {
for (var a = 0; a < self.events.length; a++) {
var r = self.events[a];
(r.q) ? r.e.unbind(r.n, r.f): self._unbind(r.e, r.n, r.f, r.b);
}
};
 
this.showRail = function() {
if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) {
self.visibility = true;
self.rail.visibility = true;
self.rail.css('display', 'block');
}
return self;
};
 
this.showRailHr = function() {
if (!self.railh) return self;
if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) {
self.railh.visibility = true;
self.railh.css('display', 'block');
}
return self;
};
 
this.hideRail = function() {
self.visibility = false;
self.rail.visibility = false;
self.rail.css('display', 'none');
return self;
};
 
this.hideRailHr = function() {
if (!self.railh) return self;
self.railh.visibility = false;
self.railh.css('display', 'none');
return self;
};
 
this.show = function() {
self.hidden = false;
self.railslocked = false;
return self.showRail().showRailHr();
};
 
this.hide = function() {
self.hidden = true;
self.railslocked = true;
return self.hideRail().hideRailHr();
};
 
this.toggle = function() {
return (self.hidden) ? self.show() : self.hide();
};
 
this.remove = function() {
self.stop();
if (self.cursortimeout) clearTimeout(self.cursortimeout);
// if (self.debouncedelayed) clearTimeout(self.debouncedelayed);
for(var n in self.delaylist) if (self.delaylist[n]) clearAnimationFrame(self.delaylist[n].h);
self.doZoomOut();
self.unbindAll();
 
if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
 
if (self.observer !== false) self.observer.disconnect();
if (self.observerremover !== false) self.observerremover.disconnect();
if (self.observerbody !== false) self.observerbody.disconnect();
 
self.events = null;
 
if (self.cursor) {
self.cursor.remove();
}
if (self.cursorh) {
self.cursorh.remove();
}
if (self.rail) {
self.rail.remove();
}
if (self.railh) {
self.railh.remove();
}
if (self.zoom) {
self.zoom.remove();
}
for (var a = 0; a < self.saved.css.length; a++) {
var d = self.saved.css[a];
d[0].css(d[1], (d[2] === undefined) ? '' : d[2]);
}
self.saved = false;
self.me.data('__nicescroll', ''); //erase all traces
 
// memory leak fixed by GianlucaGuarini - thanks a lot!
// remove the current nicescroll from the $.nicescroll array & normalize array
var lst = $.nicescroll;
lst.each(function(i) {
if (!this) return;
if (this.id === self.id) {
delete lst[i];
for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
lst.length--;
if (lst.length) delete lst[lst.length];
}
});
 
for (var i in self) {
self[i] = null;
delete self[i];
}
 
self = null;
 
};
 
this.scrollstart = function(fn) {
this.onscrollstart = fn;
return self;
};
this.scrollend = function(fn) {
this.onscrollend = fn;
return self;
};
this.scrollcancel = function(fn) {
this.onscrollcancel = fn;
return self;
};
 
this.zoomin = function(fn) {
this.onzoomin = fn;
return self;
};
this.zoomout = function(fn) {
this.onzoomout = fn;
return self;
};
 
this.isScrollable = function(e) {
var dom = (e.target) ? e.target : e;
if (dom.nodeName == 'OPTION') return true;
while (dom && (dom.nodeType == 1) && (dom !== this.me[0]) && !(/^BODY|HTML/.test(dom.nodeName))) {
var dd = $(dom);
var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
dom = (dom.parentNode) ? dom.parentNode : false;
}
return false;
};
 
this.getViewport = function(me) {
var dom = (me && me.parentNode) ? me.parentNode : false;
while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
var dd = $(dom);
if (/fixed|absolute/.test(dd.css("position"))) return dd;
var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd;
if (dd.getNiceScroll().length > 0) return dd;
dom = (dom.parentNode) ? dom.parentNode : false;
}
return false; //(dom) ? $(dom) : false;
};
 
this.triggerScrollEnd = function() {
if (!self.onscrollend) return;
 
var px = self.getScrollLeft();
var py = self.getScrollTop();
 
var info = {
type: "scrollend",
current: {
x: px,
y: py
},
end: {
x: px,
y: py
}
};
self.onscrollend.call(self, info);
};
 
function execScrollWheel(e, hr, chkscroll) {
var px, py;
if (e.deltaMode == 0) { // PIXEL
px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)));
py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)));
} else if (e.deltaMode == 1) { // LINE
px = -Math.floor(e.deltaX * self.opt.mousescrollstep);
py = -Math.floor(e.deltaY * self.opt.mousescrollstep);
}
 
if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support
px = py;
py = 0;
if (chkscroll) {
var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
if (hrend) { // preserve vertical scrolling
py = px;
px = 0;
}
}
}
 
// invert horizontal direction for rtl mode
if (self.isrtlmode) px = -px;
 
if (px) {
if (self.scrollmom) {
self.scrollmom.stop();
}
self.lastdeltax += px;
self.debounced("mousewheelx", function() {
var dt = self.lastdeltax;
self.lastdeltax = 0;
if (!self.rail.drag) {
self.doScrollLeftBy(dt);
}
}, 15);
}
if (py) {
if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
if (py < 0) {
if (self.getScrollTop() >= self.page.maxh) return true;
} else {
if (self.getScrollTop() <= 0) return true;
}
}
if (self.scrollmom) {
self.scrollmom.stop();
}
self.lastdeltay += py;
// self.debounced("mousewheely", function() {
self.synched("mousewheely", function() {
var dt = self.lastdeltay;
self.lastdeltay = 0;
if (!self.rail.drag) {
self.doScrollBy(dt);
}
}, 15);
}
 
e.stopImmediatePropagation();
return e.preventDefault();
}
 
this.onmousewheel = function(e) {
if (self.wheelprevented) return;
if (self.railslocked) {
self.debounced("checkunlock", self.resize, 250);
return true;
}
if (self.rail.drag) return self.cancelEvent(e);
 
if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
 
if (self.opt.oneaxismousemode && e.deltaX == 0) {
if (!self.rail.scrollable) {
if (self.railh && self.railh.scrollable) {
return self.onmousewheelhr(e);
} else {
return true;
}
}
}
 
var nw = +(new Date());
var chk = false;
if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
self.nativescrollingarea = self.isScrollable(e);
chk = true;
}
self.checkarea = nw;
if (self.nativescrollingarea) return true; // this isn't my business
var ret = execScrollWheel(e, false, chk);
if (ret) self.checkarea = 0;
return ret;
};
 
this.onmousewheelhr = function(e) {
if (self.wheelprevented) return;
if (self.railslocked || !self.railh.scrollable) return true;
if (self.rail.drag) return self.cancelEvent(e);
 
var nw = +(new Date());
var chk = false;
if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
self.nativescrollingarea = self.isScrollable(e);
chk = true;
}
self.checkarea = nw;
if (self.nativescrollingarea) return true; // this isn't my business
if (self.railslocked) return self.cancelEvent(e);
 
return execScrollWheel(e, true, chk);
};
 
this.stop = function() {
self.cancelScroll();
if (self.scrollmon) self.scrollmon.stop();
self.cursorfreezed = false;
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
self.noticeCursor();
return self;
};
 
this.getTransitionSpeed = function(dif) {
var sp = Math.round(self.opt.scrollspeed * 10);
var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed));
return (ex > 20) ? ex : 0;
};
 
if (!self.opt.smoothscroll) {
this.doScrollLeft = function(x, spd) { //direct
var y = self.getScrollTop();
self.doScrollPos(x, y, spd);
};
this.doScrollTop = function(y, spd) { //direct
var x = self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
this.doScrollPos = function(x, y, spd) { //direct
var nx = (x > self.page.maxw) ? self.page.maxw : x;
if (nx < 0) nx = 0;
var ny = (y > self.page.maxh) ? self.page.maxh : y;
if (ny < 0) ny = 0;
self.synched('scroll', function() {
self.setScrollTop(ny);
self.setScrollLeft(nx);
});
};
this.cancelScroll = function() {}; // direct
} else if (self.ishwscroll && cap.hastransition && self.opt.usetransition && !!self.opt.smoothscroll) {
this.prepareTransition = function(dif, istime) {
var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif);
var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '';
if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
self.lasttransitionstyle = trans;
self.doc.css(cap.transitionstyle, trans);
}
return ex;
};
 
this.doScrollLeft = function(x, spd) { //trans
var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
self.doScrollPos(x, y, spd);
};
 
this.doScrollTop = function(y, spd) { //trans
var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
 
this.doScrollPos = function(x, y, spd) { //trans
 
var py = self.getScrollTop();
var px = self.getScrollLeft();
 
if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
 
if (self.opt.bouncescroll == false) {
if (y < 0) y = 0;
else if (y > self.page.maxh) y = self.page.maxh;
if (x < 0) x = 0;
else if (x > self.page.maxw) x = self.page.maxw;
}
 
if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
 
self.newscrolly = y;
self.newscrollx = x;
 
self.newscrollspeed = spd || false;
 
if (self.timer) return false;
 
self.timer = setTimeout(function() {
 
var top = self.getScrollTop();
var lft = self.getScrollLeft();
 
var dst = {};
dst.x = x - lft;
dst.y = y - top;
dst.px = lft;
dst.py = top;
 
var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)));
var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed;
 
self.prepareTransition(ms, true);
 
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
 
if (ms > 0) {
 
if (!self.scrollrunning && self.onscrollstart) {
var info = {
"type": "scrollstart",
"current": {
"x": lft,
"y": top
},
"request": {
"x": x,
"y": y
},
"end": {
"x": self.newscrollx,
"y": self.newscrolly
},
"speed": ms
};
self.onscrollstart.call(self, info);
}
 
if (cap.transitionend) {
if (!self.scrollendtrapped) {
self.scrollendtrapped = true;
self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
}
} else {
if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
}
 
var py = top;
var px = lft;
self.timerscroll = {
bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
};
if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() {
self.showCursor(self.getScrollTop(), self.getScrollLeft());
}, 60);
 
}
 
self.synched("doScroll-set", function() {
self.timer = 0;
if (self.scrollendtrapped) self.scrollrunning = true;
self.setScrollTop(self.newscrolly);
self.setScrollLeft(self.newscrollx);
if (!self.scrollendtrapped) self.onScrollTransitionEnd();
});
 
 
}, 50);
 
};
 
this.cancelScroll = function() {
if (!self.scrollendtrapped) return true;
var py = self.getScrollTop();
var px = self.getScrollLeft();
self.scrollrunning = false;
if (!cap.transitionend) clearTimeout(cap.transitionend);
self.scrollendtrapped = false;
self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
self.prepareTransition(0);
self.setScrollTop(py); // fire event onscroll
if (self.railh) self.setScrollLeft(px);
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
self.timerscroll = false;
 
self.cursorfreezed = false;
 
self.showCursor(py, px);
return self;
};
this.onScrollTransitionEnd = function() {
if (self.scrollendtrapped) self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
self.scrollendtrapped = false;
self.prepareTransition(0);
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
self.timerscroll = false;
var py = self.getScrollTop();
var px = self.getScrollLeft();
self.setScrollTop(py); // fire event onscroll
if (self.railh) self.setScrollLeft(px); // fire event onscroll left
 
self.noticeCursor(false, py, px);
 
self.cursorfreezed = false;
 
if (py < 0) py = 0;
else if (py > self.page.maxh) py = self.page.maxh;
if (px < 0) px = 0;
else if (px > self.page.maxw) px = self.page.maxw;
if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed);
 
if (self.onscrollend && self.scrollrunning) {
self.triggerScrollEnd();
}
self.scrollrunning = false;
 
};
 
} else {
 
this.doScrollLeft = function(x, spd) { //no-trans
var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
self.doScrollPos(x, y, spd);
};
 
this.doScrollTop = function(y, spd) { //no-trans
var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
 
this.doScrollPos = function(x, y, spd) { //no-trans
var y = (y === undefined || y === false) ? self.getScrollTop(true) : y;
 
if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true;
 
if (self.timer) clearAnimationFrame(self.timer);
self.timer = 0;
 
var py = self.getScrollTop();
var px = self.getScrollLeft();
 
if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
 
self.newscrolly = y;
self.newscrollx = x;
 
if (!self.bouncescroll || !self.rail.visibility) {
if (self.newscrolly < 0) {
self.newscrolly = 0;
} else if (self.newscrolly > self.page.maxh) {
self.newscrolly = self.page.maxh;
}
}
if (!self.bouncescroll || !self.railh.visibility) {
if (self.newscrollx < 0) {
self.newscrollx = 0;
} else if (self.newscrollx > self.page.maxw) {
self.newscrollx = self.page.maxw;
}
}
 
self.dst = {};
self.dst.x = x - px;
self.dst.y = y - py;
self.dst.px = px;
self.dst.py = py;
 
var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)));
 
self.dst.ax = self.dst.x / dst;
self.dst.ay = self.dst.y / dst;
 
var pa = 0;
var pe = dst;
 
if (self.dst.x == 0) {
pa = py;
pe = y;
self.dst.ay = 1;
self.dst.py = 0;
} else if (self.dst.y == 0) {
pa = px;
pe = x;
self.dst.ax = 1;
self.dst.px = 0;
}
 
var ms = self.getTransitionSpeed(dst);
if (spd && spd <= 1) ms *= spd;
if (ms > 0) {
self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1);
} else {
self.bzscroll = false;
}
 
if (self.timer) return;
 
if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize();
 
var sync = 1;
 
function scrolling() {
if (self.cancelAnimationFrame) return true;
 
self.scrollrunning = true;
 
sync = 1 - sync;
if (sync) return (self.timer = setAnimationFrame(scrolling) || 1);
 
var done = 0;
var sx, sy;
 
var sc = sy = self.getScrollTop();
if (self.dst.ay) {
sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly;
var dr = sc - sy;
if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly;
self.setScrollTop(sc);
if (sc == self.newscrolly) done = 1;
} else {
done = 1;
}
 
var scx = sx = self.getScrollLeft();
if (self.dst.ax) {
scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx;
var dr = scx - sx;
if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx;
self.setScrollLeft(scx);
if (scx == self.newscrollx) done += 1;
} else {
done += 1;
}
 
if (done == 2) {
self.timer = 0;
self.cursorfreezed = false;
self.bzscroll = false;
self.scrollrunning = false;
if (sc < 0) sc = 0;
else if (sc > self.page.maxh) sc = Math.max(0,self.page.maxh);
if (scx < 0) scx = 0;
else if (scx > self.page.maxw) scx = self.page.maxw;
if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc);
else {
if (self.onscrollend) {
self.triggerScrollEnd();
}
}
} else {
self.timer = setAnimationFrame(scrolling) || 1;
}
}
self.cancelAnimationFrame = false;
self.timer = 1;
 
if (self.onscrollstart && !self.scrollrunning) {
var info = {
"type": "scrollstart",
"current": {
"x": px,
"y": py
},
"request": {
"x": x,
"y": y
},
"end": {
"x": self.newscrollx,
"y": self.newscrolly
},
"speed": ms
};
self.onscrollstart.call(self, info);
}
 
scrolling();
 
if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize();
 
self.noticeCursor();
};
 
this.cancelScroll = function() {
if (self.timer) clearAnimationFrame(self.timer);
self.timer = 0;
self.bzscroll = false;
self.scrollrunning = false;
return self;
};
 
}
 
this.doScrollBy = function(stp, relative) {
var ny = 0;
if (relative) {
ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y);
} else {
var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
ny = sy - stp;
}
if (self.bouncescroll) {
var haf = Math.round(self.view.h / 2);
if (ny < -haf) ny = -haf;
else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf);
}
self.cursorfreezed = false;
 
var py = self.getScrollTop(true);
if (ny < 0 && py <= 0) return self.noticeCursor();
else if (ny > self.page.maxh && py >= self.page.maxh) {
self.checkContentSize();
return self.noticeCursor();
}
 
self.doScrollTop(ny);
};
 
this.doScrollLeftBy = function(stp, relative) {
var nx = 0;
if (relative) {
nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x);
} else {
var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
nx = sx - stp;
}
if (self.bouncescroll) {
var haf = Math.round(self.view.w / 2);
if (nx < -haf) nx = -haf;
else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf);
}
self.cursorfreezed = false;
 
var px = self.getScrollLeft(true);
if (nx < 0 && px <= 0) return self.noticeCursor();
else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor();
 
self.doScrollLeft(nx);
};
 
this.doScrollTo = function(pos, relative) {
var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
if (ny < 0) ny = 0;
else if (ny > self.page.maxh) ny = self.page.maxh;
self.cursorfreezed = false;
self.doScrollTop(pos);
};
 
this.checkContentSize = function() {
var pg = self.getContentSize();
if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
};
 
self.onscroll = function(e) {
if (self.rail.drag) return;
if (!self.cursorfreezed) {
self.synched('scroll', function() {
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
self.noticeCursor();
});
}
self.triggerScrollEnd();
};
self.bind(self.docscroll, "scroll", self.onscroll);
 
this.doZoomIn = function(e) {
if (self.zoomactive) return;
self.zoomactive = true;
 
self.zoomrestore = {
style: {}
};
var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
var win = self.win[0].style;
for (var a in lst) {
var pp = lst[a];
self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : '';
}
 
self.zoomrestore.style.width = self.win.css('width');
self.zoomrestore.style.height = self.win.css('height');
 
self.zoomrestore.padding = {
w: self.win.outerWidth() - self.win.width(),
h: self.win.outerHeight() - self.win.height()
};
 
if (cap.isios4) {
self.zoomrestore.scrollTop = $(window).scrollTop();
$(window).scrollTop(0);
}
 
self.win.css({
position: (cap.isios4) ? "absolute" : "fixed",
top: 0,
left: 0,
zIndex: globalmaxzindex + 100,
margin: 0
});
var bkg = self.win.css("backgroundColor");
if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
self.rail.css({
zIndex: globalmaxzindex + 101
});
self.zoom.css({
zIndex: globalmaxzindex + 102
});
self.zoom.css('backgroundPosition', '0px -18px');
self.resizeZoom();
 
if (self.onzoomin) self.onzoomin.call(self);
 
return self.cancelEvent(e);
};
 
this.doZoomOut = function(e) {
if (!self.zoomactive) return;
self.zoomactive = false;
 
self.win.css("margin", "");
self.win.css(self.zoomrestore.style);
 
if (cap.isios4) {
$(window).scrollTop(self.zoomrestore.scrollTop);
}
 
self.rail.css({
"z-index": self.zindex
});
self.zoom.css({
"z-index": self.zindex
});
self.zoomrestore = false;
self.zoom.css('backgroundPosition', '0px 0px');
self.onResize();
 
if (self.onzoomout) self.onzoomout.call(self);
 
return self.cancelEvent(e);
};
 
this.doZoom = function(e) {
return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
};
 
this.resizeZoom = function() {
if (!self.zoomactive) return;
 
var py = self.getScrollTop(); //preserve scrolling position
self.win.css({
width: $(window).width() - self.zoomrestore.padding.w + "px",
height: $(window).height() - self.zoomrestore.padding.h + "px"
});
self.onResize();
 
self.setScrollTop(Math.min(self.page.maxh, py));
};
 
this.init();
 
$.nicescroll.push(this);
 
};
 
// Inspired by the work of Kin Blas
// http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js
 
 
var ScrollMomentumClass2D = function(nc) {
var self = this;
this.nc = nc;
 
this.lastx = 0;
this.lasty = 0;
this.speedx = 0;
this.speedy = 0;
this.lasttime = 0;
this.steptime = 0;
this.snapx = false;
this.snapy = false;
this.demulx = 0;
this.demuly = 0;
 
this.lastscrollx = -1;
this.lastscrolly = -1;
 
this.chkx = 0;
this.chky = 0;
 
this.timer = 0;
 
this.time = function() {
return +new Date(); //beautifull hack
};
 
this.reset = function(px, py) {
self.stop();
var now = self.time();
self.steptime = 0;
self.lasttime = now;
self.speedx = 0;
self.speedy = 0;
self.lastx = px;
self.lasty = py;
self.lastscrollx = -1;
self.lastscrolly = -1;
};
 
this.update = function(px, py) {
var now = self.time();
self.steptime = now - self.lasttime;
self.lasttime = now;
var dy = py - self.lasty;
var dx = px - self.lastx;
var sy = self.nc.getScrollTop();
var sx = self.nc.getScrollLeft();
var newy = sy + dy;
var newx = sx + dx;
self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
self.speedx = dx;
self.speedy = dy;
self.lastx = px;
self.lasty = py;
};
 
this.stop = function() {
self.nc.unsynched("domomentum2d");
if (self.timer) clearTimeout(self.timer);
self.timer = 0;
self.lastscrollx = -1;
self.lastscrolly = -1;
};
 
this.doSnapy = function(nx, ny) {
var snap = false;
 
if (ny < 0) {
ny = 0;
snap = true;
} else if (ny > self.nc.page.maxh) {
ny = self.nc.page.maxh;
snap = true;
}
 
if (nx < 0) {
nx = 0;
snap = true;
} else if (nx > self.nc.page.maxw) {
nx = self.nc.page.maxw;
snap = true;
}
 
(snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed): self.nc.triggerScrollEnd();
};
 
this.doMomentum = function(gp) {
var t = self.time();
var l = (gp) ? t + gp : self.lasttime;
 
var sl = self.nc.getScrollLeft();
var st = self.nc.getScrollTop();
 
var pageh = self.nc.page.maxh;
var pagew = self.nc.page.maxw;
 
self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;
 
var chk = l && (t - l) <= 60;
 
if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;
 
var sy = (self.speedy && chk) ? self.speedy : false;
var sx = (self.speedx && chk) ? self.speedx : false;
 
if (sy || sx) {
var tm = Math.max(16, self.steptime); //timeout granularity
 
if (tm > 50) { // do smooth
var xm = tm / 50;
self.speedx *= xm;
self.speedy *= xm;
tm = 50;
}
 
self.demulxy = 0;
 
self.lastscrollx = self.nc.getScrollLeft();
self.chkx = self.lastscrollx;
self.lastscrolly = self.nc.getScrollTop();
self.chky = self.lastscrolly;
 
var nx = self.lastscrollx;
var ny = self.lastscrolly;
 
var onscroll = function() {
var df = ((self.time() - t) > 600) ? 0.04 : 0.02;
 
if (self.speedx) {
nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
self.lastscrollx = nx;
if ((nx < 0) || (nx > pagew)) df = 0.10;
}
 
if (self.speedy) {
ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
self.lastscrolly = ny;
if ((ny < 0) || (ny > pageh)) df = 0.10;
}
 
self.demulxy = Math.min(1, self.demulxy + df);
 
self.nc.synched("domomentum2d", function() {
 
if (self.speedx) {
var scx = self.nc.getScrollLeft();
// if (scx != self.chkx) self.stop();
self.chkx = nx;
self.nc.setScrollLeft(nx);
}
 
if (self.speedy) {
var scy = self.nc.getScrollTop();
// if (scy != self.chky) self.stop();
self.chky = ny;
self.nc.setScrollTop(ny);
}
 
if (!self.timer) {
self.nc.hideCursor();
self.doSnapy(nx, ny);
}
 
});
 
if (self.demulxy < 1) {
self.timer = setTimeout(onscroll, tm);
} else {
self.stop();
self.nc.hideCursor();
self.doSnapy(nx, ny);
}
};
 
onscroll();
 
} else {
self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
}
 
};
 
};
 
 
// override jQuery scrollTop
 
var _scrollTop = jQuery.fn.scrollTop; // preserve original function
 
jQuery.cssHooks.pageYOffset = {
get: function(elem, computed, extra) {
var nice = $.data(elem, '__nicescroll') || false;
return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
},
set: function(elem, value) {
var nice = $.data(elem, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call(elem, value);
return this;
}
};
 
/*
$.fx.step["scrollTop"] = function(fx){
$.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
};
*/
 
jQuery.fn.scrollTop = function(value) {
if (value === undefined) {
var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
} else {
return this.each(function() {
var nice = $.data(this, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call($(this), value);
});
}
};
 
// override jQuery scrollLeft
 
var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
 
$.cssHooks.pageXOffset = {
get: function(elem, computed, extra) {
var nice = $.data(elem, '__nicescroll') || false;
return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
},
set: function(elem, value) {
var nice = $.data(elem, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call(elem, value);
return this;
}
};
 
/*
$.fx.step["scrollLeft"] = function(fx){
$.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
};
*/
 
jQuery.fn.scrollLeft = function(value) {
if (value === undefined) {
var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
} else {
return this.each(function() {
var nice = $.data(this, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call($(this), value);
});
}
};
 
var NiceScrollArray = function(doms) {
var self = this;
this.length = 0;
this.name = "nicescrollarray";
 
this.each = function(fn) {
$.each(self, fn);
return self;
};
 
this.push = function(nice) {
self[self.length] = nice;
self.length++;
};
 
this.eq = function(idx) {
return self[idx];
};
 
if (doms) {
for (var a = 0; a < doms.length; a++) {
var nice = $.data(doms[a], '__nicescroll') || false;
if (nice) {
this[this.length] = nice;
this.length++;
}
}
}
 
return this;
};
 
function mplex(el, lst, fn) {
for (var a = 0; a < lst.length; a++) fn(el, lst[a]);
}
mplex(
NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
function(e, n) {
e[n] = function() {
var args = arguments;
return this.each(function() {
this[n].apply(this, args);
});
};
}
);
 
jQuery.fn.getNiceScroll = function(index) {
if (index === undefined) {
return new NiceScrollArray(this);
} else {
return this[index] && $.data(this[index], '__nicescroll') || false;
}
};
 
jQuery.expr[':'].nicescroll = function(a) {
return $.data(a, '__nicescroll') !== undefined;
};
 
$.fn.niceScroll = function(wrapper, opt) {
if (opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) {
opt = wrapper;
wrapper = false;
}
opt = $.extend({},opt); // cloning
var ret = new NiceScrollArray();
if (opt === undefined) opt = {};
 
if (wrapper || false) {
opt.doc = $(wrapper);
opt.win = $(this);
}
var docundef = !("doc" in opt);
if (!docundef && !("win" in opt)) opt.win = $(this);
 
this.each(function() {
var nice = $(this).data('__nicescroll') || false;
if (!nice) {
opt.doc = (docundef) ? $(this) : opt.doc;
nice = new NiceScrollClass(opt, $(this));
$(this).data('__nicescroll', nice);
}
ret.push(nice);
});
return (ret.length == 1) ? ret[0] : ret;
};
 
window.NiceScroll = {
getjQuery: function() {
return jQuery;
}
};
 
if (!$.nicescroll) {
$.nicescroll = new NiceScrollArray();
$.nicescroll.options = _globaloptions;
}
 
}));
 
/Web Favorities/fav_common.php
@@ -1,5 +1,6 @@
<?php
$NoNavi=$oldNetscape=$noXML=false;$mozver=$iever=$SidebarSuffix1=$admAppend=$aAppend='';
$noXML=true;
 
$ua=strtolower($_SERVER["HTTP_USER_AGENT"]);
if(strpos($ua,'mozilla/')!==false) {
@@ -26,6 +27,7 @@
if ((strpos(strtoupper($_SERVER["HTTP_USER_AGENT"]),"MSIE") ? strpos(strtoupper($_SERVER["HTTP_USER_AGENT"]),"MSIE")+1 : 0)>0)
$noXML=true;
 
$jscroll = (isset($_GET["jscroll"]) && $_GET["jscroll"]=="Y") ? true : false;
if (isset($_GET["noxml"]) && $_GET["noxml"]=="Y") $noXML=true;
if (isset($_GET["noxml"]) && $_GET["noxml"]=="N") $noXML=false;
if (isset($_GET["sidebar"]) && $_GET["sidebar"]=="Y") {
@@ -37,7 +39,8 @@
}
if ($InSidebar) {
$aAppend="target=\"_content\"";
$admAppend="target=\"_search\"";
//$admAppend="target=\"_search\"";
$admAppend="";
$SidebarSuffix1="?sidebar=Y";
$SidebarSuffix2="&sidebar=Y";
$TextboxWidth=30;
/Web Favorities/fav_add.php
@@ -9,15 +9,17 @@
$Command1__varcatid=val($_POST,"catid",'0');
$MM_RedirectUrl=$homeURL.$SidebarSuffix1;
 
$conn=sqlite_popen($sqlite_file);
$qry="SELECT * FROM Fav";
$rs=sqlite_query($conn,$qry);
$rcnt=sqlite_num_rows($rs);
$row = sqlite_fetch_array($rs);
$db = new PDO('sqlite:./'.$sqlite_file, '', '', array(PDO::ATTR_PERSISTENT => true));
//$row = sqlite_fetch_array($rs);
 
if (isset($_SESSION['isLogined']) && isset($_POST["MM_insert"]) && $_POST["MM_insert"]=="form1"){
$Command1_CommandText="INSERT INTO Fav (cat,name,addr,catid,protected,ord) VALUES (".sqlite_escape_string($Command1__varcat).",'".sqlite_escape_string($Command1__varname)."','".sqlite_escape_string($Command1__varaddr)."',".sqlite_escape_string($Command1__varcatid).",".sqlite_escape_string($Command1__varprot).",".sqlite_escape_string($rcnt).")";
sqlite_exec($Command1_CommandText,$conn);
$qry="SELECT COUNT(id) FROM Fav";
$rs=$db->query($qry);
$rcnt=$db->fetchColumn($rs);
$sth = $db->prepare('INSERT INTO Fav (cat,name,addr,catid,protected,ord) VALUES (?, ?, ?, ?, ?, ?)');
$sth->execute(array($Command1__varcat, $Command1__varname, $Command1__varaddr, $Command1__varcatid, $Command1__varprot, $rcnt));
// $Command1_CommandText="INSERT INTO Fav (cat,name,addr,catid,protected,ord) VALUES (".sqlite_escape_string($Command1__varcat).",'".sqlite_escape_string($Command1__varname)."','".sqlite_escape_string($Command1__varaddr)."',".sqlite_escape_string($Command1__varcatid).",".sqlite_escape_string($Command1__varprot).",".sqlite_escape_string($rcnt).")";
// sqlite_exec($Command1_CommandText,$conn);
 
header("Location: ".$MM_RedirectUrl);
exit();
@@ -82,9 +84,9 @@
<select name="catid" id="catid" onChange="detSel();">';
$qry="SELECT id,name FROM Fav WHERE cat = 1 ORDER BY ord,id";
$rs=sqlite_query($conn,$qry);
$rs=$db->query($qry);
echo ' <option value="0" '.(isset($_GET["catid"])&&$_GET["catid"]==''?"selected":'').'>'.$MyFav_Cat_NoCategory.'</option>';
while($row2 = sqlite_fetch_array($rs)) {
while($row2 = $rs->fetch(PDO::FETCH_ASSOC)) {
echo ' <option value="'.($row2["id"]).'" '.(isset($_GET["catid"])&&$row2["id"]==$_GET["catid"]?"selected":'').'>'.($row2["name"]).'</option>';
}
echo ' </select>
Cannot display: file marked as a binary type.
svn:mime-type = application/octet-stream

Property changes:

Name: svn:mime-type
+ application/octet-stream

/Web Favorities/myfav.sdb3
New file
/Web Favorities/jquery.min.js
@@ -0,0 +1,5 @@
/*! jQuery v1.11.3 | (c) 2005, 2015 jQuery Foundation, Inc. | jquery.org/license */
!function(a,b){"object"==typeof module&&"object"==typeof module.exports?module.exports=a.document?b(a,!0):function(a){if(!a.document)throw new Error("jQuery requires a window with a document");return b(a)}:b(a)}("undefined"!=typeof window?window:this,function(a,b){var c=[],d=c.slice,e=c.concat,f=c.push,g=c.indexOf,h={},i=h.toString,j=h.hasOwnProperty,k={},l="1.11.3",m=function(a,b){return new m.fn.init(a,b)},n=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,o=/^-ms-/,p=/-([\da-z])/gi,q=function(a,b){return b.toUpperCase()};m.fn=m.prototype={jquery:l,constructor:m,selector:"",length:0,toArray:function(){return d.call(this)},get:function(a){return null!=a?0>a?this[a+this.length]:this[a]:d.call(this)},pushStack:function(a){var b=m.merge(this.constructor(),a);return b.prevObject=this,b.context=this.context,b},each:function(a,b){return m.each(this,a,b)},map:function(a){return this.pushStack(m.map(this,function(b,c){return a.call(b,c,b)}))},slice:function(){return this.pushStack(d.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(a){var b=this.length,c=+a+(0>a?b:0);return this.pushStack(c>=0&&b>c?[this[c]]:[])},end:function(){return this.prevObject||this.constructor(null)},push:f,sort:c.sort,splice:c.splice},m.extend=m.fn.extend=function(){var a,b,c,d,e,f,g=arguments[0]||{},h=1,i=arguments.length,j=!1;for("boolean"==typeof g&&(j=g,g=arguments[h]||{},h++),"object"==typeof g||m.isFunction(g)||(g={}),h===i&&(g=this,h--);i>h;h++)if(null!=(e=arguments[h]))for(d in e)a=g[d],c=e[d],g!==c&&(j&&c&&(m.isPlainObject(c)||(b=m.isArray(c)))?(b?(b=!1,f=a&&m.isArray(a)?a:[]):f=a&&m.isPlainObject(a)?a:{},g[d]=m.extend(j,f,c)):void 0!==c&&(g[d]=c));return g},m.extend({expando:"jQuery"+(l+Math.random()).replace(/\D/g,""),isReady:!0,error:function(a){throw new Error(a)},noop:function(){},isFunction:function(a){return"function"===m.type(a)},isArray:Array.isArray||function(a){return"array"===m.type(a)},isWindow:function(a){return null!=a&&a==a.window},isNumeric:function(a){return!m.isArray(a)&&a-parseFloat(a)+1>=0},isEmptyObject:function(a){var b;for(b in a)return!1;return!0},isPlainObject:function(a){var b;if(!a||"object"!==m.type(a)||a.nodeType||m.isWindow(a))return!1;try{if(a.constructor&&!j.call(a,"constructor")&&!j.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}if(k.ownLast)for(b in a)return j.call(a,b);for(b in a);return void 0===b||j.call(a,b)},type:function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?h[i.call(a)]||"object":typeof a},globalEval:function(b){b&&m.trim(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(o,"ms-").replace(p,q)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()},each:function(a,b,c){var d,e=0,f=a.length,g=r(a);if(c){if(g){for(;f>e;e++)if(d=b.apply(a[e],c),d===!1)break}else for(e in a)if(d=b.apply(a[e],c),d===!1)break}else if(g){for(;f>e;e++)if(d=b.call(a[e],e,a[e]),d===!1)break}else for(e in a)if(d=b.call(a[e],e,a[e]),d===!1)break;return a},trim:function(a){return null==a?"":(a+"").replace(n,"")},makeArray:function(a,b){var c=b||[];return null!=a&&(r(Object(a))?m.merge(c,"string"==typeof a?[a]:a):f.call(c,a)),c},inArray:function(a,b,c){var d;if(b){if(g)return g.call(b,a,c);for(d=b.length,c=c?0>c?Math.max(0,d+c):c:0;d>c;c++)if(c in b&&b[c]===a)return c}return-1},merge:function(a,b){var c=+b.length,d=0,e=a.length;while(c>d)a[e++]=b[d++];if(c!==c)while(void 0!==b[d])a[e++]=b[d++];return a.length=e,a},grep:function(a,b,c){for(var d,e=[],f=0,g=a.length,h=!c;g>f;f++)d=!b(a[f],f),d!==h&&e.push(a[f]);return e},map:function(a,b,c){var d,f=0,g=a.length,h=r(a),i=[];if(h)for(;g>f;f++)d=b(a[f],f,c),null!=d&&i.push(d);else for(f in a)d=b(a[f],f,c),null!=d&&i.push(d);return e.apply([],i)},guid:1,proxy:function(a,b){var c,e,f;return"string"==typeof b&&(f=a[b],b=a,a=f),m.isFunction(a)?(c=d.call(arguments,2),e=function(){return a.apply(b||this,c.concat(d.call(arguments)))},e.guid=a.guid=a.guid||m.guid++,e):void 0},now:function(){return+new Date},support:k}),m.each("Boolean Number String Function Array Date RegExp Object Error".split(" "),function(a,b){h["[object "+b+"]"]=b.toLowerCase()});function r(a){var b="length"in a&&a.length,c=m.type(a);return"function"===c||m.isWindow(a)?!1:1===a.nodeType&&b?!0:"array"===c||0===b||"number"==typeof b&&b>0&&b-1 in a}var s=function(a){var b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u="sizzle"+1*new Date,v=a.document,w=0,x=0,y=ha(),z=ha(),A=ha(),B=function(a,b){return a===b&&(l=!0),0},C=1<<31,D={}.hasOwnProperty,E=[],F=E.pop,G=E.push,H=E.push,I=E.slice,J=function(a,b){for(var c=0,d=a.length;d>c;c++)if(a[c]===b)return c;return-1},K="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",L="[\\x20\\t\\r\\n\\f]",M="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",N=M.replace("w","w#"),O="\\["+L+"*("+M+")(?:"+L+"*([*^$|!~]?=)"+L+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+N+"))|)"+L+"*\\]",P=":("+M+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+O+")*)|.*)\\)|)",Q=new RegExp(L+"+","g"),R=new RegExp("^"+L+"+|((?:^|[^\\\\])(?:\\\\.)*)"+L+"+$","g"),S=new RegExp("^"+L+"*,"+L+"*"),T=new RegExp("^"+L+"*([>+~]|"+L+")"+L+"*"),U=new RegExp("="+L+"*([^\\]'\"]*?)"+L+"*\\]","g"),V=new RegExp(P),W=new RegExp("^"+N+"$"),X={ID:new RegExp("^#("+M+")"),CLASS:new RegExp("^\\.("+M+")"),TAG:new RegExp("^("+M.replace("w","w*")+")"),ATTR:new RegExp("^"+O),PSEUDO:new RegExp("^"+P),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+L+"*(even|odd|(([+-]|)(\\d*)n|)"+L+"*(?:([+-]|)"+L+"*(\\d+)|))"+L+"*\\)|)","i"),bool:new RegExp("^(?:"+K+")$","i"),needsContext:new RegExp("^"+L+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+L+"*((?:-\\d)?\\d*)"+L+"*\\)|)(?=[^-]|$)","i")},Y=/^(?:input|select|textarea|button)$/i,Z=/^h\d$/i,$=/^[^{]+\{\s*\[native \w/,_=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,aa=/[+~]/,ba=/'|\\/g,ca=new RegExp("\\\\([\\da-f]{1,6}"+L+"?|("+L+")|.)","ig"),da=function(a,b,c){var d="0x"+b-65536;return d!==d||c?b:0>d?String.fromCharCode(d+65536):String.fromCharCode(d>>10|55296,1023&d|56320)},ea=function(){m()};try{H.apply(E=I.call(v.childNodes),v.childNodes),E[v.childNodes.length].nodeType}catch(fa){H={apply:E.length?function(a,b){G.apply(a,I.call(b))}:function(a,b){var c=a.length,d=0;while(a[c++]=b[d++]);a.length=c-1}}}function ga(a,b,d,e){var f,h,j,k,l,o,r,s,w,x;if((b?b.ownerDocument||b:v)!==n&&m(b),b=b||n,d=d||[],k=b.nodeType,"string"!=typeof a||!a||1!==k&&9!==k&&11!==k)return d;if(!e&&p){if(11!==k&&(f=_.exec(a)))if(j=f[1]){if(9===k){if(h=b.getElementById(j),!h||!h.parentNode)return d;if(h.id===j)return d.push(h),d}else if(b.ownerDocument&&(h=b.ownerDocument.getElementById(j))&&t(b,h)&&h.id===j)return d.push(h),d}else{if(f[2])return H.apply(d,b.getElementsByTagName(a)),d;if((j=f[3])&&c.getElementsByClassName)return H.apply(d,b.getElementsByClassName(j)),d}if(c.qsa&&(!q||!q.test(a))){if(s=r=u,w=b,x=1!==k&&a,1===k&&"object"!==b.nodeName.toLowerCase()){o=g(a),(r=b.getAttribute("id"))?s=r.replace(ba,"\\$&"):b.setAttribute("id",s),s="[id='"+s+"'] ",l=o.length;while(l--)o[l]=s+ra(o[l]);w=aa.test(a)&&pa(b.parentNode)||b,x=o.join(",")}if(x)try{return H.apply(d,w.querySelectorAll(x)),d}catch(y){}finally{r||b.removeAttribute("id")}}}return i(a.replace(R,"$1"),b,d,e)}function ha(){var a=[];function b(c,e){return a.push(c+" ")>d.cacheLength&&delete b[a.shift()],b[c+" "]=e}return b}function ia(a){return a[u]=!0,a}function ja(a){var b=n.createElement("div");try{return!!a(b)}catch(c){return!1}finally{b.parentNode&&b.parentNode.removeChild(b),b=null}}function ka(a,b){var c=a.split("|"),e=a.length;while(e--)d.attrHandle[c[e]]=b}function la(a,b){var c=b&&a,d=c&&1===a.nodeType&&1===b.nodeType&&(~b.sourceIndex||C)-(~a.sourceIndex||C);if(d)return d;if(c)while(c=c.nextSibling)if(c===b)return-1;return a?1:-1}function ma(a){return function(b){var c=b.nodeName.toLowerCase();return"input"===c&&b.type===a}}function na(a){return function(b){var c=b.nodeName.toLowerCase();return("input"===c||"button"===c)&&b.type===a}}function oa(a){return ia(function(b){return b=+b,ia(function(c,d){var e,f=a([],c.length,b),g=f.length;while(g--)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function pa(a){return a&&"undefined"!=typeof a.getElementsByTagName&&a}c=ga.support={},f=ga.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return b?"HTML"!==b.nodeName:!1},m=ga.setDocument=function(a){var b,e,g=a?a.ownerDocument||a:v;return g!==n&&9===g.nodeType&&g.documentElement?(n=g,o=g.documentElement,e=g.defaultView,e&&e!==e.top&&(e.addEventListener?e.addEventListener("unload",ea,!1):e.attachEvent&&e.attachEvent("onunload",ea)),p=!f(g),c.attributes=ja(function(a){return a.className="i",!a.getAttribute("className")}),c.getElementsByTagName=ja(function(a){return a.appendChild(g.createComment("")),!a.getElementsByTagName("*").length}),c.getElementsByClassName=$.test(g.getElementsByClassName),c.getById=ja(function(a){return o.appendChild(a).id=u,!g.getElementsByName||!g.getElementsByName(u).length}),c.getById?(d.find.ID=function(a,b){if("undefined"!=typeof b.getElementById&&p){var c=b.getElementById(a);return c&&c.parentNode?[c]:[]}},d.filter.ID=function(a){var b=a.replace(ca,da);return function(a){return a.getAttribute("id")===b}}):(delete d.find.ID,d.filter.ID=function(a){var b=a.replace(ca,da);return function(a){var c="undefined"!=typeof a.getAttributeNode&&a.getAttributeNode("id");return c&&c.value===b}}),d.find.TAG=c.getElementsByTagName?function(a,b){return"undefined"!=typeof b.getElementsByTagName?b.getElementsByTagName(a):c.qsa?b.querySelectorAll(a):void 0}:function(a,b){var c,d=[],e=0,f=b.getElementsByTagName(a);if("*"===a){while(c=f[e++])1===c.nodeType&&d.push(c);return d}return f},d.find.CLASS=c.getElementsByClassName&&function(a,b){return p?b.getElementsByClassName(a):void 0},r=[],q=[],(c.qsa=$.test(g.querySelectorAll))&&(ja(function(a){o.appendChild(a).innerHTML="<a id='"+u+"'></a><select id='"+u+"-\f]' msallowcapture=''><option selected=''></option></select>",a.querySelectorAll("[msallowcapture^='']").length&&q.push("[*^$]="+L+"*(?:''|\"\")"),a.querySelectorAll("[selected]").length||q.push("\\["+L+"*(?:value|"+K+")"),a.querySelectorAll("[id~="+u+"-]").length||q.push("~="),a.querySelectorAll(":checked").length||q.push(":checked"),a.querySelectorAll("a#"+u+"+*").length||q.push(".#.+[+~]")}),ja(function(a){var b=g.createElement("input");b.setAttribute("type","hidden"),a.appendChild(b).setAttribute("name","D"),a.querySelectorAll("[name=d]").length&&q.push("name"+L+"*[*^$|!~]?="),a.querySelectorAll(":enabled").length||q.push(":enabled",":disabled"),a.querySelectorAll("*,:x"),q.push(",.*:")})),(c.matchesSelector=$.test(s=o.matches||o.webkitMatchesSelector||o.mozMatchesSelector||o.oMatchesSelector||o.msMatchesSelector))&&ja(function(a){c.disconnectedMatch=s.call(a,"div"),s.call(a,"[s!='']:x"),r.push("!=",P)}),q=q.length&&new RegExp(q.join("|")),r=r.length&&new RegExp(r.join("|")),b=$.test(o.compareDocumentPosition),t=b||$.test(o.contains)?function(a,b){var c=9===a.nodeType?a.documentElement:a,d=b&&b.parentNode;return a===d||!(!d||1!==d.nodeType||!(c.contains?c.contains(d):a.compareDocumentPosition&&16&a.compareDocumentPosition(d)))}:function(a,b){if(b)while(b=b.parentNode)if(b===a)return!0;return!1},B=b?function(a,b){if(a===b)return l=!0,0;var d=!a.compareDocumentPosition-!b.compareDocumentPosition;return d?d:(d=(a.ownerDocument||a)===(b.ownerDocument||b)?a.compareDocumentPosition(b):1,1&d||!c.sortDetached&&b.compareDocumentPosition(a)===d?a===g||a.ownerDocument===v&&t(v,a)?-1:b===g||b.ownerDocument===v&&t(v,b)?1:k?J(k,a)-J(k,b):0:4&d?-1:1)}:function(a,b){if(a===b)return l=!0,0;var c,d=0,e=a.parentNode,f=b.parentNode,h=[a],i=[b];if(!e||!f)return a===g?-1:b===g?1:e?-1:f?1:k?J(k,a)-J(k,b):0;if(e===f)return la(a,b);c=a;while(c=c.parentNode)h.unshift(c);c=b;while(c=c.parentNode)i.unshift(c);while(h[d]===i[d])d++;return d?la(h[d],i[d]):h[d]===v?-1:i[d]===v?1:0},g):n},ga.matches=function(a,b){return ga(a,null,null,b)},ga.matchesSelector=function(a,b){if((a.ownerDocument||a)!==n&&m(a),b=b.replace(U,"='$1']"),!(!c.matchesSelector||!p||r&&r.test(b)||q&&q.test(b)))try{var d=s.call(a,b);if(d||c.disconnectedMatch||a.document&&11!==a.document.nodeType)return d}catch(e){}return ga(b,n,null,[a]).length>0},ga.contains=function(a,b){return(a.ownerDocument||a)!==n&&m(a),t(a,b)},ga.attr=function(a,b){(a.ownerDocument||a)!==n&&m(a);var e=d.attrHandle[b.toLowerCase()],f=e&&D.call(d.attrHandle,b.toLowerCase())?e(a,b,!p):void 0;return void 0!==f?f:c.attributes||!p?a.getAttribute(b):(f=a.getAttributeNode(b))&&f.specified?f.value:null},ga.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)},ga.uniqueSort=function(a){var b,d=[],e=0,f=0;if(l=!c.detectDuplicates,k=!c.sortStable&&a.slice(0),a.sort(B),l){while(b=a[f++])b===a[f]&&(e=d.push(f));while(e--)a.splice(d[e],1)}return k=null,a},e=ga.getText=function(a){var b,c="",d=0,f=a.nodeType;if(f){if(1===f||9===f||11===f){if("string"==typeof a.textContent)return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=e(a)}else if(3===f||4===f)return a.nodeValue}else while(b=a[d++])c+=e(b);return c},d=ga.selectors={cacheLength:50,createPseudo:ia,match:X,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(ca,da),a[3]=(a[3]||a[4]||a[5]||"").replace(ca,da),"~="===a[2]&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),"nth"===a[1].slice(0,3)?(a[3]||ga.error(a[0]),a[4]=+(a[4]?a[5]+(a[6]||1):2*("even"===a[3]||"odd"===a[3])),a[5]=+(a[7]+a[8]||"odd"===a[3])):a[3]&&ga.error(a[0]),a},PSEUDO:function(a){var b,c=!a[6]&&a[2];return X.CHILD.test(a[0])?null:(a[3]?a[2]=a[4]||a[5]||"":c&&V.test(c)&&(b=g(c,!0))&&(b=c.indexOf(")",c.length-b)-c.length)&&(a[0]=a[0].slice(0,b),a[2]=c.slice(0,b)),a.slice(0,3))}},filter:{TAG:function(a){var b=a.replace(ca,da).toLowerCase();return"*"===a?function(){return!0}:function(a){return a.nodeName&&a.nodeName.toLowerCase()===b}},CLASS:function(a){var b=y[a+" "];return b||(b=new RegExp("(^|"+L+")"+a+"("+L+"|$)"))&&y(a,function(a){return b.test("string"==typeof a.className&&a.className||"undefined"!=typeof a.getAttribute&&a.getAttribute("class")||"")})},ATTR:function(a,b,c){return function(d){var e=ga.attr(d,a);return null==e?"!="===b:b?(e+="","="===b?e===c:"!="===b?e!==c:"^="===b?c&&0===e.indexOf(c):"*="===b?c&&e.indexOf(c)>-1:"$="===b?c&&e.slice(-c.length)===c:"~="===b?(" "+e.replace(Q," ")+" ").indexOf(c)>-1:"|="===b?e===c||e.slice(0,c.length+1)===c+"-":!1):!0}},CHILD:function(a,b,c,d,e){var f="nth"!==a.slice(0,3),g="last"!==a.slice(-4),h="of-type"===b;return 1===d&&0===e?function(a){return!!a.parentNode}:function(b,c,i){var j,k,l,m,n,o,p=f!==g?"nextSibling":"previousSibling",q=b.parentNode,r=h&&b.nodeName.toLowerCase(),s=!i&&!h;if(q){if(f){while(p){l=b;while(l=l[p])if(h?l.nodeName.toLowerCase()===r:1===l.nodeType)return!1;o=p="only"===a&&!o&&"nextSibling"}return!0}if(o=[g?q.firstChild:q.lastChild],g&&s){k=q[u]||(q[u]={}),j=k[a]||[],n=j[0]===w&&j[1],m=j[0]===w&&j[2],l=n&&q.childNodes[n];while(l=++n&&l&&l[p]||(m=n=0)||o.pop())if(1===l.nodeType&&++m&&l===b){k[a]=[w,n,m];break}}else if(s&&(j=(b[u]||(b[u]={}))[a])&&j[0]===w)m=j[1];else while(l=++n&&l&&l[p]||(m=n=0)||o.pop())if((h?l.nodeName.toLowerCase()===r:1===l.nodeType)&&++m&&(s&&((l[u]||(l[u]={}))[a]=[w,m]),l===b))break;return m-=e,m===d||m%d===0&&m/d>=0}}},PSEUDO:function(a,b){var c,e=d.pseudos[a]||d.setFilters[a.toLowerCase()]||ga.error("unsupported pseudo: "+a);return e[u]?e(b):e.length>1?(c=[a,a,"",b],d.setFilters.hasOwnProperty(a.toLowerCase())?ia(function(a,c){var d,f=e(a,b),g=f.length;while(g--)d=J(a,f[g]),a[d]=!(c[d]=f[g])}):function(a){return e(a,0,c)}):e}},pseudos:{not:ia(function(a){var b=[],c=[],d=h(a.replace(R,"$1"));return d[u]?ia(function(a,b,c,e){var f,g=d(a,null,e,[]),h=a.length;while(h--)(f=g[h])&&(a[h]=!(b[h]=f))}):function(a,e,f){return b[0]=a,d(b,null,f,c),b[0]=null,!c.pop()}}),has:ia(function(a){return function(b){return ga(a,b).length>0}}),contains:ia(function(a){return a=a.replace(ca,da),function(b){return(b.textContent||b.innerText||e(b)).indexOf(a)>-1}}),lang:ia(function(a){return W.test(a||"")||ga.error("unsupported lang: "+a),a=a.replace(ca,da).toLowerCase(),function(b){var c;do if(c=p?b.lang:b.getAttribute("xml:lang")||b.getAttribute("lang"))return c=c.toLowerCase(),c===a||0===c.indexOf(a+"-");while((b=b.parentNode)&&1===b.nodeType);return!1}}),target:function(b){var c=a.location&&a.location.hash;return c&&c.slice(1)===b.id},root:function(a){return a===o},focus:function(a){return a===n.activeElement&&(!n.hasFocus||n.hasFocus())&&!!(a.type||a.href||~a.tabIndex)},enabled:function(a){return a.disabled===!1},disabled:function(a){return a.disabled===!0},checked:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&!!a.checked||"option"===b&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},empty:function(a){for(a=a.firstChild;a;a=a.nextSibling)if(a.nodeType<6)return!1;return!0},parent:function(a){return!d.pseudos.empty(a)},header:function(a){return Z.test(a.nodeName)},input:function(a){return Y.test(a.nodeName)},button:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&"button"===a.type||"button"===b},text:function(a){var b;return"input"===a.nodeName.toLowerCase()&&"text"===a.type&&(null==(b=a.getAttribute("type"))||"text"===b.toLowerCase())},first:oa(function(){return[0]}),last:oa(function(a,b){return[b-1]}),eq:oa(function(a,b,c){return[0>c?c+b:c]}),even:oa(function(a,b){for(var c=0;b>c;c+=2)a.push(c);return a}),odd:oa(function(a,b){for(var c=1;b>c;c+=2)a.push(c);return a}),lt:oa(function(a,b,c){for(var d=0>c?c+b:c;--d>=0;)a.push(d);return a}),gt:oa(function(a,b,c){for(var d=0>c?c+b:c;++d<b;)a.push(d);return a})}},d.pseudos.nth=d.pseudos.eq;for(b in{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})d.pseudos[b]=ma(b);for(b in{submit:!0,reset:!0})d.pseudos[b]=na(b);function qa(){}qa.prototype=d.filters=d.pseudos,d.setFilters=new qa,g=ga.tokenize=function(a,b){var c,e,f,g,h,i,j,k=z[a+" "];if(k)return b?0:k.slice(0);h=a,i=[],j=d.preFilter;while(h){(!c||(e=S.exec(h)))&&(e&&(h=h.slice(e[0].length)||h),i.push(f=[])),c=!1,(e=T.exec(h))&&(c=e.shift(),f.push({value:c,type:e[0].replace(R," ")}),h=h.slice(c.length));for(g in d.filter)!(e=X[g].exec(h))||j[g]&&!(e=j[g](e))||(c=e.shift(),f.push({value:c,type:g,matches:e}),h=h.slice(c.length));if(!c)break}return b?h.length:h?ga.error(a):z(a,i).slice(0)};function ra(a){for(var b=0,c=a.length,d="";c>b;b++)d+=a[b].value;return d}function sa(a,b,c){var d=b.dir,e=c&&"parentNode"===d,f=x++;return b.first?function(b,c,f){while(b=b[d])if(1===b.nodeType||e)return a(b,c,f)}:function(b,c,g){var h,i,j=[w,f];if(g){while(b=b[d])if((1===b.nodeType||e)&&a(b,c,g))return!0}else while(b=b[d])if(1===b.nodeType||e){if(i=b[u]||(b[u]={}),(h=i[d])&&h[0]===w&&h[1]===f)return j[2]=h[2];if(i[d]=j,j[2]=a(b,c,g))return!0}}}function ta(a){return a.length>1?function(b,c,d){var e=a.length;while(e--)if(!a[e](b,c,d))return!1;return!0}:a[0]}function ua(a,b,c){for(var d=0,e=b.length;e>d;d++)ga(a,b[d],c);return c}function va(a,b,c,d,e){for(var f,g=[],h=0,i=a.length,j=null!=b;i>h;h++)(f=a[h])&&(!c||c(f,d,e))&&(g.push(f),j&&b.push(h));return g}function wa(a,b,c,d,e,f){return d&&!d[u]&&(d=wa(d)),e&&!e[u]&&(e=wa(e,f)),ia(function(f,g,h,i){var j,k,l,m=[],n=[],o=g.length,p=f||ua(b||"*",h.nodeType?[h]:h,[]),q=!a||!f&&b?p:va(p,m,a,h,i),r=c?e||(f?a:o||d)?[]:g:q;if(c&&c(q,r,h,i),d){j=va(r,n),d(j,[],h,i),k=j.length;while(k--)(l=j[k])&&(r[n[k]]=!(q[n[k]]=l))}if(f){if(e||a){if(e){j=[],k=r.length;while(k--)(l=r[k])&&j.push(q[k]=l);e(null,r=[],j,i)}k=r.length;while(k--)(l=r[k])&&(j=e?J(f,l):m[k])>-1&&(f[j]=!(g[j]=l))}}else r=va(r===g?r.splice(o,r.length):r),e?e(null,g,r,i):H.apply(g,r)})}function xa(a){for(var b,c,e,f=a.length,g=d.relative[a[0].type],h=g||d.relative[" "],i=g?1:0,k=sa(function(a){return a===b},h,!0),l=sa(function(a){return J(b,a)>-1},h,!0),m=[function(a,c,d){var e=!g&&(d||c!==j)||((b=c).nodeType?k(a,c,d):l(a,c,d));return b=null,e}];f>i;i++)if(c=d.relative[a[i].type])m=[sa(ta(m),c)];else{if(c=d.filter[a[i].type].apply(null,a[i].matches),c[u]){for(e=++i;f>e;e++)if(d.relative[a[e].type])break;return wa(i>1&&ta(m),i>1&&ra(a.slice(0,i-1).concat({value:" "===a[i-2].type?"*":""})).replace(R,"$1"),c,e>i&&xa(a.slice(i,e)),f>e&&xa(a=a.slice(e)),f>e&&ra(a))}m.push(c)}return ta(m)}function ya(a,b){var c=b.length>0,e=a.length>0,f=function(f,g,h,i,k){var l,m,o,p=0,q="0",r=f&&[],s=[],t=j,u=f||e&&d.find.TAG("*",k),v=w+=null==t?1:Math.random()||.1,x=u.length;for(k&&(j=g!==n&&g);q!==x&&null!=(l=u[q]);q++){if(e&&l){m=0;while(o=a[m++])if(o(l,g,h)){i.push(l);break}k&&(w=v)}c&&((l=!o&&l)&&p--,f&&r.push(l))}if(p+=q,c&&q!==p){m=0;while(o=b[m++])o(r,s,g,h);if(f){if(p>0)while(q--)r[q]||s[q]||(s[q]=F.call(i));s=va(s)}H.apply(i,s),k&&!f&&s.length>0&&p+b.length>1&&ga.uniqueSort(i)}return k&&(w=v,j=t),r};return c?ia(f):f}return h=ga.compile=function(a,b){var c,d=[],e=[],f=A[a+" "];if(!f){b||(b=g(a)),c=b.length;while(c--)f=xa(b[c]),f[u]?d.push(f):e.push(f);f=A(a,ya(e,d)),f.selector=a}return f},i=ga.select=function(a,b,e,f){var i,j,k,l,m,n="function"==typeof a&&a,o=!f&&g(a=n.selector||a);if(e=e||[],1===o.length){if(j=o[0]=o[0].slice(0),j.length>2&&"ID"===(k=j[0]).type&&c.getById&&9===b.nodeType&&p&&d.relative[j[1].type]){if(b=(d.find.ID(k.matches[0].replace(ca,da),b)||[])[0],!b)return e;n&&(b=b.parentNode),a=a.slice(j.shift().value.length)}i=X.needsContext.test(a)?0:j.length;while(i--){if(k=j[i],d.relative[l=k.type])break;if((m=d.find[l])&&(f=m(k.matches[0].replace(ca,da),aa.test(j[0].type)&&pa(b.parentNode)||b))){if(j.splice(i,1),a=f.length&&ra(j),!a)return H.apply(e,f),e;break}}}return(n||h(a,o))(f,b,!p,e,aa.test(a)&&pa(b.parentNode)||b),e},c.sortStable=u.split("").sort(B).join("")===u,c.detectDuplicates=!!l,m(),c.sortDetached=ja(function(a){return 1&a.compareDocumentPosition(n.createElement("div"))}),ja(function(a){return a.innerHTML="<a href='#'></a>","#"===a.firstChild.getAttribute("href")})||ka("type|href|height|width",function(a,b,c){return c?void 0:a.getAttribute(b,"type"===b.toLowerCase()?1:2)}),c.attributes&&ja(function(a){return a.innerHTML="<input/>",a.firstChild.setAttribute("value",""),""===a.firstChild.getAttribute("value")})||ka("value",function(a,b,c){return c||"input"!==a.nodeName.toLowerCase()?void 0:a.defaultValue}),ja(function(a){return null==a.getAttribute("disabled")})||ka(K,function(a,b,c){var d;return c?void 0:a[b]===!0?b.toLowerCase():(d=a.getAttributeNode(b))&&d.specified?d.value:null}),ga}(a);m.find=s,m.expr=s.selectors,m.expr[":"]=m.expr.pseudos,m.unique=s.uniqueSort,m.text=s.getText,m.isXMLDoc=s.isXML,m.contains=s.contains;var t=m.expr.match.needsContext,u=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,v=/^.[^:#\[\.,]*$/;function w(a,b,c){if(m.isFunction(b))return m.grep(a,function(a,d){return!!b.call(a,d,a)!==c});if(b.nodeType)return m.grep(a,function(a){return a===b!==c});if("string"==typeof b){if(v.test(b))return m.filter(b,a,c);b=m.filter(b,a)}return m.grep(a,function(a){return m.inArray(a,b)>=0!==c})}m.filter=function(a,b,c){var d=b[0];return c&&(a=":not("+a+")"),1===b.length&&1===d.nodeType?m.find.matchesSelector(d,a)?[d]:[]:m.find.matches(a,m.grep(b,function(a){return 1===a.nodeType}))},m.fn.extend({find:function(a){var b,c=[],d=this,e=d.length;if("string"!=typeof a)return this.pushStack(m(a).filter(function(){for(b=0;e>b;b++)if(m.contains(d[b],this))return!0}));for(b=0;e>b;b++)m.find(a,d[b],c);return c=this.pushStack(e>1?m.unique(c):c),c.selector=this.selector?this.selector+" "+a:a,c},filter:function(a){return this.pushStack(w(this,a||[],!1))},not:function(a){return this.pushStack(w(this,a||[],!0))},is:function(a){return!!w(this,"string"==typeof a&&t.test(a)?m(a):a||[],!1).length}});var x,y=a.document,z=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,A=m.fn.init=function(a,b){var c,d;if(!a)return this;if("string"==typeof a){if(c="<"===a.charAt(0)&&">"===a.charAt(a.length-1)&&a.length>=3?[null,a,null]:z.exec(a),!c||!c[1]&&b)return!b||b.jquery?(b||x).find(a):this.constructor(b).find(a);if(c[1]){if(b=b instanceof m?b[0]:b,m.merge(this,m.parseHTML(c[1],b&&b.nodeType?b.ownerDocument||b:y,!0)),u.test(c[1])&&m.isPlainObject(b))for(c in b)m.isFunction(this[c])?this[c](b[c]):this.attr(c,b[c]);return this}if(d=y.getElementById(c[2]),d&&d.parentNode){if(d.id!==c[2])return x.find(a);this.length=1,this[0]=d}return this.context=y,this.selector=a,this}return a.nodeType?(this.context=this[0]=a,this.length=1,this):m.isFunction(a)?"undefined"!=typeof x.ready?x.ready(a):a(m):(void 0!==a.selector&&(this.selector=a.selector,this.context=a.context),m.makeArray(a,this))};A.prototype=m.fn,x=m(y);var B=/^(?:parents|prev(?:Until|All))/,C={children:!0,contents:!0,next:!0,prev:!0};m.extend({dir:function(a,b,c){var d=[],e=a[b];while(e&&9!==e.nodeType&&(void 0===c||1!==e.nodeType||!m(e).is(c)))1===e.nodeType&&d.push(e),e=e[b];return d},sibling:function(a,b){for(var c=[];a;a=a.nextSibling)1===a.nodeType&&a!==b&&c.push(a);return c}}),m.fn.extend({has:function(a){var b,c=m(a,this),d=c.length;return this.filter(function(){for(b=0;d>b;b++)if(m.contains(this,c[b]))return!0})},closest:function(a,b){for(var c,d=0,e=this.length,f=[],g=t.test(a)||"string"!=typeof a?m(a,b||this.context):0;e>d;d++)for(c=this[d];c&&c!==b;c=c.parentNode)if(c.nodeType<11&&(g?g.index(c)>-1:1===c.nodeType&&m.find.matchesSelector(c,a))){f.push(c);break}return this.pushStack(f.length>1?m.unique(f):f)},index:function(a){return a?"string"==typeof a?m.inArray(this[0],m(a)):m.inArray(a.jquery?a[0]:a,this):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(a,b){return this.pushStack(m.unique(m.merge(this.get(),m(a,b))))},addBack:function(a){return this.add(null==a?this.prevObject:this.prevObject.filter(a))}});function D(a,b){do a=a[b];while(a&&1!==a.nodeType);return a}m.each({parent:function(a){var b=a.parentNode;return b&&11!==b.nodeType?b:null},parents:function(a){return m.dir(a,"parentNode")},parentsUntil:function(a,b,c){return m.dir(a,"parentNode",c)},next:function(a){return D(a,"nextSibling")},prev:function(a){return D(a,"previousSibling")},nextAll:function(a){return m.dir(a,"nextSibling")},prevAll:function(a){return m.dir(a,"previousSibling")},nextUntil:function(a,b,c){return m.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return m.dir(a,"previousSibling",c)},siblings:function(a){return m.sibling((a.parentNode||{}).firstChild,a)},children:function(a){return m.sibling(a.firstChild)},contents:function(a){return m.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:m.merge([],a.childNodes)}},function(a,b){m.fn[a]=function(c,d){var e=m.map(this,b,c);return"Until"!==a.slice(-5)&&(d=c),d&&"string"==typeof d&&(e=m.filter(d,e)),this.length>1&&(C[a]||(e=m.unique(e)),B.test(a)&&(e=e.reverse())),this.pushStack(e)}});var E=/\S+/g,F={};function G(a){var b=F[a]={};return m.each(a.match(E)||[],function(a,c){b[c]=!0}),b}m.Callbacks=function(a){a="string"==typeof a?F[a]||G(a):m.extend({},a);var b,c,d,e,f,g,h=[],i=!a.once&&[],j=function(l){for(c=a.memory&&l,d=!0,f=g||0,g=0,e=h.length,b=!0;h&&e>f;f++)if(h[f].apply(l[0],l[1])===!1&&a.stopOnFalse){c=!1;break}b=!1,h&&(i?i.length&&j(i.shift()):c?h=[]:k.disable())},k={add:function(){if(h){var d=h.length;!function f(b){m.each(b,function(b,c){var d=m.type(c);"function"===d?a.unique&&k.has(c)||h.push(c):c&&c.length&&"string"!==d&&f(c)})}(arguments),b?e=h.length:c&&(g=d,j(c))}return this},remove:function(){return h&&m.each(arguments,function(a,c){var d;while((d=m.inArray(c,h,d))>-1)h.splice(d,1),b&&(e>=d&&e--,f>=d&&f--)}),this},has:function(a){return a?m.inArray(a,h)>-1:!(!h||!h.length)},empty:function(){return h=[],e=0,this},disable:function(){return h=i=c=void 0,this},disabled:function(){return!h},lock:function(){return i=void 0,c||k.disable(),this},locked:function(){return!i},fireWith:function(a,c){return!h||d&&!i||(c=c||[],c=[a,c.slice?c.slice():c],b?i.push(c):j(c)),this},fire:function(){return k.fireWith(this,arguments),this},fired:function(){return!!d}};return k},m.extend({Deferred:function(a){var b=[["resolve","done",m.Callbacks("once memory"),"resolved"],["reject","fail",m.Callbacks("once memory"),"rejected"],["notify","progress",m.Callbacks("memory")]],c="pending",d={state:function(){return c},always:function(){return e.done(arguments).fail(arguments),this},then:function(){var a=arguments;return m.Deferred(function(c){m.each(b,function(b,f){var g=m.isFunction(a[b])&&a[b];e[f[1]](function(){var a=g&&g.apply(this,arguments);a&&m.isFunction(a.promise)?a.promise().done(c.resolve).fail(c.reject).progress(c.notify):c[f[0]+"With"](this===d?c.promise():this,g?[a]:arguments)})}),a=null}).promise()},promise:function(a){return null!=a?m.extend(a,d):d}},e={};return d.pipe=d.then,m.each(b,function(a,f){var g=f[2],h=f[3];d[f[1]]=g.add,h&&g.add(function(){c=h},b[1^a][2].disable,b[2][2].lock),e[f[0]]=function(){return e[f[0]+"With"](this===e?d:this,arguments),this},e[f[0]+"With"]=g.fireWith}),d.promise(e),a&&a.call(e,e),e},when:function(a){var b=0,c=d.call(arguments),e=c.length,f=1!==e||a&&m.isFunction(a.promise)?e:0,g=1===f?a:m.Deferred(),h=function(a,b,c){return function(e){b[a]=this,c[a]=arguments.length>1?d.call(arguments):e,c===i?g.notifyWith(b,c):--f||g.resolveWith(b,c)}},i,j,k;if(e>1)for(i=new Array(e),j=new Array(e),k=new Array(e);e>b;b++)c[b]&&m.isFunction(c[b].promise)?c[b].promise().done(h(b,k,c)).fail(g.reject).progress(h(b,j,i)):--f;return f||g.resolveWith(k,c),g.promise()}});var H;m.fn.ready=function(a){return m.ready.promise().done(a),this},m.extend({isReady:!1,readyWait:1,holdReady:function(a){a?m.readyWait++:m.ready(!0)},ready:function(a){if(a===!0?!--m.readyWait:!m.isReady){if(!y.body)return setTimeout(m.ready);m.isReady=!0,a!==!0&&--m.readyWait>0||(H.resolveWith(y,[m]),m.fn.triggerHandler&&(m(y).triggerHandler("ready"),m(y).off("ready")))}}});function I(){y.addEventListener?(y.removeEventListener("DOMContentLoaded",J,!1),a.removeEventListener("load",J,!1)):(y.detachEvent("onreadystatechange",J),a.detachEvent("onload",J))}function J(){(y.addEventListener||"load"===event.type||"complete"===y.readyState)&&(I(),m.ready())}m.ready.promise=function(b){if(!H)if(H=m.Deferred(),"complete"===y.readyState)setTimeout(m.ready);else if(y.addEventListener)y.addEventListener("DOMContentLoaded",J,!1),a.addEventListener("load",J,!1);else{y.attachEvent("onreadystatechange",J),a.attachEvent("onload",J);var c=!1;try{c=null==a.frameElement&&y.documentElement}catch(d){}c&&c.doScroll&&!function e(){if(!m.isReady){try{c.doScroll("left")}catch(a){return setTimeout(e,50)}I(),m.ready()}}()}return H.promise(b)};var K="undefined",L;for(L in m(k))break;k.ownLast="0"!==L,k.inlineBlockNeedsLayout=!1,m(function(){var a,b,c,d;c=y.getElementsByTagName("body")[0],c&&c.style&&(b=y.createElement("div"),d=y.createElement("div"),d.style.cssText="position:absolute;border:0;width:0;height:0;top:0;left:-9999px",c.appendChild(d).appendChild(b),typeof b.style.zoom!==K&&(b.style.cssText="display:inline;margin:0;border:0;padding:1px;width:1px;zoom:1",k.inlineBlockNeedsLayout=a=3===b.offsetWidth,a&&(c.style.zoom=1)),c.removeChild(d))}),function(){var a=y.createElement("div");if(null==k.deleteExpando){k.deleteExpando=!0;try{delete a.test}catch(b){k.deleteExpando=!1}}a=null}(),m.acceptData=function(a){var b=m.noData[(a.nodeName+" ").toLowerCase()],c=+a.nodeType||1;return 1!==c&&9!==c?!1:!b||b!==!0&&a.getAttribute("classid")===b};var M=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,N=/([A-Z])/g;function O(a,b,c){if(void 0===c&&1===a.nodeType){var d="data-"+b.replace(N,"-$1").toLowerCase();if(c=a.getAttribute(d),"string"==typeof c){try{c="true"===c?!0:"false"===c?!1:"null"===c?null:+c+""===c?+c:M.test(c)?m.parseJSON(c):c}catch(e){}m.data(a,b,c)}else c=void 0}return c}function P(a){var b;for(b in a)if(("data"!==b||!m.isEmptyObject(a[b]))&&"toJSON"!==b)return!1;
 
return!0}function Q(a,b,d,e){if(m.acceptData(a)){var f,g,h=m.expando,i=a.nodeType,j=i?m.cache:a,k=i?a[h]:a[h]&&h;if(k&&j[k]&&(e||j[k].data)||void 0!==d||"string"!=typeof b)return k||(k=i?a[h]=c.pop()||m.guid++:h),j[k]||(j[k]=i?{}:{toJSON:m.noop}),("object"==typeof b||"function"==typeof b)&&(e?j[k]=m.extend(j[k],b):j[k].data=m.extend(j[k].data,b)),g=j[k],e||(g.data||(g.data={}),g=g.data),void 0!==d&&(g[m.camelCase(b)]=d),"string"==typeof b?(f=g[b],null==f&&(f=g[m.camelCase(b)])):f=g,f}}function R(a,b,c){if(m.acceptData(a)){var d,e,f=a.nodeType,g=f?m.cache:a,h=f?a[m.expando]:m.expando;if(g[h]){if(b&&(d=c?g[h]:g[h].data)){m.isArray(b)?b=b.concat(m.map(b,m.camelCase)):b in d?b=[b]:(b=m.camelCase(b),b=b in d?[b]:b.split(" ")),e=b.length;while(e--)delete d[b[e]];if(c?!P(d):!m.isEmptyObject(d))return}(c||(delete g[h].data,P(g[h])))&&(f?m.cleanData([a],!0):k.deleteExpando||g!=g.window?delete g[h]:g[h]=null)}}}m.extend({cache:{},noData:{"applet ":!0,"embed ":!0,"object ":"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"},hasData:function(a){return a=a.nodeType?m.cache[a[m.expando]]:a[m.expando],!!a&&!P(a)},data:function(a,b,c){return Q(a,b,c)},removeData:function(a,b){return R(a,b)},_data:function(a,b,c){return Q(a,b,c,!0)},_removeData:function(a,b){return R(a,b,!0)}}),m.fn.extend({data:function(a,b){var c,d,e,f=this[0],g=f&&f.attributes;if(void 0===a){if(this.length&&(e=m.data(f),1===f.nodeType&&!m._data(f,"parsedAttrs"))){c=g.length;while(c--)g[c]&&(d=g[c].name,0===d.indexOf("data-")&&(d=m.camelCase(d.slice(5)),O(f,d,e[d])));m._data(f,"parsedAttrs",!0)}return e}return"object"==typeof a?this.each(function(){m.data(this,a)}):arguments.length>1?this.each(function(){m.data(this,a,b)}):f?O(f,a,m.data(f,a)):void 0},removeData:function(a){return this.each(function(){m.removeData(this,a)})}}),m.extend({queue:function(a,b,c){var d;return a?(b=(b||"fx")+"queue",d=m._data(a,b),c&&(!d||m.isArray(c)?d=m._data(a,b,m.makeArray(c)):d.push(c)),d||[]):void 0},dequeue:function(a,b){b=b||"fx";var c=m.queue(a,b),d=c.length,e=c.shift(),f=m._queueHooks(a,b),g=function(){m.dequeue(a,b)};"inprogress"===e&&(e=c.shift(),d--),e&&("fx"===b&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return m._data(a,c)||m._data(a,c,{empty:m.Callbacks("once memory").add(function(){m._removeData(a,b+"queue"),m._removeData(a,c)})})}}),m.fn.extend({queue:function(a,b){var c=2;return"string"!=typeof a&&(b=a,a="fx",c--),arguments.length<c?m.queue(this[0],a):void 0===b?this:this.each(function(){var c=m.queue(this,a,b);m._queueHooks(this,a),"fx"===a&&"inprogress"!==c[0]&&m.dequeue(this,a)})},dequeue:function(a){return this.each(function(){m.dequeue(this,a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,b){var c,d=1,e=m.Deferred(),f=this,g=this.length,h=function(){--d||e.resolveWith(f,[f])};"string"!=typeof a&&(b=a,a=void 0),a=a||"fx";while(g--)c=m._data(f[g],a+"queueHooks"),c&&c.empty&&(d++,c.empty.add(h));return h(),e.promise(b)}});var S=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,T=["Top","Right","Bottom","Left"],U=function(a,b){return a=b||a,"none"===m.css(a,"display")||!m.contains(a.ownerDocument,a)},V=m.access=function(a,b,c,d,e,f,g){var h=0,i=a.length,j=null==c;if("object"===m.type(c)){e=!0;for(h in c)m.access(a,b,h,c[h],!0,f,g)}else if(void 0!==d&&(e=!0,m.isFunction(d)||(g=!0),j&&(g?(b.call(a,d),b=null):(j=b,b=function(a,b,c){return j.call(m(a),c)})),b))for(;i>h;h++)b(a[h],c,g?d:d.call(a[h],h,b(a[h],c)));return e?a:j?b.call(a):i?b(a[0],c):f},W=/^(?:checkbox|radio)$/i;!function(){var a=y.createElement("input"),b=y.createElement("div"),c=y.createDocumentFragment();if(b.innerHTML=" <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",k.leadingWhitespace=3===b.firstChild.nodeType,k.tbody=!b.getElementsByTagName("tbody").length,k.htmlSerialize=!!b.getElementsByTagName("link").length,k.html5Clone="<:nav></:nav>"!==y.createElement("nav").cloneNode(!0).outerHTML,a.type="checkbox",a.checked=!0,c.appendChild(a),k.appendChecked=a.checked,b.innerHTML="<textarea>x</textarea>",k.noCloneChecked=!!b.cloneNode(!0).lastChild.defaultValue,c.appendChild(b),b.innerHTML="<input type='radio' checked='checked' name='t'/>",k.checkClone=b.cloneNode(!0).cloneNode(!0).lastChild.checked,k.noCloneEvent=!0,b.attachEvent&&(b.attachEvent("onclick",function(){k.noCloneEvent=!1}),b.cloneNode(!0).click()),null==k.deleteExpando){k.deleteExpando=!0;try{delete b.test}catch(d){k.deleteExpando=!1}}}(),function(){var b,c,d=y.createElement("div");for(b in{submit:!0,change:!0,focusin:!0})c="on"+b,(k[b+"Bubbles"]=c in a)||(d.setAttribute(c,"t"),k[b+"Bubbles"]=d.attributes[c].expando===!1);d=null}();var X=/^(?:input|select|textarea)$/i,Y=/^key/,Z=/^(?:mouse|pointer|contextmenu)|click/,$=/^(?:focusinfocus|focusoutblur)$/,_=/^([^.]*)(?:\.(.+)|)$/;function aa(){return!0}function ba(){return!1}function ca(){try{return y.activeElement}catch(a){}}m.event={global:{},add:function(a,b,c,d,e){var f,g,h,i,j,k,l,n,o,p,q,r=m._data(a);if(r){c.handler&&(i=c,c=i.handler,e=i.selector),c.guid||(c.guid=m.guid++),(g=r.events)||(g=r.events={}),(k=r.handle)||(k=r.handle=function(a){return typeof m===K||a&&m.event.triggered===a.type?void 0:m.event.dispatch.apply(k.elem,arguments)},k.elem=a),b=(b||"").match(E)||[""],h=b.length;while(h--)f=_.exec(b[h])||[],o=q=f[1],p=(f[2]||"").split(".").sort(),o&&(j=m.event.special[o]||{},o=(e?j.delegateType:j.bindType)||o,j=m.event.special[o]||{},l=m.extend({type:o,origType:q,data:d,handler:c,guid:c.guid,selector:e,needsContext:e&&m.expr.match.needsContext.test(e),namespace:p.join(".")},i),(n=g[o])||(n=g[o]=[],n.delegateCount=0,j.setup&&j.setup.call(a,d,p,k)!==!1||(a.addEventListener?a.addEventListener(o,k,!1):a.attachEvent&&a.attachEvent("on"+o,k))),j.add&&(j.add.call(a,l),l.handler.guid||(l.handler.guid=c.guid)),e?n.splice(n.delegateCount++,0,l):n.push(l),m.event.global[o]=!0);a=null}},remove:function(a,b,c,d,e){var f,g,h,i,j,k,l,n,o,p,q,r=m.hasData(a)&&m._data(a);if(r&&(k=r.events)){b=(b||"").match(E)||[""],j=b.length;while(j--)if(h=_.exec(b[j])||[],o=q=h[1],p=(h[2]||"").split(".").sort(),o){l=m.event.special[o]||{},o=(d?l.delegateType:l.bindType)||o,n=k[o]||[],h=h[2]&&new RegExp("(^|\\.)"+p.join("\\.(?:.*\\.|)")+"(\\.|$)"),i=f=n.length;while(f--)g=n[f],!e&&q!==g.origType||c&&c.guid!==g.guid||h&&!h.test(g.namespace)||d&&d!==g.selector&&("**"!==d||!g.selector)||(n.splice(f,1),g.selector&&n.delegateCount--,l.remove&&l.remove.call(a,g));i&&!n.length&&(l.teardown&&l.teardown.call(a,p,r.handle)!==!1||m.removeEvent(a,o,r.handle),delete k[o])}else for(o in k)m.event.remove(a,o+b[j],c,d,!0);m.isEmptyObject(k)&&(delete r.handle,m._removeData(a,"events"))}},trigger:function(b,c,d,e){var f,g,h,i,k,l,n,o=[d||y],p=j.call(b,"type")?b.type:b,q=j.call(b,"namespace")?b.namespace.split("."):[];if(h=l=d=d||y,3!==d.nodeType&&8!==d.nodeType&&!$.test(p+m.event.triggered)&&(p.indexOf(".")>=0&&(q=p.split("."),p=q.shift(),q.sort()),g=p.indexOf(":")<0&&"on"+p,b=b[m.expando]?b:new m.Event(p,"object"==typeof b&&b),b.isTrigger=e?2:3,b.namespace=q.join("."),b.namespace_re=b.namespace?new RegExp("(^|\\.)"+q.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,b.result=void 0,b.target||(b.target=d),c=null==c?[b]:m.makeArray(c,[b]),k=m.event.special[p]||{},e||!k.trigger||k.trigger.apply(d,c)!==!1)){if(!e&&!k.noBubble&&!m.isWindow(d)){for(i=k.delegateType||p,$.test(i+p)||(h=h.parentNode);h;h=h.parentNode)o.push(h),l=h;l===(d.ownerDocument||y)&&o.push(l.defaultView||l.parentWindow||a)}n=0;while((h=o[n++])&&!b.isPropagationStopped())b.type=n>1?i:k.bindType||p,f=(m._data(h,"events")||{})[b.type]&&m._data(h,"handle"),f&&f.apply(h,c),f=g&&h[g],f&&f.apply&&m.acceptData(h)&&(b.result=f.apply(h,c),b.result===!1&&b.preventDefault());if(b.type=p,!e&&!b.isDefaultPrevented()&&(!k._default||k._default.apply(o.pop(),c)===!1)&&m.acceptData(d)&&g&&d[p]&&!m.isWindow(d)){l=d[g],l&&(d[g]=null),m.event.triggered=p;try{d[p]()}catch(r){}m.event.triggered=void 0,l&&(d[g]=l)}return b.result}},dispatch:function(a){a=m.event.fix(a);var b,c,e,f,g,h=[],i=d.call(arguments),j=(m._data(this,"events")||{})[a.type]||[],k=m.event.special[a.type]||{};if(i[0]=a,a.delegateTarget=this,!k.preDispatch||k.preDispatch.call(this,a)!==!1){h=m.event.handlers.call(this,a,j),b=0;while((f=h[b++])&&!a.isPropagationStopped()){a.currentTarget=f.elem,g=0;while((e=f.handlers[g++])&&!a.isImmediatePropagationStopped())(!a.namespace_re||a.namespace_re.test(e.namespace))&&(a.handleObj=e,a.data=e.data,c=((m.event.special[e.origType]||{}).handle||e.handler).apply(f.elem,i),void 0!==c&&(a.result=c)===!1&&(a.preventDefault(),a.stopPropagation()))}return k.postDispatch&&k.postDispatch.call(this,a),a.result}},handlers:function(a,b){var c,d,e,f,g=[],h=b.delegateCount,i=a.target;if(h&&i.nodeType&&(!a.button||"click"!==a.type))for(;i!=this;i=i.parentNode||this)if(1===i.nodeType&&(i.disabled!==!0||"click"!==a.type)){for(e=[],f=0;h>f;f++)d=b[f],c=d.selector+" ",void 0===e[c]&&(e[c]=d.needsContext?m(c,this).index(i)>=0:m.find(c,this,null,[i]).length),e[c]&&e.push(d);e.length&&g.push({elem:i,handlers:e})}return h<b.length&&g.push({elem:this,handlers:b.slice(h)}),g},fix:function(a){if(a[m.expando])return a;var b,c,d,e=a.type,f=a,g=this.fixHooks[e];g||(this.fixHooks[e]=g=Z.test(e)?this.mouseHooks:Y.test(e)?this.keyHooks:{}),d=g.props?this.props.concat(g.props):this.props,a=new m.Event(f),b=d.length;while(b--)c=d[b],a[c]=f[c];return a.target||(a.target=f.srcElement||y),3===a.target.nodeType&&(a.target=a.target.parentNode),a.metaKey=!!a.metaKey,g.filter?g.filter(a,f):a},props:"altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){return null==a.which&&(a.which=null!=b.charCode?b.charCode:b.keyCode),a}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,b){var c,d,e,f=b.button,g=b.fromElement;return null==a.pageX&&null!=b.clientX&&(d=a.target.ownerDocument||y,e=d.documentElement,c=d.body,a.pageX=b.clientX+(e&&e.scrollLeft||c&&c.scrollLeft||0)-(e&&e.clientLeft||c&&c.clientLeft||0),a.pageY=b.clientY+(e&&e.scrollTop||c&&c.scrollTop||0)-(e&&e.clientTop||c&&c.clientTop||0)),!a.relatedTarget&&g&&(a.relatedTarget=g===a.target?b.toElement:g),a.which||void 0===f||(a.which=1&f?1:2&f?3:4&f?2:0),a}},special:{load:{noBubble:!0},focus:{trigger:function(){if(this!==ca()&&this.focus)try{return this.focus(),!1}catch(a){}},delegateType:"focusin"},blur:{trigger:function(){return this===ca()&&this.blur?(this.blur(),!1):void 0},delegateType:"focusout"},click:{trigger:function(){return m.nodeName(this,"input")&&"checkbox"===this.type&&this.click?(this.click(),!1):void 0},_default:function(a){return m.nodeName(a.target,"a")}},beforeunload:{postDispatch:function(a){void 0!==a.result&&a.originalEvent&&(a.originalEvent.returnValue=a.result)}}},simulate:function(a,b,c,d){var e=m.extend(new m.Event,c,{type:a,isSimulated:!0,originalEvent:{}});d?m.event.trigger(e,null,b):m.event.dispatch.call(b,e),e.isDefaultPrevented()&&c.preventDefault()}},m.removeEvent=y.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){var d="on"+b;a.detachEvent&&(typeof a[d]===K&&(a[d]=null),a.detachEvent(d,c))},m.Event=function(a,b){return this instanceof m.Event?(a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||void 0===a.defaultPrevented&&a.returnValue===!1?aa:ba):this.type=a,b&&m.extend(this,b),this.timeStamp=a&&a.timeStamp||m.now(),void(this[m.expando]=!0)):new m.Event(a,b)},m.Event.prototype={isDefaultPrevented:ba,isPropagationStopped:ba,isImmediatePropagationStopped:ba,preventDefault:function(){var a=this.originalEvent;this.isDefaultPrevented=aa,a&&(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){var a=this.originalEvent;this.isPropagationStopped=aa,a&&(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){var a=this.originalEvent;this.isImmediatePropagationStopped=aa,a&&a.stopImmediatePropagation&&a.stopImmediatePropagation(),this.stopPropagation()}},m.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(a,b){m.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c,d=this,e=a.relatedTarget,f=a.handleObj;return(!e||e!==d&&!m.contains(d,e))&&(a.type=f.origType,c=f.handler.apply(this,arguments),a.type=b),c}}}),k.submitBubbles||(m.event.special.submit={setup:function(){return m.nodeName(this,"form")?!1:void m.event.add(this,"click._submit keypress._submit",function(a){var b=a.target,c=m.nodeName(b,"input")||m.nodeName(b,"button")?b.form:void 0;c&&!m._data(c,"submitBubbles")&&(m.event.add(c,"submit._submit",function(a){a._submit_bubble=!0}),m._data(c,"submitBubbles",!0))})},postDispatch:function(a){a._submit_bubble&&(delete a._submit_bubble,this.parentNode&&!a.isTrigger&&m.event.simulate("submit",this.parentNode,a,!0))},teardown:function(){return m.nodeName(this,"form")?!1:void m.event.remove(this,"._submit")}}),k.changeBubbles||(m.event.special.change={setup:function(){return X.test(this.nodeName)?(("checkbox"===this.type||"radio"===this.type)&&(m.event.add(this,"propertychange._change",function(a){"checked"===a.originalEvent.propertyName&&(this._just_changed=!0)}),m.event.add(this,"click._change",function(a){this._just_changed&&!a.isTrigger&&(this._just_changed=!1),m.event.simulate("change",this,a,!0)})),!1):void m.event.add(this,"beforeactivate._change",function(a){var b=a.target;X.test(b.nodeName)&&!m._data(b,"changeBubbles")&&(m.event.add(b,"change._change",function(a){!this.parentNode||a.isSimulated||a.isTrigger||m.event.simulate("change",this.parentNode,a,!0)}),m._data(b,"changeBubbles",!0))})},handle:function(a){var b=a.target;return this!==b||a.isSimulated||a.isTrigger||"radio"!==b.type&&"checkbox"!==b.type?a.handleObj.handler.apply(this,arguments):void 0},teardown:function(){return m.event.remove(this,"._change"),!X.test(this.nodeName)}}),k.focusinBubbles||m.each({focus:"focusin",blur:"focusout"},function(a,b){var c=function(a){m.event.simulate(b,a.target,m.event.fix(a),!0)};m.event.special[b]={setup:function(){var d=this.ownerDocument||this,e=m._data(d,b);e||d.addEventListener(a,c,!0),m._data(d,b,(e||0)+1)},teardown:function(){var d=this.ownerDocument||this,e=m._data(d,b)-1;e?m._data(d,b,e):(d.removeEventListener(a,c,!0),m._removeData(d,b))}}}),m.fn.extend({on:function(a,b,c,d,e){var f,g;if("object"==typeof a){"string"!=typeof b&&(c=c||b,b=void 0);for(f in a)this.on(f,b,c,a[f],e);return this}if(null==c&&null==d?(d=b,c=b=void 0):null==d&&("string"==typeof b?(d=c,c=void 0):(d=c,c=b,b=void 0)),d===!1)d=ba;else if(!d)return this;return 1===e&&(g=d,d=function(a){return m().off(a),g.apply(this,arguments)},d.guid=g.guid||(g.guid=m.guid++)),this.each(function(){m.event.add(this,a,d,c,b)})},one:function(a,b,c,d){return this.on(a,b,c,d,1)},off:function(a,b,c){var d,e;if(a&&a.preventDefault&&a.handleObj)return d=a.handleObj,m(a.delegateTarget).off(d.namespace?d.origType+"."+d.namespace:d.origType,d.selector,d.handler),this;if("object"==typeof a){for(e in a)this.off(e,b,a[e]);return this}return(b===!1||"function"==typeof b)&&(c=b,b=void 0),c===!1&&(c=ba),this.each(function(){m.event.remove(this,a,c,b)})},trigger:function(a,b){return this.each(function(){m.event.trigger(a,b,this)})},triggerHandler:function(a,b){var c=this[0];return c?m.event.trigger(a,b,c,!0):void 0}});function da(a){var b=ea.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}var ea="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",fa=/ jQuery\d+="(?:null|\d+)"/g,ga=new RegExp("<(?:"+ea+")[\\s/>]","i"),ha=/^\s+/,ia=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,ja=/<([\w:]+)/,ka=/<tbody/i,la=/<|&#?\w+;/,ma=/<(?:script|style|link)/i,na=/checked\s*(?:[^=]|=\s*.checked.)/i,oa=/^$|\/(?:java|ecma)script/i,pa=/^true\/(.*)/,qa=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,ra={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],area:[1,"<map>","</map>"],param:[1,"<object>","</object>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:k.htmlSerialize?[0,"",""]:[1,"X<div>","</div>"]},sa=da(y),ta=sa.appendChild(y.createElement("div"));ra.optgroup=ra.option,ra.tbody=ra.tfoot=ra.colgroup=ra.caption=ra.thead,ra.th=ra.td;function ua(a,b){var c,d,e=0,f=typeof a.getElementsByTagName!==K?a.getElementsByTagName(b||"*"):typeof a.querySelectorAll!==K?a.querySelectorAll(b||"*"):void 0;if(!f)for(f=[],c=a.childNodes||a;null!=(d=c[e]);e++)!b||m.nodeName(d,b)?f.push(d):m.merge(f,ua(d,b));return void 0===b||b&&m.nodeName(a,b)?m.merge([a],f):f}function va(a){W.test(a.type)&&(a.defaultChecked=a.checked)}function wa(a,b){return m.nodeName(a,"table")&&m.nodeName(11!==b.nodeType?b:b.firstChild,"tr")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function xa(a){return a.type=(null!==m.find.attr(a,"type"))+"/"+a.type,a}function ya(a){var b=pa.exec(a.type);return b?a.type=b[1]:a.removeAttribute("type"),a}function za(a,b){for(var c,d=0;null!=(c=a[d]);d++)m._data(c,"globalEval",!b||m._data(b[d],"globalEval"))}function Aa(a,b){if(1===b.nodeType&&m.hasData(a)){var c,d,e,f=m._data(a),g=m._data(b,f),h=f.events;if(h){delete g.handle,g.events={};for(c in h)for(d=0,e=h[c].length;e>d;d++)m.event.add(b,c,h[c][d])}g.data&&(g.data=m.extend({},g.data))}}function Ba(a,b){var c,d,e;if(1===b.nodeType){if(c=b.nodeName.toLowerCase(),!k.noCloneEvent&&b[m.expando]){e=m._data(b);for(d in e.events)m.removeEvent(b,d,e.handle);b.removeAttribute(m.expando)}"script"===c&&b.text!==a.text?(xa(b).text=a.text,ya(b)):"object"===c?(b.parentNode&&(b.outerHTML=a.outerHTML),k.html5Clone&&a.innerHTML&&!m.trim(b.innerHTML)&&(b.innerHTML=a.innerHTML)):"input"===c&&W.test(a.type)?(b.defaultChecked=b.checked=a.checked,b.value!==a.value&&(b.value=a.value)):"option"===c?b.defaultSelected=b.selected=a.defaultSelected:("input"===c||"textarea"===c)&&(b.defaultValue=a.defaultValue)}}m.extend({clone:function(a,b,c){var d,e,f,g,h,i=m.contains(a.ownerDocument,a);if(k.html5Clone||m.isXMLDoc(a)||!ga.test("<"+a.nodeName+">")?f=a.cloneNode(!0):(ta.innerHTML=a.outerHTML,ta.removeChild(f=ta.firstChild)),!(k.noCloneEvent&&k.noCloneChecked||1!==a.nodeType&&11!==a.nodeType||m.isXMLDoc(a)))for(d=ua(f),h=ua(a),g=0;null!=(e=h[g]);++g)d[g]&&Ba(e,d[g]);if(b)if(c)for(h=h||ua(a),d=d||ua(f),g=0;null!=(e=h[g]);g++)Aa(e,d[g]);else Aa(a,f);return d=ua(f,"script"),d.length>0&&za(d,!i&&ua(a,"script")),d=h=e=null,f},buildFragment:function(a,b,c,d){for(var e,f,g,h,i,j,l,n=a.length,o=da(b),p=[],q=0;n>q;q++)if(f=a[q],f||0===f)if("object"===m.type(f))m.merge(p,f.nodeType?[f]:f);else if(la.test(f)){h=h||o.appendChild(b.createElement("div")),i=(ja.exec(f)||["",""])[1].toLowerCase(),l=ra[i]||ra._default,h.innerHTML=l[1]+f.replace(ia,"<$1></$2>")+l[2],e=l[0];while(e--)h=h.lastChild;if(!k.leadingWhitespace&&ha.test(f)&&p.push(b.createTextNode(ha.exec(f)[0])),!k.tbody){f="table"!==i||ka.test(f)?"<table>"!==l[1]||ka.test(f)?0:h:h.firstChild,e=f&&f.childNodes.length;while(e--)m.nodeName(j=f.childNodes[e],"tbody")&&!j.childNodes.length&&f.removeChild(j)}m.merge(p,h.childNodes),h.textContent="";while(h.firstChild)h.removeChild(h.firstChild);h=o.lastChild}else p.push(b.createTextNode(f));h&&o.removeChild(h),k.appendChecked||m.grep(ua(p,"input"),va),q=0;while(f=p[q++])if((!d||-1===m.inArray(f,d))&&(g=m.contains(f.ownerDocument,f),h=ua(o.appendChild(f),"script"),g&&za(h),c)){e=0;while(f=h[e++])oa.test(f.type||"")&&c.push(f)}return h=null,o},cleanData:function(a,b){for(var d,e,f,g,h=0,i=m.expando,j=m.cache,l=k.deleteExpando,n=m.event.special;null!=(d=a[h]);h++)if((b||m.acceptData(d))&&(f=d[i],g=f&&j[f])){if(g.events)for(e in g.events)n[e]?m.event.remove(d,e):m.removeEvent(d,e,g.handle);j[f]&&(delete j[f],l?delete d[i]:typeof d.removeAttribute!==K?d.removeAttribute(i):d[i]=null,c.push(f))}}}),m.fn.extend({text:function(a){return V(this,function(a){return void 0===a?m.text(this):this.empty().append((this[0]&&this[0].ownerDocument||y).createTextNode(a))},null,a,arguments.length)},append:function(){return this.domManip(arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=wa(this,a);b.appendChild(a)}})},prepend:function(){return this.domManip(arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=wa(this,a);b.insertBefore(a,b.firstChild)}})},before:function(){return this.domManip(arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this)})},after:function(){return this.domManip(arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this.nextSibling)})},remove:function(a,b){for(var c,d=a?m.filter(a,this):this,e=0;null!=(c=d[e]);e++)b||1!==c.nodeType||m.cleanData(ua(c)),c.parentNode&&(b&&m.contains(c.ownerDocument,c)&&za(ua(c,"script")),c.parentNode.removeChild(c));return this},empty:function(){for(var a,b=0;null!=(a=this[b]);b++){1===a.nodeType&&m.cleanData(ua(a,!1));while(a.firstChild)a.removeChild(a.firstChild);a.options&&m.nodeName(a,"select")&&(a.options.length=0)}return this},clone:function(a,b){return a=null==a?!1:a,b=null==b?a:b,this.map(function(){return m.clone(this,a,b)})},html:function(a){return V(this,function(a){var b=this[0]||{},c=0,d=this.length;if(void 0===a)return 1===b.nodeType?b.innerHTML.replace(fa,""):void 0;if(!("string"!=typeof a||ma.test(a)||!k.htmlSerialize&&ga.test(a)||!k.leadingWhitespace&&ha.test(a)||ra[(ja.exec(a)||["",""])[1].toLowerCase()])){a=a.replace(ia,"<$1></$2>");try{for(;d>c;c++)b=this[c]||{},1===b.nodeType&&(m.cleanData(ua(b,!1)),b.innerHTML=a);b=0}catch(e){}}b&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(){var a=arguments[0];return this.domManip(arguments,function(b){a=this.parentNode,m.cleanData(ua(this)),a&&a.replaceChild(b,this)}),a&&(a.length||a.nodeType)?this:this.remove()},detach:function(a){return this.remove(a,!0)},domManip:function(a,b){a=e.apply([],a);var c,d,f,g,h,i,j=0,l=this.length,n=this,o=l-1,p=a[0],q=m.isFunction(p);if(q||l>1&&"string"==typeof p&&!k.checkClone&&na.test(p))return this.each(function(c){var d=n.eq(c);q&&(a[0]=p.call(this,c,d.html())),d.domManip(a,b)});if(l&&(i=m.buildFragment(a,this[0].ownerDocument,!1,this),c=i.firstChild,1===i.childNodes.length&&(i=c),c)){for(g=m.map(ua(i,"script"),xa),f=g.length;l>j;j++)d=i,j!==o&&(d=m.clone(d,!0,!0),f&&m.merge(g,ua(d,"script"))),b.call(this[j],d,j);if(f)for(h=g[g.length-1].ownerDocument,m.map(g,ya),j=0;f>j;j++)d=g[j],oa.test(d.type||"")&&!m._data(d,"globalEval")&&m.contains(h,d)&&(d.src?m._evalUrl&&m._evalUrl(d.src):m.globalEval((d.text||d.textContent||d.innerHTML||"").replace(qa,"")));i=c=null}return this}}),m.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){m.fn[a]=function(a){for(var c,d=0,e=[],g=m(a),h=g.length-1;h>=d;d++)c=d===h?this:this.clone(!0),m(g[d])[b](c),f.apply(e,c.get());return this.pushStack(e)}});var Ca,Da={};function Ea(b,c){var d,e=m(c.createElement(b)).appendTo(c.body),f=a.getDefaultComputedStyle&&(d=a.getDefaultComputedStyle(e[0]))?d.display:m.css(e[0],"display");return e.detach(),f}function Fa(a){var b=y,c=Da[a];return c||(c=Ea(a,b),"none"!==c&&c||(Ca=(Ca||m("<iframe frameborder='0' width='0' height='0'/>")).appendTo(b.documentElement),b=(Ca[0].contentWindow||Ca[0].contentDocument).document,b.write(),b.close(),c=Ea(a,b),Ca.detach()),Da[a]=c),c}!function(){var a;k.shrinkWrapBlocks=function(){if(null!=a)return a;a=!1;var b,c,d;return c=y.getElementsByTagName("body")[0],c&&c.style?(b=y.createElement("div"),d=y.createElement("div"),d.style.cssText="position:absolute;border:0;width:0;height:0;top:0;left:-9999px",c.appendChild(d).appendChild(b),typeof b.style.zoom!==K&&(b.style.cssText="-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;display:block;margin:0;border:0;padding:1px;width:1px;zoom:1",b.appendChild(y.createElement("div")).style.width="5px",a=3!==b.offsetWidth),c.removeChild(d),a):void 0}}();var Ga=/^margin/,Ha=new RegExp("^("+S+")(?!px)[a-z%]+$","i"),Ia,Ja,Ka=/^(top|right|bottom|left)$/;a.getComputedStyle?(Ia=function(b){return b.ownerDocument.defaultView.opener?b.ownerDocument.defaultView.getComputedStyle(b,null):a.getComputedStyle(b,null)},Ja=function(a,b,c){var d,e,f,g,h=a.style;return c=c||Ia(a),g=c?c.getPropertyValue(b)||c[b]:void 0,c&&(""!==g||m.contains(a.ownerDocument,a)||(g=m.style(a,b)),Ha.test(g)&&Ga.test(b)&&(d=h.width,e=h.minWidth,f=h.maxWidth,h.minWidth=h.maxWidth=h.width=g,g=c.width,h.width=d,h.minWidth=e,h.maxWidth=f)),void 0===g?g:g+""}):y.documentElement.currentStyle&&(Ia=function(a){return a.currentStyle},Ja=function(a,b,c){var d,e,f,g,h=a.style;return c=c||Ia(a),g=c?c[b]:void 0,null==g&&h&&h[b]&&(g=h[b]),Ha.test(g)&&!Ka.test(b)&&(d=h.left,e=a.runtimeStyle,f=e&&e.left,f&&(e.left=a.currentStyle.left),h.left="fontSize"===b?"1em":g,g=h.pixelLeft+"px",h.left=d,f&&(e.left=f)),void 0===g?g:g+""||"auto"});function La(a,b){return{get:function(){var c=a();if(null!=c)return c?void delete this.get:(this.get=b).apply(this,arguments)}}}!function(){var b,c,d,e,f,g,h;if(b=y.createElement("div"),b.innerHTML=" <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",d=b.getElementsByTagName("a")[0],c=d&&d.style){c.cssText="float:left;opacity:.5",k.opacity="0.5"===c.opacity,k.cssFloat=!!c.cssFloat,b.style.backgroundClip="content-box",b.cloneNode(!0).style.backgroundClip="",k.clearCloneStyle="content-box"===b.style.backgroundClip,k.boxSizing=""===c.boxSizing||""===c.MozBoxSizing||""===c.WebkitBoxSizing,m.extend(k,{reliableHiddenOffsets:function(){return null==g&&i(),g},boxSizingReliable:function(){return null==f&&i(),f},pixelPosition:function(){return null==e&&i(),e},reliableMarginRight:function(){return null==h&&i(),h}});function i(){var b,c,d,i;c=y.getElementsByTagName("body")[0],c&&c.style&&(b=y.createElement("div"),d=y.createElement("div"),d.style.cssText="position:absolute;border:0;width:0;height:0;top:0;left:-9999px",c.appendChild(d).appendChild(b),b.style.cssText="-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;display:block;margin-top:1%;top:1%;border:1px;padding:1px;width:4px;position:absolute",e=f=!1,h=!0,a.getComputedStyle&&(e="1%"!==(a.getComputedStyle(b,null)||{}).top,f="4px"===(a.getComputedStyle(b,null)||{width:"4px"}).width,i=b.appendChild(y.createElement("div")),i.style.cssText=b.style.cssText="-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;display:block;margin:0;border:0;padding:0",i.style.marginRight=i.style.width="0",b.style.width="1px",h=!parseFloat((a.getComputedStyle(i,null)||{}).marginRight),b.removeChild(i)),b.innerHTML="<table><tr><td></td><td>t</td></tr></table>",i=b.getElementsByTagName("td"),i[0].style.cssText="margin:0;border:0;padding:0;display:none",g=0===i[0].offsetHeight,g&&(i[0].style.display="",i[1].style.display="none",g=0===i[0].offsetHeight),c.removeChild(d))}}}(),m.swap=function(a,b,c,d){var e,f,g={};for(f in b)g[f]=a.style[f],a.style[f]=b[f];e=c.apply(a,d||[]);for(f in b)a.style[f]=g[f];return e};var Ma=/alpha\([^)]*\)/i,Na=/opacity\s*=\s*([^)]*)/,Oa=/^(none|table(?!-c[ea]).+)/,Pa=new RegExp("^("+S+")(.*)$","i"),Qa=new RegExp("^([+-])=("+S+")","i"),Ra={position:"absolute",visibility:"hidden",display:"block"},Sa={letterSpacing:"0",fontWeight:"400"},Ta=["Webkit","O","Moz","ms"];function Ua(a,b){if(b in a)return b;var c=b.charAt(0).toUpperCase()+b.slice(1),d=b,e=Ta.length;while(e--)if(b=Ta[e]+c,b in a)return b;return d}function Va(a,b){for(var c,d,e,f=[],g=0,h=a.length;h>g;g++)d=a[g],d.style&&(f[g]=m._data(d,"olddisplay"),c=d.style.display,b?(f[g]||"none"!==c||(d.style.display=""),""===d.style.display&&U(d)&&(f[g]=m._data(d,"olddisplay",Fa(d.nodeName)))):(e=U(d),(c&&"none"!==c||!e)&&m._data(d,"olddisplay",e?c:m.css(d,"display"))));for(g=0;h>g;g++)d=a[g],d.style&&(b&&"none"!==d.style.display&&""!==d.style.display||(d.style.display=b?f[g]||"":"none"));return a}function Wa(a,b,c){var d=Pa.exec(b);return d?Math.max(0,d[1]-(c||0))+(d[2]||"px"):b}function Xa(a,b,c,d,e){for(var f=c===(d?"border":"content")?4:"width"===b?1:0,g=0;4>f;f+=2)"margin"===c&&(g+=m.css(a,c+T[f],!0,e)),d?("content"===c&&(g-=m.css(a,"padding"+T[f],!0,e)),"margin"!==c&&(g-=m.css(a,"border"+T[f]+"Width",!0,e))):(g+=m.css(a,"padding"+T[f],!0,e),"padding"!==c&&(g+=m.css(a,"border"+T[f]+"Width",!0,e)));return g}function Ya(a,b,c){var d=!0,e="width"===b?a.offsetWidth:a.offsetHeight,f=Ia(a),g=k.boxSizing&&"border-box"===m.css(a,"boxSizing",!1,f);if(0>=e||null==e){if(e=Ja(a,b,f),(0>e||null==e)&&(e=a.style[b]),Ha.test(e))return e;d=g&&(k.boxSizingReliable()||e===a.style[b]),e=parseFloat(e)||0}return e+Xa(a,b,c||(g?"border":"content"),d,f)+"px"}m.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=Ja(a,"opacity");return""===c?"1":c}}}},cssNumber:{columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":k.cssFloat?"cssFloat":"styleFloat"},style:function(a,b,c,d){if(a&&3!==a.nodeType&&8!==a.nodeType&&a.style){var e,f,g,h=m.camelCase(b),i=a.style;if(b=m.cssProps[h]||(m.cssProps[h]=Ua(i,h)),g=m.cssHooks[b]||m.cssHooks[h],void 0===c)return g&&"get"in g&&void 0!==(e=g.get(a,!1,d))?e:i[b];if(f=typeof c,"string"===f&&(e=Qa.exec(c))&&(c=(e[1]+1)*e[2]+parseFloat(m.css(a,b)),f="number"),null!=c&&c===c&&("number"!==f||m.cssNumber[h]||(c+="px"),k.clearCloneStyle||""!==c||0!==b.indexOf("background")||(i[b]="inherit"),!(g&&"set"in g&&void 0===(c=g.set(a,c,d)))))try{i[b]=c}catch(j){}}},css:function(a,b,c,d){var e,f,g,h=m.camelCase(b);return b=m.cssProps[h]||(m.cssProps[h]=Ua(a.style,h)),g=m.cssHooks[b]||m.cssHooks[h],g&&"get"in g&&(f=g.get(a,!0,c)),void 0===f&&(f=Ja(a,b,d)),"normal"===f&&b in Sa&&(f=Sa[b]),""===c||c?(e=parseFloat(f),c===!0||m.isNumeric(e)?e||0:f):f}}),m.each(["height","width"],function(a,b){m.cssHooks[b]={get:function(a,c,d){return c?Oa.test(m.css(a,"display"))&&0===a.offsetWidth?m.swap(a,Ra,function(){return Ya(a,b,d)}):Ya(a,b,d):void 0},set:function(a,c,d){var e=d&&Ia(a);return Wa(a,c,d?Xa(a,b,d,k.boxSizing&&"border-box"===m.css(a,"boxSizing",!1,e),e):0)}}}),k.opacity||(m.cssHooks.opacity={get:function(a,b){return Na.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?.01*parseFloat(RegExp.$1)+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=m.isNumeric(b)?"alpha(opacity="+100*b+")":"",f=d&&d.filter||c.filter||"";c.zoom=1,(b>=1||""===b)&&""===m.trim(f.replace(Ma,""))&&c.removeAttribute&&(c.removeAttribute("filter"),""===b||d&&!d.filter)||(c.filter=Ma.test(f)?f.replace(Ma,e):f+" "+e)}}),m.cssHooks.marginRight=La(k.reliableMarginRight,function(a,b){return b?m.swap(a,{display:"inline-block"},Ja,[a,"marginRight"]):void 0}),m.each({margin:"",padding:"",border:"Width"},function(a,b){m.cssHooks[a+b]={expand:function(c){for(var d=0,e={},f="string"==typeof c?c.split(" "):[c];4>d;d++)e[a+T[d]+b]=f[d]||f[d-2]||f[0];return e}},Ga.test(a)||(m.cssHooks[a+b].set=Wa)}),m.fn.extend({css:function(a,b){return V(this,function(a,b,c){var d,e,f={},g=0;if(m.isArray(b)){for(d=Ia(a),e=b.length;e>g;g++)f[b[g]]=m.css(a,b[g],!1,d);return f}return void 0!==c?m.style(a,b,c):m.css(a,b)},a,b,arguments.length>1)},show:function(){return Va(this,!0)},hide:function(){return Va(this)},toggle:function(a){return"boolean"==typeof a?a?this.show():this.hide():this.each(function(){U(this)?m(this).show():m(this).hide()})}});function Za(a,b,c,d,e){
return new Za.prototype.init(a,b,c,d,e)}m.Tween=Za,Za.prototype={constructor:Za,init:function(a,b,c,d,e,f){this.elem=a,this.prop=c,this.easing=e||"swing",this.options=b,this.start=this.now=this.cur(),this.end=d,this.unit=f||(m.cssNumber[c]?"":"px")},cur:function(){var a=Za.propHooks[this.prop];return a&&a.get?a.get(this):Za.propHooks._default.get(this)},run:function(a){var b,c=Za.propHooks[this.prop];return this.options.duration?this.pos=b=m.easing[this.easing](a,this.options.duration*a,0,1,this.options.duration):this.pos=b=a,this.now=(this.end-this.start)*b+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),c&&c.set?c.set(this):Za.propHooks._default.set(this),this}},Za.prototype.init.prototype=Za.prototype,Za.propHooks={_default:{get:function(a){var b;return null==a.elem[a.prop]||a.elem.style&&null!=a.elem.style[a.prop]?(b=m.css(a.elem,a.prop,""),b&&"auto"!==b?b:0):a.elem[a.prop]},set:function(a){m.fx.step[a.prop]?m.fx.step[a.prop](a):a.elem.style&&(null!=a.elem.style[m.cssProps[a.prop]]||m.cssHooks[a.prop])?m.style(a.elem,a.prop,a.now+a.unit):a.elem[a.prop]=a.now}}},Za.propHooks.scrollTop=Za.propHooks.scrollLeft={set:function(a){a.elem.nodeType&&a.elem.parentNode&&(a.elem[a.prop]=a.now)}},m.easing={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2}},m.fx=Za.prototype.init,m.fx.step={};var $a,_a,ab=/^(?:toggle|show|hide)$/,bb=new RegExp("^(?:([+-])=|)("+S+")([a-z%]*)$","i"),cb=/queueHooks$/,db=[ib],eb={"*":[function(a,b){var c=this.createTween(a,b),d=c.cur(),e=bb.exec(b),f=e&&e[3]||(m.cssNumber[a]?"":"px"),g=(m.cssNumber[a]||"px"!==f&&+d)&&bb.exec(m.css(c.elem,a)),h=1,i=20;if(g&&g[3]!==f){f=f||g[3],e=e||[],g=+d||1;do h=h||".5",g/=h,m.style(c.elem,a,g+f);while(h!==(h=c.cur()/d)&&1!==h&&--i)}return e&&(g=c.start=+g||+d||0,c.unit=f,c.end=e[1]?g+(e[1]+1)*e[2]:+e[2]),c}]};function fb(){return setTimeout(function(){$a=void 0}),$a=m.now()}function gb(a,b){var c,d={height:a},e=0;for(b=b?1:0;4>e;e+=2-b)c=T[e],d["margin"+c]=d["padding"+c]=a;return b&&(d.opacity=d.width=a),d}function hb(a,b,c){for(var d,e=(eb[b]||[]).concat(eb["*"]),f=0,g=e.length;g>f;f++)if(d=e[f].call(c,b,a))return d}function ib(a,b,c){var d,e,f,g,h,i,j,l,n=this,o={},p=a.style,q=a.nodeType&&U(a),r=m._data(a,"fxshow");c.queue||(h=m._queueHooks(a,"fx"),null==h.unqueued&&(h.unqueued=0,i=h.empty.fire,h.empty.fire=function(){h.unqueued||i()}),h.unqueued++,n.always(function(){n.always(function(){h.unqueued--,m.queue(a,"fx").length||h.empty.fire()})})),1===a.nodeType&&("height"in b||"width"in b)&&(c.overflow=[p.overflow,p.overflowX,p.overflowY],j=m.css(a,"display"),l="none"===j?m._data(a,"olddisplay")||Fa(a.nodeName):j,"inline"===l&&"none"===m.css(a,"float")&&(k.inlineBlockNeedsLayout&&"inline"!==Fa(a.nodeName)?p.zoom=1:p.display="inline-block")),c.overflow&&(p.overflow="hidden",k.shrinkWrapBlocks()||n.always(function(){p.overflow=c.overflow[0],p.overflowX=c.overflow[1],p.overflowY=c.overflow[2]}));for(d in b)if(e=b[d],ab.exec(e)){if(delete b[d],f=f||"toggle"===e,e===(q?"hide":"show")){if("show"!==e||!r||void 0===r[d])continue;q=!0}o[d]=r&&r[d]||m.style(a,d)}else j=void 0;if(m.isEmptyObject(o))"inline"===("none"===j?Fa(a.nodeName):j)&&(p.display=j);else{r?"hidden"in r&&(q=r.hidden):r=m._data(a,"fxshow",{}),f&&(r.hidden=!q),q?m(a).show():n.done(function(){m(a).hide()}),n.done(function(){var b;m._removeData(a,"fxshow");for(b in o)m.style(a,b,o[b])});for(d in o)g=hb(q?r[d]:0,d,n),d in r||(r[d]=g.start,q&&(g.end=g.start,g.start="width"===d||"height"===d?1:0))}}function jb(a,b){var c,d,e,f,g;for(c in a)if(d=m.camelCase(c),e=b[d],f=a[c],m.isArray(f)&&(e=f[1],f=a[c]=f[0]),c!==d&&(a[d]=f,delete a[c]),g=m.cssHooks[d],g&&"expand"in g){f=g.expand(f),delete a[d];for(c in f)c in a||(a[c]=f[c],b[c]=e)}else b[d]=e}function kb(a,b,c){var d,e,f=0,g=db.length,h=m.Deferred().always(function(){delete i.elem}),i=function(){if(e)return!1;for(var b=$a||fb(),c=Math.max(0,j.startTime+j.duration-b),d=c/j.duration||0,f=1-d,g=0,i=j.tweens.length;i>g;g++)j.tweens[g].run(f);return h.notifyWith(a,[j,f,c]),1>f&&i?c:(h.resolveWith(a,[j]),!1)},j=h.promise({elem:a,props:m.extend({},b),opts:m.extend(!0,{specialEasing:{}},c),originalProperties:b,originalOptions:c,startTime:$a||fb(),duration:c.duration,tweens:[],createTween:function(b,c){var d=m.Tween(a,j.opts,b,c,j.opts.specialEasing[b]||j.opts.easing);return j.tweens.push(d),d},stop:function(b){var c=0,d=b?j.tweens.length:0;if(e)return this;for(e=!0;d>c;c++)j.tweens[c].run(1);return b?h.resolveWith(a,[j,b]):h.rejectWith(a,[j,b]),this}}),k=j.props;for(jb(k,j.opts.specialEasing);g>f;f++)if(d=db[f].call(j,a,k,j.opts))return d;return m.map(k,hb,j),m.isFunction(j.opts.start)&&j.opts.start.call(a,j),m.fx.timer(m.extend(i,{elem:a,anim:j,queue:j.opts.queue})),j.progress(j.opts.progress).done(j.opts.done,j.opts.complete).fail(j.opts.fail).always(j.opts.always)}m.Animation=m.extend(kb,{tweener:function(a,b){m.isFunction(a)?(b=a,a=["*"]):a=a.split(" ");for(var c,d=0,e=a.length;e>d;d++)c=a[d],eb[c]=eb[c]||[],eb[c].unshift(b)},prefilter:function(a,b){b?db.unshift(a):db.push(a)}}),m.speed=function(a,b,c){var d=a&&"object"==typeof a?m.extend({},a):{complete:c||!c&&b||m.isFunction(a)&&a,duration:a,easing:c&&b||b&&!m.isFunction(b)&&b};return d.duration=m.fx.off?0:"number"==typeof d.duration?d.duration:d.duration in m.fx.speeds?m.fx.speeds[d.duration]:m.fx.speeds._default,(null==d.queue||d.queue===!0)&&(d.queue="fx"),d.old=d.complete,d.complete=function(){m.isFunction(d.old)&&d.old.call(this),d.queue&&m.dequeue(this,d.queue)},d},m.fn.extend({fadeTo:function(a,b,c,d){return this.filter(U).css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=m.isEmptyObject(a),f=m.speed(b,c,d),g=function(){var b=kb(this,m.extend({},a),f);(e||m._data(this,"finish"))&&b.stop(!0)};return g.finish=g,e||f.queue===!1?this.each(g):this.queue(f.queue,g)},stop:function(a,b,c){var d=function(a){var b=a.stop;delete a.stop,b(c)};return"string"!=typeof a&&(c=b,b=a,a=void 0),b&&a!==!1&&this.queue(a||"fx",[]),this.each(function(){var b=!0,e=null!=a&&a+"queueHooks",f=m.timers,g=m._data(this);if(e)g[e]&&g[e].stop&&d(g[e]);else for(e in g)g[e]&&g[e].stop&&cb.test(e)&&d(g[e]);for(e=f.length;e--;)f[e].elem!==this||null!=a&&f[e].queue!==a||(f[e].anim.stop(c),b=!1,f.splice(e,1));(b||!c)&&m.dequeue(this,a)})},finish:function(a){return a!==!1&&(a=a||"fx"),this.each(function(){var b,c=m._data(this),d=c[a+"queue"],e=c[a+"queueHooks"],f=m.timers,g=d?d.length:0;for(c.finish=!0,m.queue(this,a,[]),e&&e.stop&&e.stop.call(this,!0),b=f.length;b--;)f[b].elem===this&&f[b].queue===a&&(f[b].anim.stop(!0),f.splice(b,1));for(b=0;g>b;b++)d[b]&&d[b].finish&&d[b].finish.call(this);delete c.finish})}}),m.each(["toggle","show","hide"],function(a,b){var c=m.fn[b];m.fn[b]=function(a,d,e){return null==a||"boolean"==typeof a?c.apply(this,arguments):this.animate(gb(b,!0),a,d,e)}}),m.each({slideDown:gb("show"),slideUp:gb("hide"),slideToggle:gb("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){m.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),m.timers=[],m.fx.tick=function(){var a,b=m.timers,c=0;for($a=m.now();c<b.length;c++)a=b[c],a()||b[c]!==a||b.splice(c--,1);b.length||m.fx.stop(),$a=void 0},m.fx.timer=function(a){m.timers.push(a),a()?m.fx.start():m.timers.pop()},m.fx.interval=13,m.fx.start=function(){_a||(_a=setInterval(m.fx.tick,m.fx.interval))},m.fx.stop=function(){clearInterval(_a),_a=null},m.fx.speeds={slow:600,fast:200,_default:400},m.fn.delay=function(a,b){return a=m.fx?m.fx.speeds[a]||a:a,b=b||"fx",this.queue(b,function(b,c){var d=setTimeout(b,a);c.stop=function(){clearTimeout(d)}})},function(){var a,b,c,d,e;b=y.createElement("div"),b.setAttribute("className","t"),b.innerHTML=" <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",d=b.getElementsByTagName("a")[0],c=y.createElement("select"),e=c.appendChild(y.createElement("option")),a=b.getElementsByTagName("input")[0],d.style.cssText="top:1px",k.getSetAttribute="t"!==b.className,k.style=/top/.test(d.getAttribute("style")),k.hrefNormalized="/a"===d.getAttribute("href"),k.checkOn=!!a.value,k.optSelected=e.selected,k.enctype=!!y.createElement("form").enctype,c.disabled=!0,k.optDisabled=!e.disabled,a=y.createElement("input"),a.setAttribute("value",""),k.input=""===a.getAttribute("value"),a.value="t",a.setAttribute("type","radio"),k.radioValue="t"===a.value}();var lb=/\r/g;m.fn.extend({val:function(a){var b,c,d,e=this[0];{if(arguments.length)return d=m.isFunction(a),this.each(function(c){var e;1===this.nodeType&&(e=d?a.call(this,c,m(this).val()):a,null==e?e="":"number"==typeof e?e+="":m.isArray(e)&&(e=m.map(e,function(a){return null==a?"":a+""})),b=m.valHooks[this.type]||m.valHooks[this.nodeName.toLowerCase()],b&&"set"in b&&void 0!==b.set(this,e,"value")||(this.value=e))});if(e)return b=m.valHooks[e.type]||m.valHooks[e.nodeName.toLowerCase()],b&&"get"in b&&void 0!==(c=b.get(e,"value"))?c:(c=e.value,"string"==typeof c?c.replace(lb,""):null==c?"":c)}}}),m.extend({valHooks:{option:{get:function(a){var b=m.find.attr(a,"value");return null!=b?b:m.trim(m.text(a))}},select:{get:function(a){for(var b,c,d=a.options,e=a.selectedIndex,f="select-one"===a.type||0>e,g=f?null:[],h=f?e+1:d.length,i=0>e?h:f?e:0;h>i;i++)if(c=d[i],!(!c.selected&&i!==e||(k.optDisabled?c.disabled:null!==c.getAttribute("disabled"))||c.parentNode.disabled&&m.nodeName(c.parentNode,"optgroup"))){if(b=m(c).val(),f)return b;g.push(b)}return g},set:function(a,b){var c,d,e=a.options,f=m.makeArray(b),g=e.length;while(g--)if(d=e[g],m.inArray(m.valHooks.option.get(d),f)>=0)try{d.selected=c=!0}catch(h){d.scrollHeight}else d.selected=!1;return c||(a.selectedIndex=-1),e}}}}),m.each(["radio","checkbox"],function(){m.valHooks[this]={set:function(a,b){return m.isArray(b)?a.checked=m.inArray(m(a).val(),b)>=0:void 0}},k.checkOn||(m.valHooks[this].get=function(a){return null===a.getAttribute("value")?"on":a.value})});var mb,nb,ob=m.expr.attrHandle,pb=/^(?:checked|selected)$/i,qb=k.getSetAttribute,rb=k.input;m.fn.extend({attr:function(a,b){return V(this,m.attr,a,b,arguments.length>1)},removeAttr:function(a){return this.each(function(){m.removeAttr(this,a)})}}),m.extend({attr:function(a,b,c){var d,e,f=a.nodeType;if(a&&3!==f&&8!==f&&2!==f)return typeof a.getAttribute===K?m.prop(a,b,c):(1===f&&m.isXMLDoc(a)||(b=b.toLowerCase(),d=m.attrHooks[b]||(m.expr.match.bool.test(b)?nb:mb)),void 0===c?d&&"get"in d&&null!==(e=d.get(a,b))?e:(e=m.find.attr(a,b),null==e?void 0:e):null!==c?d&&"set"in d&&void 0!==(e=d.set(a,c,b))?e:(a.setAttribute(b,c+""),c):void m.removeAttr(a,b))},removeAttr:function(a,b){var c,d,e=0,f=b&&b.match(E);if(f&&1===a.nodeType)while(c=f[e++])d=m.propFix[c]||c,m.expr.match.bool.test(c)?rb&&qb||!pb.test(c)?a[d]=!1:a[m.camelCase("default-"+c)]=a[d]=!1:m.attr(a,c,""),a.removeAttribute(qb?c:d)},attrHooks:{type:{set:function(a,b){if(!k.radioValue&&"radio"===b&&m.nodeName(a,"input")){var c=a.value;return a.setAttribute("type",b),c&&(a.value=c),b}}}}}),nb={set:function(a,b,c){return b===!1?m.removeAttr(a,c):rb&&qb||!pb.test(c)?a.setAttribute(!qb&&m.propFix[c]||c,c):a[m.camelCase("default-"+c)]=a[c]=!0,c}},m.each(m.expr.match.bool.source.match(/\w+/g),function(a,b){var c=ob[b]||m.find.attr;ob[b]=rb&&qb||!pb.test(b)?function(a,b,d){var e,f;return d||(f=ob[b],ob[b]=e,e=null!=c(a,b,d)?b.toLowerCase():null,ob[b]=f),e}:function(a,b,c){return c?void 0:a[m.camelCase("default-"+b)]?b.toLowerCase():null}}),rb&&qb||(m.attrHooks.value={set:function(a,b,c){return m.nodeName(a,"input")?void(a.defaultValue=b):mb&&mb.set(a,b,c)}}),qb||(mb={set:function(a,b,c){var d=a.getAttributeNode(c);return d||a.setAttributeNode(d=a.ownerDocument.createAttribute(c)),d.value=b+="","value"===c||b===a.getAttribute(c)?b:void 0}},ob.id=ob.name=ob.coords=function(a,b,c){var d;return c?void 0:(d=a.getAttributeNode(b))&&""!==d.value?d.value:null},m.valHooks.button={get:function(a,b){var c=a.getAttributeNode(b);return c&&c.specified?c.value:void 0},set:mb.set},m.attrHooks.contenteditable={set:function(a,b,c){mb.set(a,""===b?!1:b,c)}},m.each(["width","height"],function(a,b){m.attrHooks[b]={set:function(a,c){return""===c?(a.setAttribute(b,"auto"),c):void 0}}})),k.style||(m.attrHooks.style={get:function(a){return a.style.cssText||void 0},set:function(a,b){return a.style.cssText=b+""}});var sb=/^(?:input|select|textarea|button|object)$/i,tb=/^(?:a|area)$/i;m.fn.extend({prop:function(a,b){return V(this,m.prop,a,b,arguments.length>1)},removeProp:function(a){return a=m.propFix[a]||a,this.each(function(){try{this[a]=void 0,delete this[a]}catch(b){}})}}),m.extend({propFix:{"for":"htmlFor","class":"className"},prop:function(a,b,c){var d,e,f,g=a.nodeType;if(a&&3!==g&&8!==g&&2!==g)return f=1!==g||!m.isXMLDoc(a),f&&(b=m.propFix[b]||b,e=m.propHooks[b]),void 0!==c?e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:a[b]=c:e&&"get"in e&&null!==(d=e.get(a,b))?d:a[b]},propHooks:{tabIndex:{get:function(a){var b=m.find.attr(a,"tabindex");return b?parseInt(b,10):sb.test(a.nodeName)||tb.test(a.nodeName)&&a.href?0:-1}}}}),k.hrefNormalized||m.each(["href","src"],function(a,b){m.propHooks[b]={get:function(a){return a.getAttribute(b,4)}}}),k.optSelected||(m.propHooks.selected={get:function(a){var b=a.parentNode;return b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex),null}}),m.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){m.propFix[this.toLowerCase()]=this}),k.enctype||(m.propFix.enctype="encoding");var ub=/[\t\r\n\f]/g;m.fn.extend({addClass:function(a){var b,c,d,e,f,g,h=0,i=this.length,j="string"==typeof a&&a;if(m.isFunction(a))return this.each(function(b){m(this).addClass(a.call(this,b,this.className))});if(j)for(b=(a||"").match(E)||[];i>h;h++)if(c=this[h],d=1===c.nodeType&&(c.className?(" "+c.className+" ").replace(ub," "):" ")){f=0;while(e=b[f++])d.indexOf(" "+e+" ")<0&&(d+=e+" ");g=m.trim(d),c.className!==g&&(c.className=g)}return this},removeClass:function(a){var b,c,d,e,f,g,h=0,i=this.length,j=0===arguments.length||"string"==typeof a&&a;if(m.isFunction(a))return this.each(function(b){m(this).removeClass(a.call(this,b,this.className))});if(j)for(b=(a||"").match(E)||[];i>h;h++)if(c=this[h],d=1===c.nodeType&&(c.className?(" "+c.className+" ").replace(ub," "):"")){f=0;while(e=b[f++])while(d.indexOf(" "+e+" ")>=0)d=d.replace(" "+e+" "," ");g=a?m.trim(d):"",c.className!==g&&(c.className=g)}return this},toggleClass:function(a,b){var c=typeof a;return"boolean"==typeof b&&"string"===c?b?this.addClass(a):this.removeClass(a):this.each(m.isFunction(a)?function(c){m(this).toggleClass(a.call(this,c,this.className,b),b)}:function(){if("string"===c){var b,d=0,e=m(this),f=a.match(E)||[];while(b=f[d++])e.hasClass(b)?e.removeClass(b):e.addClass(b)}else(c===K||"boolean"===c)&&(this.className&&m._data(this,"__className__",this.className),this.className=this.className||a===!1?"":m._data(this,"__className__")||"")})},hasClass:function(a){for(var b=" "+a+" ",c=0,d=this.length;d>c;c++)if(1===this[c].nodeType&&(" "+this[c].className+" ").replace(ub," ").indexOf(b)>=0)return!0;return!1}}),m.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){m.fn[b]=function(a,c){return arguments.length>0?this.on(b,null,a,c):this.trigger(b)}}),m.fn.extend({hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)},bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return 1===arguments.length?this.off(a,"**"):this.off(b,a||"**",c)}});var vb=m.now(),wb=/\?/,xb=/(,)|(\[|{)|(}|])|"(?:[^"\\\r\n]|\\["\\\/bfnrt]|\\u[\da-fA-F]{4})*"\s*:?|true|false|null|-?(?!0\d)\d+(?:\.\d+|)(?:[eE][+-]?\d+|)/g;m.parseJSON=function(b){if(a.JSON&&a.JSON.parse)return a.JSON.parse(b+"");var c,d=null,e=m.trim(b+"");return e&&!m.trim(e.replace(xb,function(a,b,e,f){return c&&b&&(d=0),0===d?a:(c=e||b,d+=!f-!e,"")}))?Function("return "+e)():m.error("Invalid JSON: "+b)},m.parseXML=function(b){var c,d;if(!b||"string"!=typeof b)return null;try{a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b))}catch(e){c=void 0}return c&&c.documentElement&&!c.getElementsByTagName("parsererror").length||m.error("Invalid XML: "+b),c};var yb,zb,Ab=/#.*$/,Bb=/([?&])_=[^&]*/,Cb=/^(.*?):[ \t]*([^\r\n]*)\r?$/gm,Db=/^(?:about|app|app-storage|.+-extension|file|res|widget):$/,Eb=/^(?:GET|HEAD)$/,Fb=/^\/\//,Gb=/^([\w.+-]+:)(?:\/\/(?:[^\/?#]*@|)([^\/?#:]*)(?::(\d+)|)|)/,Hb={},Ib={},Jb="*/".concat("*");try{zb=location.href}catch(Kb){zb=y.createElement("a"),zb.href="",zb=zb.href}yb=Gb.exec(zb.toLowerCase())||[];function Lb(a){return function(b,c){"string"!=typeof b&&(c=b,b="*");var d,e=0,f=b.toLowerCase().match(E)||[];if(m.isFunction(c))while(d=f[e++])"+"===d.charAt(0)?(d=d.slice(1)||"*",(a[d]=a[d]||[]).unshift(c)):(a[d]=a[d]||[]).push(c)}}function Mb(a,b,c,d){var e={},f=a===Ib;function g(h){var i;return e[h]=!0,m.each(a[h]||[],function(a,h){var j=h(b,c,d);return"string"!=typeof j||f||e[j]?f?!(i=j):void 0:(b.dataTypes.unshift(j),g(j),!1)}),i}return g(b.dataTypes[0])||!e["*"]&&g("*")}function Nb(a,b){var c,d,e=m.ajaxSettings.flatOptions||{};for(d in b)void 0!==b[d]&&((e[d]?a:c||(c={}))[d]=b[d]);return c&&m.extend(!0,a,c),a}function Ob(a,b,c){var d,e,f,g,h=a.contents,i=a.dataTypes;while("*"===i[0])i.shift(),void 0===e&&(e=a.mimeType||b.getResponseHeader("Content-Type"));if(e)for(g in h)if(h[g]&&h[g].test(e)){i.unshift(g);break}if(i[0]in c)f=i[0];else{for(g in c){if(!i[0]||a.converters[g+" "+i[0]]){f=g;break}d||(d=g)}f=f||d}return f?(f!==i[0]&&i.unshift(f),c[f]):void 0}function Pb(a,b,c,d){var e,f,g,h,i,j={},k=a.dataTypes.slice();if(k[1])for(g in a.converters)j[g.toLowerCase()]=a.converters[g];f=k.shift();while(f)if(a.responseFields[f]&&(c[a.responseFields[f]]=b),!i&&d&&a.dataFilter&&(b=a.dataFilter(b,a.dataType)),i=f,f=k.shift())if("*"===f)f=i;else if("*"!==i&&i!==f){if(g=j[i+" "+f]||j["* "+f],!g)for(e in j)if(h=e.split(" "),h[1]===f&&(g=j[i+" "+h[0]]||j["* "+h[0]])){g===!0?g=j[e]:j[e]!==!0&&(f=h[0],k.unshift(h[1]));break}if(g!==!0)if(g&&a["throws"])b=g(b);else try{b=g(b)}catch(l){return{state:"parsererror",error:g?l:"No conversion from "+i+" to "+f}}}return{state:"success",data:b}}m.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:zb,type:"GET",isLocal:Db.test(yb[1]),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":Jb,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":m.parseJSON,"text xml":m.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(a,b){return b?Nb(Nb(a,m.ajaxSettings),b):Nb(m.ajaxSettings,a)},ajaxPrefilter:Lb(Hb),ajaxTransport:Lb(Ib),ajax:function(a,b){"object"==typeof a&&(b=a,a=void 0),b=b||{};var c,d,e,f,g,h,i,j,k=m.ajaxSetup({},b),l=k.context||k,n=k.context&&(l.nodeType||l.jquery)?m(l):m.event,o=m.Deferred(),p=m.Callbacks("once memory"),q=k.statusCode||{},r={},s={},t=0,u="canceled",v={readyState:0,getResponseHeader:function(a){var b;if(2===t){if(!j){j={};while(b=Cb.exec(f))j[b[1].toLowerCase()]=b[2]}b=j[a.toLowerCase()]}return null==b?null:b},getAllResponseHeaders:function(){return 2===t?f:null},setRequestHeader:function(a,b){var c=a.toLowerCase();return t||(a=s[c]=s[c]||a,r[a]=b),this},overrideMimeType:function(a){return t||(k.mimeType=a),this},statusCode:function(a){var b;if(a)if(2>t)for(b in a)q[b]=[q[b],a[b]];else v.always(a[v.status]);return this},abort:function(a){var b=a||u;return i&&i.abort(b),x(0,b),this}};if(o.promise(v).complete=p.add,v.success=v.done,v.error=v.fail,k.url=((a||k.url||zb)+"").replace(Ab,"").replace(Fb,yb[1]+"//"),k.type=b.method||b.type||k.method||k.type,k.dataTypes=m.trim(k.dataType||"*").toLowerCase().match(E)||[""],null==k.crossDomain&&(c=Gb.exec(k.url.toLowerCase()),k.crossDomain=!(!c||c[1]===yb[1]&&c[2]===yb[2]&&(c[3]||("http:"===c[1]?"80":"443"))===(yb[3]||("http:"===yb[1]?"80":"443")))),k.data&&k.processData&&"string"!=typeof k.data&&(k.data=m.param(k.data,k.traditional)),Mb(Hb,k,b,v),2===t)return v;h=m.event&&k.global,h&&0===m.active++&&m.event.trigger("ajaxStart"),k.type=k.type.toUpperCase(),k.hasContent=!Eb.test(k.type),e=k.url,k.hasContent||(k.data&&(e=k.url+=(wb.test(e)?"&":"?")+k.data,delete k.data),k.cache===!1&&(k.url=Bb.test(e)?e.replace(Bb,"$1_="+vb++):e+(wb.test(e)?"&":"?")+"_="+vb++)),k.ifModified&&(m.lastModified[e]&&v.setRequestHeader("If-Modified-Since",m.lastModified[e]),m.etag[e]&&v.setRequestHeader("If-None-Match",m.etag[e])),(k.data&&k.hasContent&&k.contentType!==!1||b.contentType)&&v.setRequestHeader("Content-Type",k.contentType),v.setRequestHeader("Accept",k.dataTypes[0]&&k.accepts[k.dataTypes[0]]?k.accepts[k.dataTypes[0]]+("*"!==k.dataTypes[0]?", "+Jb+"; q=0.01":""):k.accepts["*"]);for(d in k.headers)v.setRequestHeader(d,k.headers[d]);if(k.beforeSend&&(k.beforeSend.call(l,v,k)===!1||2===t))return v.abort();u="abort";for(d in{success:1,error:1,complete:1})v[d](k[d]);if(i=Mb(Ib,k,b,v)){v.readyState=1,h&&n.trigger("ajaxSend",[v,k]),k.async&&k.timeout>0&&(g=setTimeout(function(){v.abort("timeout")},k.timeout));try{t=1,i.send(r,x)}catch(w){if(!(2>t))throw w;x(-1,w)}}else x(-1,"No Transport");function x(a,b,c,d){var j,r,s,u,w,x=b;2!==t&&(t=2,g&&clearTimeout(g),i=void 0,f=d||"",v.readyState=a>0?4:0,j=a>=200&&300>a||304===a,c&&(u=Ob(k,v,c)),u=Pb(k,u,v,j),j?(k.ifModified&&(w=v.getResponseHeader("Last-Modified"),w&&(m.lastModified[e]=w),w=v.getResponseHeader("etag"),w&&(m.etag[e]=w)),204===a||"HEAD"===k.type?x="nocontent":304===a?x="notmodified":(x=u.state,r=u.data,s=u.error,j=!s)):(s=x,(a||!x)&&(x="error",0>a&&(a=0))),v.status=a,v.statusText=(b||x)+"",j?o.resolveWith(l,[r,x,v]):o.rejectWith(l,[v,x,s]),v.statusCode(q),q=void 0,h&&n.trigger(j?"ajaxSuccess":"ajaxError",[v,k,j?r:s]),p.fireWith(l,[v,x]),h&&(n.trigger("ajaxComplete",[v,k]),--m.active||m.event.trigger("ajaxStop")))}return v},getJSON:function(a,b,c){return m.get(a,b,c,"json")},getScript:function(a,b){return m.get(a,void 0,b,"script")}}),m.each(["get","post"],function(a,b){m[b]=function(a,c,d,e){return m.isFunction(c)&&(e=e||d,d=c,c=void 0),m.ajax({url:a,type:b,dataType:e,data:c,success:d})}}),m._evalUrl=function(a){return m.ajax({url:a,type:"GET",dataType:"script",async:!1,global:!1,"throws":!0})},m.fn.extend({wrapAll:function(a){if(m.isFunction(a))return this.each(function(b){m(this).wrapAll(a.call(this,b))});if(this[0]){var b=m(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&1===a.firstChild.nodeType)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){return this.each(m.isFunction(a)?function(b){m(this).wrapInner(a.call(this,b))}:function(){var b=m(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=m.isFunction(a);return this.each(function(c){m(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){m.nodeName(this,"body")||m(this).replaceWith(this.childNodes)}).end()}}),m.expr.filters.hidden=function(a){return a.offsetWidth<=0&&a.offsetHeight<=0||!k.reliableHiddenOffsets()&&"none"===(a.style&&a.style.display||m.css(a,"display"))},m.expr.filters.visible=function(a){return!m.expr.filters.hidden(a)};var Qb=/%20/g,Rb=/\[\]$/,Sb=/\r?\n/g,Tb=/^(?:submit|button|image|reset|file)$/i,Ub=/^(?:input|select|textarea|keygen)/i;function Vb(a,b,c,d){var e;if(m.isArray(b))m.each(b,function(b,e){c||Rb.test(a)?d(a,e):Vb(a+"["+("object"==typeof e?b:"")+"]",e,c,d)});else if(c||"object"!==m.type(b))d(a,b);else for(e in b)Vb(a+"["+e+"]",b[e],c,d)}m.param=function(a,b){var c,d=[],e=function(a,b){b=m.isFunction(b)?b():null==b?"":b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};if(void 0===b&&(b=m.ajaxSettings&&m.ajaxSettings.traditional),m.isArray(a)||a.jquery&&!m.isPlainObject(a))m.each(a,function(){e(this.name,this.value)});else for(c in a)Vb(c,a[c],b,e);return d.join("&").replace(Qb,"+")},m.fn.extend({serialize:function(){return m.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var a=m.prop(this,"elements");return a?m.makeArray(a):this}).filter(function(){var a=this.type;return this.name&&!m(this).is(":disabled")&&Ub.test(this.nodeName)&&!Tb.test(a)&&(this.checked||!W.test(a))}).map(function(a,b){var c=m(this).val();return null==c?null:m.isArray(c)?m.map(c,function(a){return{name:b.name,value:a.replace(Sb,"\r\n")}}):{name:b.name,value:c.replace(Sb,"\r\n")}}).get()}}),m.ajaxSettings.xhr=void 0!==a.ActiveXObject?function(){return!this.isLocal&&/^(get|post|head|put|delete|options)$/i.test(this.type)&&Zb()||$b()}:Zb;var Wb=0,Xb={},Yb=m.ajaxSettings.xhr();a.attachEvent&&a.attachEvent("onunload",function(){for(var a in Xb)Xb[a](void 0,!0)}),k.cors=!!Yb&&"withCredentials"in Yb,Yb=k.ajax=!!Yb,Yb&&m.ajaxTransport(function(a){if(!a.crossDomain||k.cors){var b;return{send:function(c,d){var e,f=a.xhr(),g=++Wb;if(f.open(a.type,a.url,a.async,a.username,a.password),a.xhrFields)for(e in a.xhrFields)f[e]=a.xhrFields[e];a.mimeType&&f.overrideMimeType&&f.overrideMimeType(a.mimeType),a.crossDomain||c["X-Requested-With"]||(c["X-Requested-With"]="XMLHttpRequest");for(e in c)void 0!==c[e]&&f.setRequestHeader(e,c[e]+"");f.send(a.hasContent&&a.data||null),b=function(c,e){var h,i,j;if(b&&(e||4===f.readyState))if(delete Xb[g],b=void 0,f.onreadystatechange=m.noop,e)4!==f.readyState&&f.abort();else{j={},h=f.status,"string"==typeof f.responseText&&(j.text=f.responseText);try{i=f.statusText}catch(k){i=""}h||!a.isLocal||a.crossDomain?1223===h&&(h=204):h=j.text?200:404}j&&d(h,i,j,f.getAllResponseHeaders())},a.async?4===f.readyState?setTimeout(b):f.onreadystatechange=Xb[g]=b:b()},abort:function(){b&&b(void 0,!0)}}}});function Zb(){try{return new a.XMLHttpRequest}catch(b){}}function $b(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}m.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/(?:java|ecma)script/},converters:{"text script":function(a){return m.globalEval(a),a}}}),m.ajaxPrefilter("script",function(a){void 0===a.cache&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),m.ajaxTransport("script",function(a){if(a.crossDomain){var b,c=y.head||m("head")[0]||y.documentElement;return{send:function(d,e){b=y.createElement("script"),b.async=!0,a.scriptCharset&&(b.charset=a.scriptCharset),b.src=a.url,b.onload=b.onreadystatechange=function(a,c){(c||!b.readyState||/loaded|complete/.test(b.readyState))&&(b.onload=b.onreadystatechange=null,b.parentNode&&b.parentNode.removeChild(b),b=null,c||e(200,"success"))},c.insertBefore(b,c.firstChild)},abort:function(){b&&b.onload(void 0,!0)}}}});var _b=[],ac=/(=)\?(?=&|$)|\?\?/;m.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var a=_b.pop()||m.expando+"_"+vb++;return this[a]=!0,a}}),m.ajaxPrefilter("json jsonp",function(b,c,d){var e,f,g,h=b.jsonp!==!1&&(ac.test(b.url)?"url":"string"==typeof b.data&&!(b.contentType||"").indexOf("application/x-www-form-urlencoded")&&ac.test(b.data)&&"data");return h||"jsonp"===b.dataTypes[0]?(e=b.jsonpCallback=m.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,h?b[h]=b[h].replace(ac,"$1"+e):b.jsonp!==!1&&(b.url+=(wb.test(b.url)?"&":"?")+b.jsonp+"="+e),b.converters["script json"]=function(){return g||m.error(e+" was not called"),g[0]},b.dataTypes[0]="json",f=a[e],a[e]=function(){g=arguments},d.always(function(){a[e]=f,b[e]&&(b.jsonpCallback=c.jsonpCallback,_b.push(e)),g&&m.isFunction(f)&&f(g[0]),g=f=void 0}),"script"):void 0}),m.parseHTML=function(a,b,c){if(!a||"string"!=typeof a)return null;"boolean"==typeof b&&(c=b,b=!1),b=b||y;var d=u.exec(a),e=!c&&[];return d?[b.createElement(d[1])]:(d=m.buildFragment([a],b,e),e&&e.length&&m(e).remove(),m.merge([],d.childNodes))};var bc=m.fn.load;m.fn.load=function(a,b,c){if("string"!=typeof a&&bc)return bc.apply(this,arguments);var d,e,f,g=this,h=a.indexOf(" ");return h>=0&&(d=m.trim(a.slice(h,a.length)),a=a.slice(0,h)),m.isFunction(b)?(c=b,b=void 0):b&&"object"==typeof b&&(f="POST"),g.length>0&&m.ajax({url:a,type:f,dataType:"html",data:b}).done(function(a){e=arguments,g.html(d?m("<div>").append(m.parseHTML(a)).find(d):a)}).complete(c&&function(a,b){g.each(c,e||[a.responseText,b,a])}),this},m.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(a,b){m.fn[b]=function(a){return this.on(b,a)}}),m.expr.filters.animated=function(a){return m.grep(m.timers,function(b){return a===b.elem}).length};var cc=a.document.documentElement;function dc(a){return m.isWindow(a)?a:9===a.nodeType?a.defaultView||a.parentWindow:!1}m.offset={setOffset:function(a,b,c){var d,e,f,g,h,i,j,k=m.css(a,"position"),l=m(a),n={};"static"===k&&(a.style.position="relative"),h=l.offset(),f=m.css(a,"top"),i=m.css(a,"left"),j=("absolute"===k||"fixed"===k)&&m.inArray("auto",[f,i])>-1,j?(d=l.position(),g=d.top,e=d.left):(g=parseFloat(f)||0,e=parseFloat(i)||0),m.isFunction(b)&&(b=b.call(a,c,h)),null!=b.top&&(n.top=b.top-h.top+g),null!=b.left&&(n.left=b.left-h.left+e),"using"in b?b.using.call(a,n):l.css(n)}},m.fn.extend({offset:function(a){if(arguments.length)return void 0===a?this:this.each(function(b){m.offset.setOffset(this,a,b)});var b,c,d={top:0,left:0},e=this[0],f=e&&e.ownerDocument;if(f)return b=f.documentElement,m.contains(b,e)?(typeof e.getBoundingClientRect!==K&&(d=e.getBoundingClientRect()),c=dc(f),{top:d.top+(c.pageYOffset||b.scrollTop)-(b.clientTop||0),left:d.left+(c.pageXOffset||b.scrollLeft)-(b.clientLeft||0)}):d},position:function(){if(this[0]){var a,b,c={top:0,left:0},d=this[0];return"fixed"===m.css(d,"position")?b=d.getBoundingClientRect():(a=this.offsetParent(),b=this.offset(),m.nodeName(a[0],"html")||(c=a.offset()),c.top+=m.css(a[0],"borderTopWidth",!0),c.left+=m.css(a[0],"borderLeftWidth",!0)),{top:b.top-c.top-m.css(d,"marginTop",!0),left:b.left-c.left-m.css(d,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||cc;while(a&&!m.nodeName(a,"html")&&"static"===m.css(a,"position"))a=a.offsetParent;return a||cc})}}),m.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,b){var c=/Y/.test(b);m.fn[a]=function(d){return V(this,function(a,d,e){var f=dc(a);return void 0===e?f?b in f?f[b]:f.document.documentElement[d]:a[d]:void(f?f.scrollTo(c?m(f).scrollLeft():e,c?e:m(f).scrollTop()):a[d]=e)},a,d,arguments.length,null)}}),m.each(["top","left"],function(a,b){m.cssHooks[b]=La(k.pixelPosition,function(a,c){return c?(c=Ja(a,b),Ha.test(c)?m(a).position()[b]+"px":c):void 0})}),m.each({Height:"height",Width:"width"},function(a,b){m.each({padding:"inner"+a,content:b,"":"outer"+a},function(c,d){m.fn[d]=function(d,e){var f=arguments.length&&(c||"boolean"!=typeof d),g=c||(d===!0||e===!0?"margin":"border");return V(this,function(b,c,d){var e;return m.isWindow(b)?b.document.documentElement["client"+a]:9===b.nodeType?(e=b.documentElement,Math.max(b.body["scroll"+a],e["scroll"+a],b.body["offset"+a],e["offset"+a],e["client"+a])):void 0===d?m.css(b,c,g):m.style(b,c,d,g)},b,f?d:void 0,f,null)}})}),m.fn.size=function(){return this.length},m.fn.andSelf=m.fn.addBack,"function"==typeof define&&define.amd&&define("jquery",[],function(){return m});var ec=a.jQuery,fc=a.$;return m.noConflict=function(b){return a.$===m&&(a.$=fc),b&&a.jQuery===m&&(a.jQuery=ec),m},typeof b===K&&(a.jQuery=a.$=m),m});
/Web Favorities/rss2.php
@@ -8,7 +8,7 @@
 
if (isset($_GET["catid"])) {
$catqstr="AND catid = ".intval($_GET["catid"]);
$qry="SELECT * FROM Fav WHERE id = ".$_GET["catid"];
$qry="SELECT * FROM Fav WHERE id = ".intval($_GET["catid"]);
$rs=sqlite_query($conn,$qry);
$row = sqlite_fetch_array($rs);
$homeTitle=$homeTitle." - ".$row["name"];
/Web Favorities/fav_footer.htm
@@ -2,6 +2,6 @@
<div align="right" style="font-size:8pt"><? echo $_SERVER["HTTP_USER_AGENT"];?></div>
<hr width="97%" noshade="noshade" />
<!-- Version and Credits **PLEASE DO NOT EDIT!** -->
<div align="right" style="font-size:8pt">My Web Favorities System 0.05c<br />
Copyright(C) 2004-2007 Roy</div>
<div align="right" style="font-size:8pt">My Web Favorities System 0.06<br />
Copyright(C) 2004-2017 Roy</div>
<!-- Version and Credits -->
/Web Favorities/fav_settings.php
@@ -4,7 +4,7 @@
session_register("pwd_session");
 
//Settings here:
$sqlite_file='./myfav.sdb';
$sqlite_file='./myfav.sdb3';
 
$FavPasswd="Fav_pass";
$ViewPassword="Fav+view";
/Web Favorities/fav_reorder.php
@@ -2,16 +2,20 @@
require("./fav_settings.php");
require("./fav_strings.php");
 
$conn=sqlite_popen($sqlite_file);
if($_GET['id']>0) {
$qry="SELECT name FROM Fav WHERE id=".$_GET['id'];
$container=sqlite_single_query($conn,$qry);
$db = new PDO('sqlite:./'.$sqlite_file, '', '', array(PDO::ATTR_PERSISTENT => true));
 
$getid=intval($_GET['id']);
if($getid>0) {
$qry="SELECT name FROM Fav WHERE id=".$getid;
$rs=$db->query($qry);
$container=$rs->fetchColumn();
} elseif($_GET['id']==-1) $container=$MyFav_Order_CatOrd;
else $container=$MyFav_Order_RootOrd;
 
$qry="SELECT id,name FROM Fav WHERE ".($_GET['id']==-1?'cat = 1':'catid='.$_GET['id']).(!$_GET['id']?' AND cat = 0':'')." ORDER BY ord,id";
$rs=sqlite_query($conn,$qry);
$rcnt=sqlite_num_rows($rs);
$qry='SELECT id,name,addr FROM Fav WHERE '.($getid==-1?'cat = 1':'catid='.$getid).(!$getid?' AND cat = 0':'').' ORDER BY ord,id';
$rs=$db->query($qry);
$row = $rs->fetchAll(PDO::FETCH_ASSOC);
$rcnt=count($row);
 
$MM_RedirectUrl=$homeURL.$SidebarSuffix1;
if (isset($_SESSION['isLogined']) && isset($_POST["MM_reorder"]) && $_POST["MM_reorder"]=="form1"){
@@ -19,8 +23,8 @@
$order=explode("|",$_POST['newOrder']);
array_pop($order);
foreach($order as $ord => $id)
$Command1_CommandText.="UPDATE Fav SET ord = ".sqlite_escape_string($ord)." WHERE id = ".sqlite_escape_string($id).";";
sqlite_exec($Command1_CommandText,$conn);
$Command1_CommandText.="UPDATE Fav SET ord = ".intval($ord)." WHERE id = ".intval($id).";";
$db->exec($Command1_CommandText,$conn);
 
header("Location: ".$MM_RedirectUrl);
exit();
@@ -83,8 +87,8 @@
<table>
<tr>
<td align="middle">';
echo ' <select id="ids" size="'.$rcnt.'">';
while($row2 = sqlite_fetch_array($rs)) {
echo ' <select id="ids" size="'.$rcnt.'" multiple="multiple">';
foreach($row as $row2) {
echo ' <option value="'.($row2["id"]).'" >'.$row2["name"].'</option>';
}
echo ' </select>
/Web Favorities/atom.php
@@ -8,7 +8,7 @@
 
if (isset($_GET["catid"])) {
$catqstr="AND catid = ".intval($_GET["catid"]);
$qry="SELECT * FROM Fav WHERE id = ".$_GET["catid"];
$qry="SELECT * FROM Fav WHERE id = ".intval($_GET["catid"]);
$rs=sqlite_query($conn,$qry);
$row = sqlite_fetch_array($rs);
$homeTitle=$homeTitle." - ".$row["name"];
/Web Favorities/fav_del.php
@@ -2,7 +2,7 @@
require("./fav_settings.php");
require("./fav_strings.php");
 
$Command1__varid=val($_POST,"id");
$Command1__varid=intval(val($_POST,"id"));
 
$Recordset1__MMColParam="1";
if (isset($_GET["id"])) $Recordset1__MMColParam=intval($_GET["id"]);
@@ -10,15 +10,15 @@
 
$MM_RedirectUrl=$homeURL.$SidebarSuffix1;
 
$conn=sqlite_popen($sqlite_file);
$qry="SELECT * FROM Fav WHERE id = ".sqlite_escape_string($Recordset1__MMColParam);
$rs=sqlite_query($conn,$qry);
$rcnt=sqlite_num_rows($rs);
$row = sqlite_fetch_array($rs);
$db = new PDO('sqlite:./'.$sqlite_file, '', '', array(PDO::ATTR_PERSISTENT => true));
$qry='SELECT * FROM Fav WHERE id = '.$Recordset1__MMColParam;
$rs=$db->query($qry);
$row = $rs->fetch(PDO::FETCH_ASSOC);
$rcnt=is_array($row) ? 1 : 0;
 
if (isset($_SESSION['isLogined']) && isset($_POST["MM_delete"]) && $_POST["MM_delete"]=="form1"){
$Command1_CommandText="DELETE FROM Fav WHERE id = ".sqlite_escape_string($Command1__varid);
sqlite_exec($Command1_CommandText,$conn);
$Command1_CommandText="DELETE FROM Fav WHERE id = ".$Command1__varid;
$db->qexec($Command1_CommandText);
header("Location: ".$MM_RedirectUrl);
exit();
} elseif (isset($_POST["MM_delete"]) && $_POST["MM_delete"]!=""){